@charset "UTF-8";
html, body, div, span, object, iframe, h1, h2, h3, h4, h5, h6, p, blockquote, pre, abbr, address, cite, code, del, dfn, em, img, ins, kbd, q, samp, small, strong, sub, sup, var, b, i, dl, dt, dd, ol, ul, li, fieldset, form, label, legend, table, caption, tbody, tfoot, thead, tr, th, td, article, aside, canvas, details, figcaption, figure, footer, header, hgroup, menu, nav, section, summary, time, mark, audio, video {
  margin: 0;
  padding: 0;
  border: 0;
  outline: 0;
  font-size: 100%;
  vertical-align: baseline;
  background: transparent;
  -webkit-text-size-adjust: none;
}

html {
  line-height: 1;
  font-size: 100%;
}

article, aside, details, figcaption, figure, footer, header, hgroup, menu, nav, section, main {
  display: block;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

ul {
  list-style: none;
}

td, th {
  vertical-align: top;
}

a {
  text-decoration: none;
}

table {
  border-collapse: separate;
  border-spacing: 0;
}

caption, th, td {
  text-align: left;
  font-weight: normal;
}

blockquote:before, blockquote:after, q:before, q:after {
  content: "";
}

blockquote, q {
  quotes: "" "";
}

strong, b {
  font-weight: bold;
}

em, i {
  font-style: italic;
}

ins {
  background-color: #ff9;
  color: #000;
  text-decoration: none;
}

mark {
  background-color: #ff9;
  color: #000;
  font-style: italic;
  font-weight: bold;
}

del {
  text-decoration: line-through;
}

abbr[title], dfn[title] {
  border-bottom: 1px dotted;
  cursor: help;
}

table {
  border-collapse: collapse;
  border-spacing: 0;
}

hr {
  display: block;
  height: 1px;
  border: 0;
  border-top: 1px solid #cccccc;
  margin: 1em 0;
  padding: 0;
}

input[type=submit], select {
  vertical-align: middle;
  outline: none;
  -webkit-appearance: none;
}

textarea {
  outline: none;
}

/* STRUCTURE 
Variables
Mixins
Base tags 
*/
/* colors in stylesheet 
#17639f
#289e30
#2a7c10
#2d862d
#313435
#333333
#3E817F
#3c3c3c
#404040
#454545
#490f46
#4A4A4A
#4D3040
#4f5255
#50164e
#56595d
#565a5d
#5D7E95
#611f5e
#655c89
#66afe9
#6d2769
#6d286a
#777b7c
#782b75
#7A7449
#7D755E
#823133
#96d89a
#979797

#9D967E
#9f429b
#AD3CAA
#C4CACC
#DCAA00
#b149ad
#b21d23
#b3b3b3
#bdc0c2
#bfdef6
#c4c4c4
#c9c9c9
#cccccc
#d8d8d8
#d8d9da
#da532c
#dadada
#e0f3e1
#e5e5e5
#e5e6e7
#e6dee5
#ebebeb
#ebeced
#ecf5fc
#efefef
#f0efec
#f2f2f2
#f2f3f3
#f5f5f5
#f79c33
#ffffff
*/
body#debug:before {
  position: fixed;
  top: 5px;
  left: 5px;
  z-index: 2000;
  background: rgba(0, 0, 0, 0.5);
  color: #fff;
  font-size: 0.6em;
  margin: 0;
  padding: 0;
  height: 20px;
  line-height: 20px;
  padding: 0 6px;
}
@media only screen and (min-width: 1301px) {
  body#debug:before {
    content: "super";
  }
}
@media only screen and (max-width: 1300px) {
  body#debug:before {
    content: "wide";
  }
}
@media only screen and (max-width: 1000px) {
  body#debug:before {
    content: "desktop";
  }
}
@media only screen and (max-width: 820px) {
  body#debug:before {
    content: "narrow";
  }
}
@media only screen and (max-width:700px) {
  body#debug:before {
    content: "narrower";
  }
}
@media only screen and (max-width: 500px) {
  body#debug:before {
    content: "mobile";
  }
}

/* Box-sizing messes up some existing styles */
html {
  scroll-behavior: smooth;
}

body {
  /* Resolves font visual sizing issues */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
  font-family: MuseoSans, sans-serif;
}
body a.skip {
  color: #565a5d;
  background-color: #fff;
  position: absolute;
  top: -40px;
  left: 0px;
  padding: 5px;
  -webkit-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
  z-index: 1000;
}
body a.skip:focus {
  top: 0;
}
body .visuallyhidden {
  border: 0;
  clip: rect(1px, 1px, 1px, 1px);
  -webkit-clip-path: inset(50%);
          clip-path: inset(50%);
  height: 1px;
  margin: -1px;
  overflow: hidden;
  padding: 0;
  position: absolute !important;
  width: 1px;
  word-wrap: normal !important;
}
body .remove {
  display: none;
}

.content a[href$=".pdf"]:not(.btn):after,
a[href$=".pdf"]::after {
  content: "\e90f";
  position: relative;
  width: auto;
  background-color: transparent;
  opacity: 1;
  font-size: 1em;
  font-family: "icons";
  display: inline-block;
  position: relative;
  margin-left: 5px;
  height: 0px !important;
}

.content a.noicon[href$=".pdf"]:not(.btn):after,
a.noicon[href$=".pdf"]::after {
  content: " ";
}

.clearfix:after, .container:after, .digestivecare_sections:after, .related:after, .subnav:after, .homeImg:after, .home .column50:after, .newsItem:after, .btn-sticky:after, .form__row:after, .intForm__title:after, .leader-grid:after, .leader__header:after, .contact-info:after, .feed__item:after, .physician__content:after, .physician-detail__img:after, .location:after, .mainText .provider:after, .mainText .provider__item:after, .alert:after, .clearfix:before, .container:before, .digestivecare_sections:before, .related:before, .subnav:before, .homeImg:before, .home .column50:before, .newsItem:before, .btn-sticky:before, .form__row:before, .intForm__title:before, .leader-grid:before, .leader__header:before, .contact-info:before, .feed__item:before, .physician__content:before, .physician-detail__img:before, .location:before, .mainText .provider:before, .mainText .provider__item:before, .alert:before {
  content: "";
  display: table;
}

.clearfix:after, .container:after, .digestivecare_sections:after, .related:after, .subnav:after, .homeImg:after, .home .column50:after, .newsItem:after, .btn-sticky:after, .form__row:after, .intForm__title:after, .leader-grid:after, .leader__header:after, .contact-info:after, .feed__item:after, .physician__content:after, .physician-detail__img:after, .location:after, .mainText .provider:after, .mainText .provider__item:after, .alert:after {
  clear: both;
}

.skip {
  position: absolute;
  left: -9999px;
  width: 1px;
  height: 1px;
  overflow: hidden;
  width: 600px;
  color: #FFF;
}

.skip:focus, .skip:active {
  position: static;
  width: auto;
  height: auto;
  left: 0px;
  margin-right: 10px;
}

.noreveal:focus, .noreveal:active {
  position: absolute;
  left: -9999px;
  width: 1px;
  height: 1px;
  overflow: hidden;
  width: 600px;
  color: #FFF;
}

.access, .element-invisible {
  position: absolute;
  left: -9999px;
  width: 1px;
  height: 1px;
  overflow: hidden;
}

.forPrint {
  display: none;
}

button, input[type=submit], label[for], [tabindex="0"] {
  cursor: pointer;
  border-radius: 0;
}

button {
  padding: 0;
  border: 0;
  border-radius: 0;
  background: none;
}

button::-moz-focus-inner {
  border: 0;
  padding: 0;
}

textarea {
  resize: vertical;
}

img {
  max-width: 100%;
  height: auto;
}

figure.wp-block-embed.is-type-video.is-provider-youtube.wp-block-embed-youtube.wp-embed-aspect-16-9 .wp-block-embed__wrapper {
  position: relative;
  padding-bottom: 56.25%;
  padding-top: 25px;
  height: 0;
}

figure.wp-block-embed.is-type-video.is-provider-youtube.wp-block-embed-youtube.wp-embed-aspect-16-9 iframe {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

/* 
WHEN UPDATING FONTS FROM ICOMOON, ALSO UPDATE THE ACF-ICON-FONT PLUGIN WITH NEW TTF/WOFF/SVG FILES ALONG WITH EDITING FONT-INFO.JSON AND ET-LINE.CSS
*/
@font-face {
  font-family: "icons";
  src: url("../fonts/icons.ttf?gjcb0d") format("truetype"), url("../fonts/icons.woff?gjcb0d") format("woff"), url("../fonts/icons.svg?gjcb0d#icons") format("svg");
  font-weight: normal;
  font-style: normal;
  font-display: block;
}
/* Use the following CSS code if you want to use data attributes for inserting your icons */
[data-icon]:before {
  content: attr(data-icon);
  font-family: "icons" !important;
  speak: never;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  /* Better Font Rendering =========== */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

/* Use the following CSS code if you want to have a class per icon */
/*
Instead of a list of all class selectors,
you can use the generic selector below, but it's slower:
[class*="icon-"] {
*/
.icon-compass, .icon-search, .icon-clock, .icon-arrow-left, .icon-arrow-down, .icon-arrow-up, .icon-arrow-right, .icon-twitter, .icon-facebook, .icon-play, .icon-calendar, .icon-warning2, .icon-location2, .icon-clipboard2, .icon-circle, .icon-map, .icon-alarm, .icon-payment, .icon-lock, .icon-pin, .icon-calendar-plus, .icon-plus, .icon-minus, .icon-close, .icon-credit, .icon-calendar-check, .icon-doctor, .icon-arrow-right2, .icon-arrow-right-slim, .icon-clipboard, .icon-building, .icon-office, .icon-warning, .icon-pdf, .icon-facebook2, .icon-article, .icon-lotus, .icon-doc, .icon-cough, .icon-external, .icon-arrow-down-slim, .icon-email, .icon-piggy, .icon-twitter-o, .icon-apple, .icon-infographic, .icon-video, .icon-feed, .icon-caduceus, .icon-pencil, .icon-book, .icon-offerings, .icon-chart, .icon-coin-dollar, .icon-phone, .icon-phone1, .icon-phone-hang-up, .icon-address-book, .icon-envelop, .icon-location, .icon-locationpin, .icon-locationpin2, .icon-mapfold, .icon-mapfoldoutline, .icon-alarm1, .icon-bell, .icon-stopwatch, .icon-calendar1, .icon-display, .icon-laptop, .icon-mobile, .icon-tablet, .icon-tv, .icon-bubbles, .icon-bubbles2, .icon-user, .icon-users, .icon-user-tie, .icon-quotes-left, .icon-quotes-right, .icon-spinner6, .icon-stats-dots, .icon-stats-bars, .icon-briefcase, .icon-clipboard1, .icon-cloud, .icon-star-empty, .icon-star-full, .icon-warning1, .icon-notification, .icon-info, .icon-playwcircle, .icon-pause, .icon-stop, .icon-circle-up, .icon-circle-right, .icon-circle-down, .icon-circle-left, .icon-file-pdf, .icon-file-word, .icon-file-excel, .icon-home, .icon-twitter-sq, .icon-facebook-sq, .icon-google-plus-sq, .icon-hospital, .icon-medkit, .icon-h-sq, .icon-plus-sq, .icon-check, .icon-provider {
  font-family: "icons";
  speak: none;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
  display: inline-block;
}

/* ----- icon font ----- */
.icon-compass:before {
  content: "\e600";
}

.icon-search:before {
  content: "\e601";
}

.icon-clock:before {
  content: "\e602";
}

.icon-arrow-left:before {
  content: "\e603";
}

.icon-arrow-down:before {
  content: "\e604";
}

.icon-arrow-up:before {
  content: "\e605";
}

.icon-arrow-right:before {
  content: "\e606";
}

.icon-twitter:before {
  content: "\e607";
}

.icon-facebook:before {
  content: "\e608";
}

.icon-play:before {
  content: "\e609";
}

.icon-calendar:before {
  content: "\e60a";
}

.icon-warning2:before {
  content: "\e60b";
}

.icon-location2:before {
  content: "\e60c";
}

.icon-clipboard2:before {
  content: "\e60d";
}

.icon-circle:before {
  content: "\e60e";
}

.icon-map:before {
  content: "\e60f";
}

.icon-alarm:before {
  content: "\e610";
}

.icon-payment:before {
  content: "\e611";
}

.icon-lock:before {
  content: "\e900";
}

.icon-pin:before {
  content: "\e901";
}

.icon-calendar-plus:before {
  content: "\e902";
}

.icon-plus:before {
  content: "\e903";
}

.icon-minus:before {
  content: "\e904";
}

.icon-close:before {
  content: "\e905";
}

.icon-credit:before {
  content: "\e906";
}

.icon-calendar-check:before {
  content: "\e907";
}

.icon-doctor:before {
  content: "\e908";
}

.icon-arrow-right2:before {
  content: "\e909";
}

.icon-arrow-right-slim:before {
  content: "\e90a";
}

.icon-clipboard:before {
  content: "\e90b";
}

.icon-building:before {
  content: "\e90c";
}

.icon-office:before {
  content: "\e90d";
}

.icon-warning:before {
  content: "\e90e";
}

.icon-pdf:before {
  content: "\e90f";
}

.icon-facebook2:before {
  content: "\e910";
}

.icon-article:before {
  content: "\e911";
}

.icon-lotus:before {
  content: "\e912";
}

.icon-doc:before {
  content: "\e913";
}

.icon-cough:before {
  content: "\e914";
}

.icon-external:before {
  content: "\e915";
}

.icon-arrow-down-slim:before {
  content: "\e916";
}

.icon-email:before {
  content: "\e917";
}

.icon-piggy:before {
  content: "\e918";
}

.icon-twitter-o:before {
  content: "\e919";
}

.icon-apple:before {
  content: "\e91a";
}

.icon-infographic:before {
  content: "\e91b";
}

.icon-video:before {
  content: "\e91c";
}

.icon-feed:before {
  content: "\e91d";
}

.icon-caduceus:before {
  content: "\e91e";
}

.icon-pencil:before {
  content: "\e91f";
}

.icon-book:before {
  content: "\e920";
}

.icon-offerings:before {
  content: "\e92a";
}

.icon-chart:before {
  content: "\e933";
}

.icon-coin-dollar:before {
  content: "\e93b";
}

.icon-phone:before {
  content: "\e942";
}

.icon-phone1:before {
  content: "\e943";
}

.icon-phone-hang-up:before {
  content: "\e944";
}

.icon-address-book:before {
  content: "\e945";
}

.icon-envelop:before {
  content: "\e946";
}

.icon-location:before {
  content: "\e947";
}

.icon-locationpin:before {
  content: "\e948";
}

.icon-locationpin2:before {
  content: "\e949";
}

.icon-mapfold:before {
  content: "\e94b";
}

.icon-mapfoldoutline:before {
  content: "\e94c";
}

.icon-alarm1:before {
  content: "\e950";
}

.icon-bell:before {
  content: "\e951";
}

.icon-stopwatch:before {
  content: "\e952";
}

.icon-calendar1:before {
  content: "\e953";
}

.icon-display:before {
  content: "\e956";
}

.icon-laptop:before {
  content: "\e957";
}

.icon-mobile:before {
  content: "\e958";
}

.icon-tablet:before {
  content: "\e95a";
}

.icon-tv:before {
  content: "\e95b";
}

.icon-bubbles:before {
  content: "\e96c";
}

.icon-bubbles2:before {
  content: "\e96d";
}

.icon-user:before {
  content: "\e971";
}

.icon-users:before {
  content: "\e972";
}

.icon-user-tie:before {
  content: "\e976";
}

.icon-quotes-left:before {
  content: "\e977";
}

.icon-quotes-right:before {
  content: "\e978";
}

.icon-spinner6:before {
  content: "\e97f";
}

.icon-stats-dots:before {
  content: "\e99b";
}

.icon-stats-bars:before {
  content: "\e99c";
}

.icon-briefcase:before {
  content: "\e9ae";
}

.icon-clipboard1:before {
  content: "\e9b8";
}

.icon-cloud:before {
  content: "\e9c1";
}

.icon-star-empty:before {
  content: "\e9d7";
}

.icon-star-full:before {
  content: "\e9d9";
}

.icon-warning1:before {
  content: "\ea07";
}

.icon-notification:before {
  content: "\ea08";
}

.icon-info:before {
  content: "\ea0c";
}

.icon-playwcircle:before {
  content: "\ea15";
}

.icon-pause:before {
  content: "\ea16";
}

.icon-stop:before {
  content: "\ea17";
}

.icon-circle-up:before {
  content: "\ea41";
}

.icon-circle-right:before {
  content: "\ea42";
}

.icon-circle-down:before {
  content: "\ea43";
}

.icon-circle-left:before {
  content: "\ea44";
}

.icon-file-pdf:before {
  content: "\eadf";
}

.icon-file-word:before {
  content: "\eae1";
}

.icon-file-excel:before {
  content: "\eae2";
}

.icon-home:before {
  content: "\f015";
}

.icon-twitter-sq:before {
  content: "\f081";
}

.icon-facebook-sq:before {
  content: "\f082";
}

.icon-google-plus-sq:before {
  content: "\f0d4";
}

.icon-hospital:before {
  content: "\f0f8";
}

.icon-medkit:before {
  content: "\f0fa";
}

.icon-h-sq:before {
  content: "\f0fd";
}

.icon-plus-sq:before {
  content: "\f0fe";
}

.icon-check:before {
  content: "\f14a";
}

.icon-provider:before {
  content: "\e921";
}

@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-300-webfont.eot");
  src: url("../fonts/museosans-300-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-300-webfont.woff") format("woff"), url("../fonts/museosans-300-webfont.ttf") format("truetype"), url("../fonts/museosans-300-webfont.svg#museo_sans_300regular") format("svg");
  font-weight: normal;
  font-style: normal;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-300italic-webfont.eot");
  src: url("../fonts/museosans-300italic-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-300italic-webfont.woff") format("woff"), url("../fonts/museosans-300italic-webfont.ttf") format("truetype"), url("../fonts/museosans-300italic-webfont.svg#museo_sans_300italic") format("svg");
  font-weight: normal;
  font-style: italic;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-500-webfont.eot");
  src: url("../fonts/museosans-500-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-500-webfont.woff") format("woff"), url("../fonts/museosans-500-webfont.ttf") format("truetype"), url("../fonts/museosans-500-webfont.svg#museo_sans_500regular") format("svg");
  font-weight: 500;
  font-style: normal;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-500italic-webfont.eot");
  src: url("../fonts/museosans-500italic-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-500italic-webfont.woff") format("woff"), url("../fonts/museosans-500italic-webfont.ttf") format("truetype"), url("../fonts/museosans-500italic-webfont.svg#museo_sans_500italic") format("svg");
  font-weight: 500;
  font-style: italic;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-700-webfont.eot");
  src: url("../fonts/museosans-700-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-700-webfont.woff") format("woff"), url("../fonts/museosans-700-webfont.ttf") format("truetype"), url("../fonts/museosans-700-webfont.svg#museo_sans_700regular") format("svg");
  font-weight: 700;
  font-style: normal;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-700italic-webfont.eot");
  src: url("../fonts/museosans-700italic-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-700italic-webfont.woff") format("woff"), url("../fonts/museosans-700italic-webfont.ttf") format("truetype"), url("../fonts/museosans-700italic-webfont.svg#museo_sans_700italic") format("svg");
  font-weight: 700;
  font-style: italic;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans_900-webfont.eot");
  src: url("../fonts/museosans_900-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans_900-webfont.woff") format("woff"), url("../fonts/museosans_900-webfont.ttf") format("truetype"), url("../fonts/museosans_900-webfont.svg#museo_sans900") format("svg");
  font-weight: 900;
  font-style: normal;
}
@font-face {
  font-family: "MuseoSans";
  src: url("../fonts/museosans-900italic-webfont.eot");
  src: url("../fonts/museosans-900italic-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/museosans-900italic-webfont.woff") format("woff"), url("../fonts/museosans-900italic-webfont.ttf") format("truetype"), url("../fonts/museosans-900italic-webfont.svg#museo_sans900_italic") format("svg");
  font-weight: 900;
  font-style: italic;
}
/* ----- Museo Sans ----- */
html, body {
  height: 100%;
  font-family: "MuseoSans", sans-serif;
  color: #565a5d;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.page-header {
  width: 100%;
  height: 130px;
  position: relative;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin-bottom: 30px;
}

.page-header .logo {
  max-width: 115px;
  margin: 13px 0 0 0;
}

.page-header .logo img {
  opacity: 1;
}

.page-header .logo:hover img {
  opacity: 0.7;
}

.mobileBtn {
  position: absolute;
  top: -5px;
  right: 9px;
  z-index: 4;
}

.subnav__content {
  float: right;
  display: none;
  width: 100%;
}

.subnav__links {
  top: 0;
  right: 60px;
  height: 50px;
  position: absolute;
  text-align: right;
  z-index: 2;
}

.subnav__link {
  background: #6d276a;
  font-size: 1.4em;
  width: auto;
  max-height: 50px;
  line-height: 50px;
  margin: 0 0 0 -3px;
  text-align: center;
  padding: 0 15px;
  color: rgba(255, 255, 255, 0.85);
  text-decoration: none;
  display: inline-block;
  vertical-align: top;
  position: relative;
  font-weight: 500;
  letter-spacing: 0.025em;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  border-left: 1px solid #50164e;
}

.subnav__link:hover, .subnav__link:focus {
  background: #611f5e;
}

.subnav__link:last-child {
  margin-right: 0;
}

.subnav__link [class^=icon-] {
  display: block;
  position: absolute;
  text-align: center;
  width: 100%;
  left: 0;
  font-size: 1.6em;
  opacity: 0;
  color: #b149ad;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
}

.subnav__link.selected {
  background: #50164e;
}

.subnav__link.selected, .subnav__link:hover, .subnav__link:focus {
  padding-top: 11px;
  line-height: 70px;
  max-height: 70px;
}

.subnav__link.selected [class^=icon-], .subnav__link:hover [class^=icon-], .subnav__link:focus [class^=icon-] {
  opacity: 1;
}

.subnav__btn.btn {
  position: absolute !important;
  bottom: -130px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  width: calc(100% - 60px);
  z-index: 3;
  padding-top: 12px;
  padding-bottom: 12px;
  font-size: 1.4em;
}

.navMain {
  display: none;
  position: absolute;
  right: 0;
  bottom: 0;
  width: calc(100% - 250px);
}

.navMain__item {
  -ms-flex: 0 1 auto;
  -webkit-box-flex: 0;
          flex: 0 1 auto;
  display: block;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
  position: relative;
}

.navMain__item:hover .navMain__link {
  margin-top: -6px;
}

.navMain__link {
  padding: 15px 25px;
  position: relative;
  display: block;
  vertical-align: top;
  font-weight: 500;
  color: #565a5d;
  font-size: 1.4em;
  line-height: 1.2;
  width: auto;
  height: 100%;
  position: relative;
  text-decoration: none;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
}

.selected .navMain__link, .selected-parent .navMain__link {
  color: #2d862d;
}

.navMain .subMenu {
  position: absolute;
  top: 56px;
  left: 0;
  width: 225px;
  max-height: 0;
  overflow: hidden;
  display: block;
  background: #404040;
  z-index: 50;
}

.navMain .subMenu__item:first-of-type a {
  border: 0;
}

.navMain .subMenu__item.selected a {
  background: #565a5d;
}

.navMain .subMenu__link {
  color: #fff;
  padding: 17px 23px;
  border-top: 1px solid #666;
  -webkit-transition: all 0.5s ease;
  transition: all 0.5s ease;
  display: block;
  font-size: 1.4em;
  font-weight: 500;
}

.navMain .subMenu__link:hover {
  background: #565a5d;
}

.brand-tagline {
  display: none;
  background: #e6dee5;
  padding: 20px 0;
  border-bottom: 1px solid rgba(109, 39, 106, 0.5);
  text-align: center;
  overflow: hidden;
}

.brand-tagline__text {
  display: inline-block;
  text-align: center;
  color: #6d276a;
  text-transform: uppercase;
  letter-spacing: 1.5px;
  font-size: 2em;
  font-weight: 500;
  position: relative;
}

.brand-tagline__text:before, .brand-tagline__text:after {
  content: "";
  position: absolute;
  width: 200%;
  height: 1px;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  background: rgba(109, 39, 106, 0.3);
  margin: 0 20px;
}

.brand-tagline__text:before {
  right: 100%;
}

.brand-tagline__text:after {
  left: 100%;
}

@media screen and (min-width: 640px) {
  .subnav__btn.btn {
    left: auto;
    right: 90px;
    width: auto;
    bottom: auto;
    top: 15px;
    -webkit-transform: none;
            transform: none;
  }
}
@media screen and (min-width: 768px) {
  .mobileBtn {
    right: 25px;
  }
  .subnav__btn.btn {
    right: 120px;
  }
}
@media screen and (min-width: 1024px) {
  .page-header .logo {
    display: inline-block;
    max-width: 204px;
  }
  .mobileBtn {
    display: none;
  }
  .subnav {
    background: #6d276a;
    min-height: 50px;
  }
  .subnav__content {
    display: block;
  }
  .subnav__btn.btn {
    right: auto;
    left: 20px;
    top: 5px;
  }
  .navMain {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
  }
}
.navMain__link:before {
  content: "";
  position: absolute;
  left: 2px;
  top: 0px;
  width: 1px;
  height: 56px;
  background: #e5e5e5;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
  display: block;
}

.navMain__link:after {
  content: "";
  position: absolute;
  bottom: 0;
  left: 0;
  width: calc(100% - 2px);
  height: calc(100% - 2px);
  background: #fff;
  z-index: -1;
  opacity: 0;
  -webkit-transition: opacity 0.25s ease;
  transition: opacity 0.25s ease;
  border: 2px solid #2d862d;
  display: block;
}

.current-menu-item .navMain__link:before,
.navMain__item:hover .navMain__link:before {
  top: 0;
  display: none;
}

.current-page-ancestor .navMain__link:after,
.current-menu-item .navMain__link:after {
  opacity: 1;
}

.navMain__item:hover .navMain__link:after,
.navMain__link:hover:after {
  opacity: 1;
}

.navMain__item:focus-within .navMain__link:after {
  opacity: 1;
}

.navMain__item:hover .subMenu {
  max-height: 2000px;
  overflow: visible;
  height: auto;
}

.navMain__item:focus-within .subMenu {
  max-height: 2000px;
  overflow: visible;
  height: auto;
}

.navMain__link:hover + .subMenu {
  max-height: 2000px;
  overflow: visible;
  height: auto;
}

.page-footer {
  position: relative;
  clear: both;
  background: -webkit-gradient(linear, left top, left bottom, from(#565A5D), to(#313435));
  background: linear-gradient(180deg, #565A5D 0%, #313435 100%);
  padding: 60px 0;
  margin: 0px;
}
.page-footer .container .row-grid, .page-footer .digestivecare_sections .row-grid, .page-footer .related .row-grid {
  display: -ms-grid;
  display: grid;
  -ms-grid-columns: 2fr 20px 3fr 20px 3fr 20px 2fr;
  grid-template-columns: 2fr 3fr 3fr 2fr;
  grid-gap: 20px;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin-bottom: 20px;
}
@media screen and (max-width: 900px) {
  .page-footer .container .row-grid, .page-footer .digestivecare_sections .row-grid, .page-footer .related .row-grid {
    -ms-grid-columns: 1fr;
    grid-template-columns: 1fr;
  }
}
.page-footer .container .col .logo, .page-footer .digestivecare_sections .col .logo, .page-footer .related .col .logo {
  width: 160px;
  height: 75px;
  display: block;
  margin: auto;
  margin-bottom: 20px;
}
.page-footer .container .col .call-out, .page-footer .digestivecare_sections .col .call-out, .page-footer .related .col .call-out {
  background-color: rgba(0, 0, 0, 0.2);
  padding: 15px;
  border-radius: 10px;
  min-height: 130px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  justify-items: center;
  text-align: center;
}
@media screen and (max-width: 900px) {
  .page-footer .container .col .call-out, .page-footer .digestivecare_sections .col .call-out, .page-footer .related .col .call-out {
    display: block;
    min-height: auto;
  }
}
.page-footer .container .col .call-out p, .page-footer .digestivecare_sections .col .call-out p, .page-footer .related .col .call-out p {
  margin: 0;
  padding: 10px 0;
}
.page-footer .container .col .call-out .btn, .page-footer .digestivecare_sections .col .call-out .btn, .page-footer .related .col .call-out .btn {
  margin-top: 10px;
  font-size: 13px;
  padding: 12px 20px;
  border-radius: 10px;
}
.page-footer .container .col p, .page-footer .digestivecare_sections .col p, .page-footer .related .col p {
  color: #fff;
  font-size: 12px;
  line-height: 1.4em;
  margin-bottom: 10px;
}
.page-footer .container .col a, .page-footer .digestivecare_sections .col a, .page-footer .related .col a {
  color: #fff;
}
.page-footer .text {
  clear: both;
  display: block;
  margin-top: 100px;
  font-size: 1.4em;
}
.page-footer p {
  color: #fff;
  line-height: 1.1em;
  margin-bottom: 10px;
}
.page-footer p strong {
  font-size: 1.05em;
}
.page-footer--alt {
  margin-top: 0px;
}
.page-footer--alt .topLinks a:link, .page-footer--alt .topLinks a:visited {
  color: #fff;
  border-color: #fff;
}
.page-footer--alt .topLinks a:hover, .page-footer--alt .topLinks a:visited:hover {
  color: rgba(255, 255, 255, 0.5);
}

.social-label {
  color: #fff;
  font-size: 12px;
  margin-bottom: 10px;
  text-align: center;
}

.social {
  max-height: 50px;
  max-width: 200px;
  width: auto;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: space-evenly;
      -ms-flex-pack: space-evenly;
          justify-content: space-evenly;
  margin: auto;
}
.social a {
  font-size: 30px;
  display: inline-block;
  vertical-align: top;
  width: auto;
  height: 100%;
  text-align: center;
  text-decoration: none;
  margin: 0;
  color: #fff;
  color: rgba(255, 255, 255, 0.5);
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
}
.social a span {
  -webkit-transition: all 300ms linear;
  transition: all 300ms linear;
}
.social a:hover span {
  color: #ccc;
}
.social a:last-child {
  margin-right: 0;
}

.text-center {
  text-align: center;
}

.bottom-links a {
  padding: 0px 10px;
}
.bottom-links a:hover {
  text-decoration: underline;
}

body {
  position: relative;
  font-size: 62.5%;
}

.container, .digestivecare_sections, .related {
  max-width: 1180px;
  margin: 0 auto;
  padding: 0 30px;
  position: relative;
}

.container--sm {
  max-width: 700px;
}

.container--md {
  max-width: 800px;
  margin: 0 auto;
}

.container--top {
  padding-top: 50px;
}

.has-menu-active {
  overflow: hidden;
}

.page-wrap {
  -webkit-transform: translateX(0);
          transform: translateX(0);
  -webkit-transition: -webkit-transform 0.3s;
  transition: -webkit-transform 0.3s;
  transition: transform 0.3s;
  transition: transform 0.3s, -webkit-transform 0.3s;
}

.page-wrap.has-push-right {
  position: fixed;
  overflow: hidden;
  -webkit-overflow-scrolling: touch;
}

.has-push-right {
  -webkit-transform: translateX(-100%);
          transform: translateX(-100%);
}

.menu-push-right {
  position: fixed;
  height: 100%;
  overflow-y: scroll;
  top: 0;
  right: 0;
  -webkit-transform: translateX(100%);
          transform: translateX(100%);
  -webkit-transition: -webkit-transform 0.3s;
  transition: -webkit-transform 0.3s;
  transition: transform 0.3s;
  transition: transform 0.3s, -webkit-transform 0.3s;
}

.menu-push-right.is-active {
  -webkit-transform: translateX(0);
          transform: translateX(0);
}

nav#sideMenu.onload {
  display: none !important;
  visibility: hidden !important;
}

.info-col {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-pack: start;
  -webkit-box-pack: start;
          justify-content: flex-start;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
}

.info-col__item {
  display: block;
  width: 100%;
}

.flex-content, .locations, .callout_about {
  width: 100%;
  margin-bottom: 40px;
}

.flex-content--home {
  width: calc(100% - 60px);
  margin-top: 45px;
  margin-bottom: 45px;
  position: relative;
}

.flex-content--home:after {
  position: absolute;
  bottom: -55px;
  left: 0;
  background: url("../../webimages/homeImg-shadow.png") no-repeat 50% 0;
  width: 100%;
  height: 16px;
  background-size: contain;
}

.flex-content--home img {
  display: block;
  margin: 20px auto;
}

.flex-content--home .btn + .btn {
  margin-top: 20px;
}

.flex-content__side {
  min-width: 275px;
}

#main {
  position: relative;
  height: 100%;
}

.red {
  color: #b21d23;
}

.birthday {
  color: #2d862d;
  font-size: 1.7em;
  line-height: 120%;
  margin-bottom: 10px;
}

/* ---- main content/general ---- */
a[href^=tel] {
  color: #565a5d;
}

a[href^=tel].btn-phone {
  display: block;
}

/* styled select menu */
.styled-select {
  height: auto;
  background: url("../../webimages/select-arrow-alt.png") no-repeat 100% 50% #fff;
  border: 1px solid #e5e6e7;
  -moz-appearance: none;
  -ms-appearance: none;
  -webkit-appearance: none;
  appearance: none;
  color: #565a5d;
}

.styled-select::-ms-expand {
  display: none;
}

.ie9 .styled-select {
  background-image: none;
}

.styled-select select {
  padding: 14px 15px;
  height: auto;
  font: 14px "MuseoSans500", sans-serif;
  color: #565a5d;
  background: none;
  border: none;
  width: 100%;
}

.styled-select.midWidth {
  width: 65%;
  display: inline-block;
  float: left;
  margin-right: 10px;
}

.styled-select.midWidth + a.button:link, .styled-select.midWidth + a.button:visited {
  height: 30px;
  margin: 0;
  line-height: 31px;
}

.styled-select.midWidth + a.button span {
  height: 30px;
  line-height: 30px;
}

.styled-select-multiple {
  width: 50%;
  min-width: auto !important;
}

.styled-select-multiple select {
  width: 315px;
  min-height: 100px;
  font-weight: 500;
  padding: 0.5%;
}

.styled-select-multiple select option {
  margin: 2px 0;
}

/* consultation schedule button */
.scheduleBtn {
  display: block;
  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
  -moz-opacity: 1;
  -khtml-opacity: 1;
  opacity: 1;
  margin-bottom: 15px;
}

.scheduleBtn, .scheduleBtn * {
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
}

.scheduleBtn:hover img {
  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=50)";
  -moz-opacity: 0.5;
  -khtml-opacity: 0.5;
  opacity: 0.5;
}

.scheduleBtn.home, .orangeBtn.home {
  display: block;
  width: 100%;
  height: 110px;
  background: #f79c33;
}

.purpleBtn.home {
  display: block;
  width: 100%;
  height: 110px;
  background: #6d276a;
}

.scheduleBtn.interior {
  width: 100%;
  height: 100px;
  background: #f79c33;
}

@media (max-width: 700px) {
  .sidebar {
    display: none !important;
  }
}
.sidebar .scheduleBtn {
  background: #AD3CAA;
}

.sidebar .scheduleBtn[alt^="Schedule "], .sidebar .scheduleBtn[alt^="Download "], .sidebar .scheduleBtn[alt^="Subscribe "], .sidebar .scheduleBtn[alt^="subscribe "], .sidebar .scheduleBtn[alt^=download] {
  background: #F79C33;
}

.sidebar .scheduleBtn[alt="Download Capital Digestive Care Presskit"] {
  background: #6d276a;
}

/* left column/main content */
.mainText {
  max-width: 670px;
  height: auto;
  float: left;
  padding: 0 0 60px 0;
}

.mainText--full {
  max-width: none;
  float: none;
}

.mainText > a {
  font-size: 1.4em;
}

.mainText table td {
  font-size: 1.4em;
}

.mainText table td > * {
  font-size: 1em;
}

.mainText p {
  margin-bottom: 15px;
  font-size: 1.4em;
  line-height: 1.6;
}

.mainText ol {
  font-size: 1.4em;
  line-height: 1.6;
}

.mainText ol > ol, .mainText ol ul, .mainText ol p {
  font-size: 1em;
}

.mainText ul {
  margin: 0 0 15px;
  list-style-type: disc;
  font-size: 1.4em;
  line-height: 1.6;
  padding: 0 20px;
}

.mainText ul > ol, .mainText ul ul, .mainText ul p {
  font-size: 1em;
}

.mainText li {
  margin: 0 0 12px 0;
  list-style-type: none;
  background: url("../../webimages/orange-arrow-sm.png") no-repeat;
  background-position: left 7px;
  padding-left: 10px;
}

.mainText ol {
  list-style-type: decimal;
  margin: 10px 15px;
}

.mainText hr {
  width: 100%;
  height: 1px;
  display: block;
  background: #ccc;
  outline: none;
  border: none;
}

.mainText figure img {
  max-width: 100%;
  height: auto;
}

.mainText .imgFull {
  max-width: 100%;
  margin-bottom: 15px;
  display: block;
}

.mainText .imgCaption {
  width: 100%;
  height: auto;
  margin: -15px 0 15px 0;
  padding: 5px;
}

.imgCaption p {
  margin-bottom: 0;
  font-size: 1.2em;
  font-style: italic;
}

/* 2. Page Styles
================================================== */
.column50 {
  width: 520px;
  min-height: 100px;
  margin: 0;
}

.column50.left {
  float: left;
}

.column50.right {
  float: right;
}

.column25 {
  width: 100%;
  float: none;
}

.column25.left {
  float: none;
}

/* main image (full-width) */
.homeImg {
  width: 100%;
  position: relative;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin-bottom: 10px;
  padding: 10px 0;
}

.homeImg .shadow {
  position: absolute;
  bottom: -21px;
  left: 0;
  background: url("../webimages/homeImg-shadow.png") no-repeat 50% 0;
  width: 100%;
  height: 16px;
  background-size: contain;
}

.homeImg img {
  display: none;
  max-width: 100%;
  margin: 20px 0;
}

.homeImg .desc {
  width: 96%;
  padding: 2% 2% 45px;
  background: #fff;
}

.homeImg .desc h1 {
  font-size: 2em;
  margin-bottom: 5px;
  font-weight: 300;
}

.homeImg .desc p {
  line-height: 1.35em;
  font-size: 1.4em;
  margin-bottom: 15px;
}

.jcarousel-control-prev, .jcarousel-control-next, .jcarousel-control-prev:active, .jcarousel-control-next:active {
  text-decoration: none !important;
}

.homeCarousel2 .text {
  position: absolute;
  top: 40px;
  left: 50px;
  display: block;
  height: 240px;
  width: 245px;
}

.homeCarousel2 .text p {
  margin-bottom: 15px;
}

.jcarousel {
  max-width: 100%;
}

.jcarousel__title {
  font-size: 1.4em;
  color: #fff;
  margin-bottom: 15px;
  display: block;
}

.jcarousel p {
  font-size: 2.1em;
  line-height: 1.3;
  text-transform: uppercase;
  font-weight: 700;
}

/* homepage news snippets */
.homeNews {
  display: block;
  float: left;
  background: #fff;
  width: 100%;
  height: auto;
  margin: 20px 0;
  padding: 20px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.homeNews h2 {
  color: #565a5d;
  font-size: 2.4em;
  font-weight: 300;
  padding: 20px 0;
  border-bottom: 1px solid #bdc0c2;
  margin-bottom: 20px;
}

.homeNews .newsItem__title {
  color: #565a5d;
  font-weight: 700;
  font-size: 1.6em;
  text-transform: uppercase;
  padding-top: 20px;
  margin-bottom: 10px;
}

.homeNews .newsItem__title a:link, .homeNews .newsItem__title a:visited {
  color: #565a5d;
  text-decoration: none;
}

.homeNews .newsItem__title a:hover, .homeNews .newsItem__title a:visited:hover {
  color: #000;
}

.homeNews .date {
  font-size: 1.3em;
}

.homeNews .newsExcerpt {
  border: 0;
  font-size: 1.4em;
  line-height: 1.6;
}

.homeNews .newsExcerpt a {
  color: #565a5d;
  text-decoration: underline;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.homeNews .newsExcerpt a:hover, .homeNews .newsExcerpt a:focus {
  color: #000;
}

.homeNews .newsItem {
  display: block;
  width: 100%;
  min-height: 122px;
  clear: both;
  border-bottom: 1px solid #c9c9c9;
  padding: 0 0 10px 0;
  margin: 0 0 20px 0;
}

.homeNews .newsItem .image {
  float: left;
  width: 120px;
  max-height: 140px;
  overflow: hidden;
  border: 1px solid #c9c9c9;
  margin: 0 10px 10px 0;
  display: block;
}

.homeNews .newsItem .image img {
  max-width: 100%;
  display: block;
}

.homeNews .newsText {
  width: 71%;
  height: auto;
  display: block;
  float: left;
}

/* homepage content slider */
.homeSlider {
  display: block;
  float: right;
  background: #fff;
  width: 510px;
  height: auto;
  margin: 20px 0;
  padding: 5px;
  position: relative;
  overflow: hidden;
}

.homeSlider #slides {
  padding: 0;
  margin: 0;
}

.homeSlider a.slideNav {
  display: block;
  float: left;
  background: #fff;
  border: 2px solid #2d862d;
  width: 20px;
  height: 20px;
  border-radius: 20px;
  text-align: center;
  margin: 10px 5px 5px 0;
  -webkit-transition: all 0.1s linear;
  transition: all 0.1s linear;
}

.homeSlider a.slideNav:hover {
  background: #2d862d;
}

.homeSlider a.slideNav span {
  height: 20px;
  width: 20px;
  line-height: 20px;
  font-size: 1.4em;
  color: #2d862d;
  text-align: center;
  border-radius: 20px;
  -webkit-transition: all 0.1s linear;
  transition: all 0.1s linear;
}

ul.slidesjs-pagination {
  float: left;
  height: 24px;
  margin: 0 0 0 5px;
}

ul.slidesjs-pagination li {
  display: block;
  float: left;
  width: 12px;
  height: 12px;
  margin: 20px 5px 0 0;
}

ul.slidesjs-pagination li a {
  display: block;
  height: 100%;
  width: 100%;
  background: #565a5d;
  text-indent: -9999px;
  border-radius: 12px;
}

ul.slidesjs-pagination li a:hover, ul.slidesjs-pagination li a.active {
  background: #2d862d;
}

.homeSlider .slideNav:hover span {
  color: #fff;
}

.homeSlider .slide {
  width: 100%;
  height: 300px;
  position: relative;
}

.homeSlider .slide span.text {
  position: absolute;
  top: 40px;
  left: 260px;
  display: block;
  height: 240px;
  width: 245px;
}

.homeSlider .slide h2 {
  color: #fff;
  line-height: 120%;
}

.homeSlider .slide p {
  color: #fff;
  max-width: 86%;
}

.homeSlider .slide a.button {
  margin-top: 10px;
}

.homeSlider .slide h2 + a.button {
  margin-top: 15px;
}

/* homepage patient forms menu */
.homeForms {
  width: 90%;
  padding: 6% 5%;
  height: auto;
  background: #fff;
}

.homeForms h3 {
  color: #2d862d;
  margin-bottom: 10px;
}

.homeForms h3 span {
  font-size: 1.2em;
}

.home .column50 {
  float: none;
  width: 100%;
}

.home .column50.right {
  max-width: 510px;
}

/* ---- physicians/locations ---- */
.anchorLinks {
  display: block;
  margin-bottom: 20px;
  font-size: 1.4em;
  line-height: 1.6;
}

.anchorLinks a {
  color: #565a5d;
  text-decoration: underline;
}

.anchorLinks a:hover, .anchorLinks a:focus {
  color: #000;
}

.anchorLinks span:last-child {
  display: none;
}

/* ---- news & media ---- */
/* video gallery */
.videoGallery {
  display: block;
  width: 940px;
  margin: 10px 0 20px 60px;
  background: #333;
}

.vidThumb h3 {
  height: 2.6em;
  padding-bottom: 0;
  line-height: 1em;
}

.fullVideo, #thisVid {
  margin: 0 60px 60px 60px;
  position: relative;
  padding-bottom: 56.25%;
  padding-top: 30px;
  height: 0;
  overflow: hidden;
}

#thisVid iframe, #thisVid object, #thisVid embed, .fullVideo iframe, .fullVideo object, .fullVideo embed {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

.warning {
  color: #2a7c10;
}

/* Form hidden crap */
.nospam {
  display: none;
  text-indent: -9999px;
}

/* Combined jss.css*/
.vTop {
  background: url("../../webimages/loader.gif") no-repeat;
  background-position: center center;
  background-color: #000;
  display: block;
  position: relative;
  padding-bottom: 56%;
  margin-bottom: 20px;
}

.vTop iframe {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

.left {
  float: left;
  margin: 0 15px 15px 0;
}

.vidThumb {
  display: block;
  margin: 0 0 15px 0;
}

.vidThumb img {
  width: 90%;
  border: solid 1px #ccc;
  padding: 3px;
}

.infoThumb {
  display: block;
  width: 100px;
  height: 75px;
  overflow: hidden;
  float: left;
  margin: 0 5px 15px 0;
  border: solid 1px #ccc;
}

.infoThumb img {
  width: 100px;
}

.infogLinks {
  font-size: 1.6em;
  line-height: 1.2em;
  font-weight: 700;
}

.infogLinks a {
  text-decoration: none;
  color: #565a5d;
}

.infogLinks a:hover, .infogLinks a:focus {
  color: #000;
}

.citations {
  margin: 20px 0;
}

.citations a {
  display: block;
  padding-bottom: 16px;
}

.phyVideo {
  margin-bottom: 20px;
}

.bodyImage img {
  display: block;
  float: left;
  margin: 0 15px 15px 0;
  max-width: 200px;
}

.mainText input[type=file] {
  color: #999;
}

.infographic li {
  list-style-type: none !important;
}

.newsItem {
  margin-bottom: 20px;
}

.newsItem .image {
  float: left;
  width: 120px;
  max-height: 140px;
  overflow: hidden;
  border: 1px solid #c9c9c9;
  margin: 0 10px 10px 0;
  display: block;
}

.newsItem .image img {
  width: 120px;
  display: block;
}

.newsItem .date {
  font-size: 1.3em;
}

.newsItem__title {
  padding-top: 10px;
}

.newsItem__content {
  float: left;
  width: 80%;
}

.newsSelect {
  float: left;
  width: 280px;
  margin: 0 0 0 60px;
  padding: 0 0 30px 0;
  overflow: scroll;
}

.videoNews {
  width: 620px;
  display: block;
  height: 250px;
  float: right;
  background-color: blue;
  margin: 0 60px 0 0;
}

.content .intro, .callout .intro {
  margin-bottom: 30px;
}
.content .intro p, .callout .intro p {
  font-size: 2em;
  line-height: 1.6;
}

.content strong, .callout strong, .content b, .callout b {
  font-weight: 500;
}

.content em, .callout em, .content i, .callout i {
  font-style: italic;
}

.content-container, .physician-container {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-pack: distribute;
  justify-content: space-around;
  margin-top: 50px;
}

.content h1, .callout h1 {
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8em;
  margin-bottom: 30px;
  margin-top: -5px;
}

.content h2, .callout h2 {
  color: #565a5d;
  font-size: 2.4em;
  font-weight: 300;
  padding: 42px 0 0;
  border-top: 3px solid #e5e6e7;
  border-bottom: 0;
  margin-bottom: 22px;
  margin-top: 40px;
}

.content h2.heading-alt, .callout h2.heading-alt, .cta .content h2, .cta .callout h2 {
  border: 0;
  margin-top: 0;
  margin-bottom: 15px;
  padding-top: 0;
}

.cta .content h2, .cta .callout h2 {
  color: #fff;
}

.content h2.section__header, .callout h2.section__header {
  border: 0;
  text-align: center;
  position: relative;
  margin-bottom: 30px;
}

.content h2.section__header:before, .callout h2.section__header:before, .content h2.section__header:after, .callout h2.section__header:after {
  content: "";
  position: absolute;
}

.content h2.section__header:before, .callout h2.section__header:before {
  width: 100%;
  height: 1px;
  background: #565a5d;
  left: 0;
  top: calc(50% + 20px);
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
}

.content h2.section__header span, .callout h2.section__header span {
  background: #fff;
  position: relative;
  z-index: 2;
  padding: 0 30px;
}

.content h3, .callout h3 {
  font-size: 2em;
  font-weight: 500;
  text-transform: none;
  margin-bottom: 15px;
}

.content h3.info-col__title, .callout h3.info-col__title {
  font-style: italic;
  margin-bottom: 2px;
  padding-top: 0;
}

.content h4, .callout h4 {
  font-size: 1.6em;
  font-weight: 700;
  padding-top: 20px;
  margin-bottom: 10px;
}

.content h5, .callout h5, .content h6, .callout h6 {
  font-size: 1.4em;
  font-weight: 300;
  text-transform: uppercase;
  margin-bottom: 15px;
  padding: 10px 0;
  border-bottom: 1px solid #dadada;
}

.content p, .callout p {
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
  margin-bottom: 29px;
}

.content p + ul, .callout p + ul, .content p + ol, .callout p + ol,
.lab p + ul, .lab p + ol {
  margin-top: -15px;
}

.cta .content p, .cta .callout p {
  color: #fff;
}

.content small, .callout small {
  font-size: 75%;
}

.content ul, .callout ul, .content ol, .callout ol {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 26px;
}

.content ul > *, .callout ul > *, .content ol > *, .callout ol > *,
.lab ul:not(.section-nav__menu) > *, .lab ol > * {
  font-size: 1em;
}

.content ul li, .callout ul li, .content ol li, .callout ol li,
.lab ul li:not(.section-nav__link), .lab ol li {
  position: relative;
  margin-bottom: 9px;
  padding-left: 15px;
  padding-right: 25px;
  list-style: none;
}

.content ul li *, .callout ul li *, .content ol li *, .callout ol li *,
.lab ul li *, .lab ol li * {
  font-size: 1em;
}

.content ul li .icon-pdf, .callout ul li .icon-pdf, .content ol li .icon-pdf, .callout ol li .icon-pdf {
  font-size: 21px;
}

.content ul li p, .callout ul li p, .content ol li p, .callout ol li p,
.lab ul li p, .lab ol li p {
  margin-bottom: 0;
}

.content ul li ul, .callout ul li ul, .content ul li ol, .callout ul li ol, .content ol li ul, .callout ol li ul, .content ol li ol, .callout ol li ol,
.lab ul li ul, .lab ul li ol, .lab ol li ul, .lab ol li ol {
  margin: 10px 0 0 20px;
}

.content ul h2, .callout ul h2, .content ul h3, .callout ul h3, .content ul h4, .callout ul h4, .content ul h5, .callout ul h5, .content ul h6, .callout ul h6, .content ol h2, .callout ol h2, .content ol h3, .callout ol h3, .content ol h4, .callout ol h4, .content ol h5, .callout ol h5, .content ol h6, .callout ol h6 {
  padding-top: 0;
}

.content ul li, .callout ul li {
  border-bottom: 1px solid #e5e6e7;
  padding-top: 11px;
  padding-bottom: 20px;
}

.content ul li:last-of-type, .callout ul li:last-of-type,
.lab ul li:last-of-type {
  border: 0;
  padding-bottom: 0;
}

.content ul li:before, .callout ul li:before,
.lab ul li:not(.section-nav__link, .section-nav__link--active)::before {
  content: "•";
  position: absolute;
  left: 0px;
  color: #565a5d;
  font-size: 16px;
}

.section-nav__link:hover::before {
  content: "" !important;
  left: 9px !important;
}

.content ul li li, .callout ul li li,
.lab ul li li {
  padding-left: 13px;
}

.content ul li li:before, .callout ul li li:before,
.lab ul li li:before {
  left: 0;
}

.content ul li a :after, .callout ul li a :after {
  content: "\e90a";
  font-family: "icons";
  left: auto;
  right: -20px;
  bottom: auto;
  top: 0;
  width: auto;
  height: auto;
  background: none;
}

.content ul li a :hover, .callout ul li a :hover, .content ul li a :focus, .callout ul li a :focus {
  color: #393;
}

.content ul li a :hover:after, .callout ul li a :hover:after, .content ul li a :focus:after, .callout ul li a :focus:after {
  right: -30px;
}

.content .list-col li, .callout .list-col li, .content .callout--split ul li, .callout .callout--split ul li {
  -moz-column-break-inside: avoid;
  -o-column-break-inside: avoid;
  -ms-column-break-inside: avoid;
  column-break-inside: avoid;
  padding-right: 20px;
  display: inline-block;
  width: calc(100% - 35px);
}

.content .list-col li:last-of-type, .callout .list-col li:last-of-type, .content .callout--split ul li:last-of-type, .callout .callout--split ul li:last-of-type {
  border-bottom: 1px solid #e5e6e7;
  padding-bottom: 20px;
}

.content .list-col #sitemap li:last-of-type, .callout .list-col #sitemap li:last-of-type, .content .callout--split ul #sitemap li:last-of-type, .callout .callout--split ul #sitemap li:last-of-type {
  border-bottom: 0;
  margin-bottom: 0;
  padding-bottom: 0;
}

.content ol, .callout ol {
  counter-reset: li;
}

.content ol li, .callout ol li {
  padding-left: 30px;
}

.content ol > li:before, .callout ol > li:before {
  position: absolute;
  content: counter(li) ".";
  counter-increment: li;
  left: 0;
  color: #565a5d;
  top: -1px;
  font-weight: 300;
  font-family: "MuseoSans", sans-serif;
  width: 25px;
  text-align: right;
}

.content table, .callout table {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 47px;
  border: 1px solid #e5e6e7;
  border-collapse: separate;
  border-spacing: 5px;
}

.content table *, .callout table * {
  font-size: 1em;
}

.content table th, .callout table th, .content table td, .callout table td {
  padding: 19px 8px;
}

.content table .tablesaw-cell-label, .callout table .tablesaw-cell-label {
  font-family: "MuseoSans", sans-serif;
  font-weight: normal;
}

.content table th, .callout table th {
  font-weight: bold;
  background: whitesmoke;
}

.content table tr:nth-child(even), .callout table tr:nth-child(even) {
  background: whitesmoke;
}

.content--topic-page table {
  border: 0;
  border-spacing: 0;
}

.content--topic-page table th {
  font-weight: 300;
  font-size: 1.9em;
  background: #fff;
  color: #6d276a;
}

.content--topic-page table tr:nth-child(even) {
  background: #fff;
}

.content--topic-page table tr:nth-child(odd) {
  background: whitesmoke;
}

.content .table--wrapper, .callout .table--wrapper {
  overflow: auto;
  /*
  	@include mq($min, 850px) {
  		width: calc(100vw - 40px);
  		margin-left: calc(((100vw - 800px)/-2));
  		padding: 0 20px;
  	}

  	@include mq($min, 1180px) {
  		margin: 0 -180px;
  		padding: 0;
  		width: calc(100% + 360px);
  	}
  	*/
}

.content .table--wrapper table, .callout .table--wrapper table {
  min-width: 600px;
}

.content .cols, .callout .cols {
  margin-top: 31px;
}

.content .cols > li, .callout .cols > li {
  line-height: 1.2;
  padding-left: 0;
  margin-bottom: 0;
  padding-bottom: 10px;
}

.content .cols > li:before, .callout .cols > li:before {
  display: none;
}

.content blockquote, .callout blockquote {
  margin: 40px 0;
  position: relative;
  padding-top: 71px;
}

.content blockquote p, .callout blockquote p {
  font-size: 1.8em;
  line-height: 1.3;
  margin-bottom: 0;
  font-weight: 300;
  letter-spacing: 0.003em;
}

.content blockquote p:first-of-type:before, .callout blockquote p:first-of-type:before {
  color: #565a5d;
  position: absolute;
  font: 156px "MuseoSans", sans-serif;
  content: "“";
  left: -10px;
  top: -10px;
}

.content blockquote p:last-of-type, .callout blockquote p:last-of-type {
  margin-bottom: 10px;
}

.content blockquote footer, .callout blockquote footer {
  font: 1.4em/1 "MuseoSans", sans-serif;
  text-transform: uppercase;
  color: #565a5d;
}

.content blockquote cite, .callout blockquote cite {
  font-style: normal;
}

.content hr, .callout hr {
  margin-bottom: 30px;
}

.content a:not(.btn), .callout a:not(.btn) {
  display: inline-block;
  position: relative;
  color: #565a5d;
  text-decoration: none;
}

.content a:not(.btn):after, .callout a:not(.btn):after {
  content: "";
  position: absolute;
  width: 100%;
  height: 1px;
  bottom: 0;
  left: 0;
  background: #565a5d;
  opacity: 0.5;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.content article a.resource-card__info:after, .callout article a.resource-card__info:after {
  height: 0px;
}

.content a:not(.btn):hover, .callout a:not(.btn):hover, .content a:not(.btn):focus, .callout a:not(.btn):focus {
  color: #393;
}

.content a:not(.btn):hover:after, .callout a:not(.btn):hover:after, .content a:not(.btn):focus:after, .callout a:not(.btn):focus:after {
  height: 3px;
  background: #393;
  opacity: 1;
}

.content a[rel*=external]:before, .callout a[rel*=external]:before {
  content: "\e915";
  font-family: "icons";
  position: absolute;
  right: -25px;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.content a[rel*=external]:after, .callout a[rel*=external]:after {
  display: none;
}

.content a[rel*=external]:hover:before, .callout a[rel*=external]:hover:before, .content a[rel*=external]:focus:before, .callout a[rel*=external]:focus:before {
  right: -30px;
}

.content p a[rel*=external]:after, .callout p a[rel*=external]:after {
  display: block;
}

.content .imageLeft, .callout .imageLeft {
  margin-bottom: 30px;
}

.content .imageRight, .callout .imageRight {
  margin-bottom: 30px;
}

.content .imageCenter, .callout .imageCenter {
  margin-bottom: 30px;
}

.content figcaption, .callout figcaption {
  font-size: 1.2em;
  margin-top: 5px;
}

.content sub, .callout sub {
  vertical-align: sub;
  font-size: 75%;
}

.content sup, .callout sup {
  vertical-align: super;
  font-size: 75%;
}

.form-list__item {
  display: none;
}

.module-title {
  color: #6d276a;
  text-align: center;
  font-size: 2.6em;
  border: 0;
}

.breadcrumbs {
  height: 49px;
  width: auto;
  display: block;
  border: 1px solid #e5e5e5;
  border-width: 1px 0;
  display: none;
}

.breadcrumbs .selected {
  font-size: 1.4em;
  font-weight: 500;
}

.breadcrumbs .selected a {
  font-size: 1em;
}

.breadcrumbs ul {
  display: block;
  float: left;
}

.breadcrumbs ul li {
  display: block;
  float: left;
  height: 49px;
  width: auto;
  color: #979797;
}

.breadcrumbs ul li:after {
  content: "/";
  padding: 5px;
  line-height: 2.9;
  font-size: 17px;
}

.breadcrumbs ul li:last-child:after {
  content: "";
}

.breadcrumbs a {
  color: #666;
  display: block;
  float: left;
  height: 49px;
  line-height: 49px;
  font-size: 1.4em;
  padding: 0 3px;
  text-decoration: none;
  -webkit-transition: all 0.2s ease;
  transition: all 0.2s ease;
  font-weight: 500;
  border-bottom: 3px solid transparent;
}
.breadcrumbs a:hover {
  color: #2d862d;
  border-color: #2d862d;
}

.breadcrumbs a br {
  display: none;
}

.breadcrumbs .langSelect {
  float: right;
  height: 16px;
  margin: 17px 0 0 0;
}

.breadcrumbs .langSelect a {
  float: left;
  display: block;
  height: 16px;
  width: auto;
  line-height: 16px;
  font-weight: 500;
}

.btn--outline-tertiary {
  color: #6d276a;
  background: #fff;
  border: 1px solid rgba(109, 39, 106, 0.5);
  -webkit-box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
}
.btn--outline-tertiary:hover:before, .btn--outline-tertiary:focus:before {
  border-color: rgba(109, 39, 106, 0.6);
}

.btn {
  border: 0;
  border-radius: 0;
  font-size: 1.6em;
  font-weight: 500;
  padding: 0;
  margin: 0;
  position: relative;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  display: inline-block;
  width: 100%;
  text-align: center;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}
.btn.btn--smaller {
  font-size: 1em;
}
.btn [class^=icon] {
  font-size: 18px;
  vertical-align: middle;
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  opacity: 0;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
}
.btn.btn--disabled {
  background-color: #bdc0c2;
  padding: 17px 20px;
  color: #fff;
  -webkit-box-shadow: inset -0.3px 2px 4px rgba(86, 90, 93, 0.35);
          box-shadow: inset -0.3px 2px 4px rgba(86, 90, 93, 0.35);
}
.btn--icon-left [class^=icon] {
  left: 20px;
}
.btn--icon-left:focus, .btn--icon-left:hover {
  padding-left: 52px;
}
.btn--icon-left:focus [class^=icon], .btn--icon-left:hover [class^=icon] {
  opacity: 1;
}
.btn--icon-right [class^=icon] {
  right: 20px;
}
.btn--icon-right:focus, .btn--icon-right:hover {
  padding-right: 52px;
}
.btn--icon-right:focus [class^=icon], .btn--icon-right:hover [class^=icon] {
  opacity: 1;
}
.btn--primary {
  padding: 17px 20px;
  background: #393;
  color: #fff;
  -webkit-box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
          box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
}
.btn--primary:focus, .btn--primary:hover {
  background: #2d862d;
}
.btn--secondary, .btn--secondary--alt {
  padding: 17px 20px;
  background: #6d276a;
  color: #fff;
  -webkit-box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
          box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
}
.btn--secondary:focus, .btn--secondary--alt:focus, .btn--secondary:hover, .btn--secondary--alt:hover {
  background: #b149ad;
}
.btn--secondary span, .btn--secondary--alt span {
  background: #b149ad;
}
.btn--secondary--alt {
  background: #b149ad;
}
.btn--secondary--alt:focus, .btn--secondary--alt:hover {
  padding-left: 17px;
  background: #b149ad;
}
.btn--outline {
  border: 1px solid #fff;
  padding: 16px 20px;
  background: 0 0;
  color: #fff;
  text-transform: uppercase;
  -webkit-box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
          box-shadow: -0.3px 2px 4px rgba(86, 90, 93, 0.35);
}
.btn--outline:focus:before, .btn--outline:hover:before {
  border-color: #fff;
}
.btn--outline:before {
  content: "";
  position: absolute;
  top: -1px;
  left: -1px;
  width: calc(100% - 4px);
  height: calc(100% - 4px);
  border: 3px solid transparent;
  -webkit-transition: border 0.25s ease;
  transition: border 0.25s ease;
  pointer-events: none;
}
.btn--outline-primary {
  color: #b149ad;
  border: 1px solid #b149ad;
}
.btn--outline-primary:focus:before, .btn--outline-primary:hover:before {
  border-color: #b149ad;
}
.btn--outline-primary-alt {
  border: 1px solid #b149ad;
}
.btn--outline-primary-alt:focus, .btn--outline-primary-alt:hover {
  background: #b149ad;
}
.btn--outline-primary-alt:focus:before, .btn--outline-primary-alt:hover:before {
  border-color: #b149ad;
}
.btn--outline-secondary {
  color: #565a5d;
  border: 1px solid #bdc0c2;
  -webkit-box-shadow: none;
          box-shadow: none;
  padding: 12px 30px 12px 30px;
  border-radius: 2px;
  text-align: left;
  font-size: 1.6em;
}
.btn--outline-secondary:focus:before, .btn--outline-secondary:hover:before {
  border-color: #bdc0c2;
}
.btn--outline-secondary-alt {
  color: #393;
  border: 1px solid #393;
  -webkit-box-shadow: none;
          box-shadow: none;
}
.btn--outline-secondary-alt span {
  color: #fff;
}
.btn--outline-secondary-alt:focus, .btn--outline-secondary-alt:hover {
  background: #393;
  color: #fff;
}
.btn--outline-secondary-alt:focus:before, .btn--outline-secondary-alt:focus:before, .btn--outline-secondary-alt:hover:before, .btn--outline-secondary-alt:hover:before {
  border-color: transparent;
}
.btn--outline-tertiary {
  color: #6d276a;
  background: #fff;
  border: 1px solid rgba(109, 39, 106, 0.5);
  -webkit-box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
}
.btn--outline-tertiary:hover:before, .btn--outline-tertiary:focus:before {
  border-color: rgba(109, 39, 106, 0.6);
}
.btn--solid-dark {
  color: white;
  background: #6d276a;
  border: 1px solid rgba(109, 39, 106, 0.5);
  -webkit-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.5);
          box-shadow: 0 2px 4px rgba(0, 0, 0, 0.5);
  padding: 12px 30px 12px 30px;
  border-radius: 2px;
  text-align: left;
  font-size: 1.6em;
}
.btn--solid-dark:hover {
  background-color: #b149ad;
  border: 1px solid #b149ad;
}
@media screen and (min-width: 1024px) {
  .btn--solid-dark--solid-dark {
    padding-top: 17px;
    padding-bottom: 17px;
  }
}

.btn--icon-fixed {
  padding: 12px 30px 12px 72px;
  border-radius: 10px;
  text-align: left;
  font-size: 1.4em;
}
.btn--icon-fixed [class^=icon] {
  top: 0;
  -webkit-transform: none;
          transform: none;
  border-radius: 10px 0 0 10px;
  opacity: 1;
  height: 100%;
  width: 50px;
  left: 0;
}
.btn--icon-fixed [class^=icon]:before {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
}
.btn--icon-fixed.btn--primary [class^=icon] {
  background: #2db035;
}
.btn--icon-fixed.btn--secondary [class^=icon], .btn--icon-fixed.btn--secondary--alt [class^=icon] {
  border-right: 1px solid #50164e;
}
.btn--icon-fixed:focus, .btn--icon-fixed:hover {
  padding-left: 80px;
}

.btn--cta {
  font-size: 2.4em;
  font-weight: 300;
  letter-spacing: 0.05em;
  color: #565a5d;
  padding: 15px 45px 15px 0;
  text-align: left;
  margin-bottom: 20px;
}
.btn--cta:after {
  content: "";
  position: absolute;
  bottom: 0;
  left: 0;
  width: 28px;
  height: 4px;
  background: #393;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.btn--cta .btn--cta:focus:after,
.btn--cta:hover:after {
  width: calc(100% - 25px);
}

.btn--cta [class^=icon-] {
  opacity: 1;
  color: #393;
  font-weight: 700;
}

.btn--cta__sm {
  display: block;
  position: relative;
  font-size: 70%;
  text-transform: uppercase;
  font-weight: 500;
  letter-spacing: 0;
  margin-top: 20px;
}

.btn--cta-icon:after {
  bottom: 40px;
  background: #50164e;
}

.btn--cta-icon [class^=icon-] {
  font-weight: 400;
  margin: -2px 0 0 10px;
  color: #b149ad;
}

.btn--cta-icon:focus .btn--cta__sm,
.btn--cta-icon:hover .btn--cta__sm {
  color: #50164e;
}

.btn--close [class^=icon-] {
  opacity: 1;
}

.btn-container {
  text-align: center;
}

.btn-container--left {
  text-align: left;
}

.btn-container .btn {
  margin-bottom: 15px;
}

.btn-sticky {
  margin-top: -15px;
  margin-bottom: 25px;
}

.content a > .btn, .callout a > .btn {
  font-size: 1em;
  text-transform: none;
  position: relative;
  z-index: 2;
}

.content .btn > a, .callout .btn > a {
  color: inherit;
  text-transform: none;
  font-size: 62.5%;
  display: block;
  padding: 12px 0;
  line-height: 0;
}

.content .btn > a:after, .callout .btn > a:after {
  display: none;
}

.content .btn > a:focus, .callout .btn > a:focus,
.content .btn > a:hover,
.callout .btn > a:hover {
  color: inherit;
}

@media screen and (min-width: 640px) {
  .btn {
    width: auto;
  }
  .btn-container--left .btn:first-of-type {
    margin-left: 0;
  }
  .btn-container .btn {
    margin: 0 15px;
  }
  .btn-container .btn:first-of-type {
    margin-left: 0;
  }
  .btn-container .btn:last-of-type {
    margin-right: 0;
  }
}
.makeappointmentbutton {
  display: none;
}

@media screen and (min-width: 1024px) {
  .makeappointmentbutton {
    display: block;
  }
}
.menu-btn {
  color: #6d276a;
  text-transform: uppercase;
  font-size: 1.2em;
  font-weight: 500;
  background: none;
  border: none;
  position: relative;
  width: 75px;
  height: 75px;
  padding: 0;
  cursor: pointer;
}

.menu-btn:hover {
  opacity: 0.8;
}

.menu-btn:focus {
  outline: none;
  background: #efefef;
}

.menu-text {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  text-align: center;
}

.menu-lines {
  display: inline-block;
  width: 34px;
  height: 2px;
  bottom: 26px;
  left: 17px;
  background: #6d276a;
  border-radius: 4px;
  border: 1px solid transparent;
  position: absolute;
  -webkit-transition: background 0.3s 0.5s ease;
  transition: background 0.3s 0.5s ease;
}

.menu-lines:before, .menu-lines:after {
  content: "";
  position: absolute;
  left: 0;
  display: inline-block;
  width: 100%;
  height: 4px;
  background: #6d276a;
  border-radius: 4px;
  -webkit-transform-origin: 50% 50%;
          transform-origin: 50% 50%;
  -webkit-transition: top 0.3s 0.6s ease, -webkit-transform 0.3s ease;
  transition: top 0.3s 0.6s ease, -webkit-transform 0.3s ease;
  transition: top 0.3s 0.6s ease, transform 0.3s ease;
  transition: top 0.3s 0.6s ease, transform 0.3s ease, -webkit-transform 0.3s ease;
}

.menu-lines:before {
  top: -12px;
}

.menu-lines:after {
  top: -24px;
}

.content a > .btn, .callout a > .btn {
  font-size: 1em;
  text-transform: none;
  position: relative;
  z-index: 2;
}

.content .btn > a, .callout .btn > a {
  color: inherit;
  text-transform: none;
  font-size: 62.5%;
  display: block;
  padding: 12px 0;
  line-height: 0;
}

.content .btn > a:after, .callout .btn > a:after {
  display: none;
}

.content .btn > a:hover, .callout .btn > a:hover, .content .btn > a:focus, .callout .btn > a:focus {
  color: inherit;
}

.card {
  border: 1px solid #e5e6e7;
  -webkit-box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
  margin-bottom: 30px;
  width: 100%;
}
.card.card--physician {
  -webkit-box-shadow: none !important;
          box-shadow: none !important;
  border: none !important;
}

.card--single {
  -ms-flex: none;
  -webkit-box-flex: 0;
          flex: none;
  margin: 0;
  border: 0;
  -webkit-box-shadow: none;
          box-shadow: none;
  max-width: none;
}
@media only screen and (max-width: 992px) {
  .card--single {
    -ms-flex: none;
    -webkit-box-flex: 0;
            flex: none;
    margin: 0;
    max-width: none;
  }
}

.card--article {
  background: transparent;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  border: 0;
  -webkit-box-shadow: none;
          box-shadow: none;
  margin: 0 0 30px 0;
}
.card--article .card__title {
  color: #fff;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-bottom: 20px;
  line-height: 1.3;
}
.card--article .card__info {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  width: 100%;
}
.card--article .card__info:hover, .card--article .card__info:focus {
  background: none;
}
.card--article .card__info:hover .card__link, .card--article .card__info:focus .card__link {
  background: #b149ad;
}
.card--article .card__info:hover .card__link [class^=icon], .card--article .card__info:focus .card__link [class^=icon] {
  opacity: 1;
  right: -10px;
}

.card--corporate {
  position: relative;
}

.card--corporate:before {
  content: "Corporate Offices";
  text-align: center;
  font-size: 1.6em;
  font-weight: 500;
  background: #6d276a;
  color: #fff;
  padding: 10px;
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  pointer-events: none;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.card > * {
  padding-left: 28px;
  padding-right: 28px;
}

.card--physician {
  max-width: 22%;
  min-width: 180px;
}

.card--physician > * {
  padding: 0;
}

.card--physician img {
  max-width: 100%;
  width: 100%;
}

.card__title {
  padding-top: 28px;
  margin: 0 0 3px 0;
  font-weight: 500;
  font-size: 2em;
  text-transform: none;
}

.card__title--name {
  padding: 20px;
}

.card__detail {
  font-size: 1.6em;
  line-height: 1.3;
}

.card__info {
  display: block;
  color: #565a5d;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.card--single .card__info {
  padding-top: 15px;
}

.card--corporate .card__info {
  padding-top: 36px;
}

.card--physician .card__info {
  height: 100%;
  padding: 10px;
}

.card__info:hover, .card__info:focus {
  background: #f2f3f3;
}

.card__info__img {
  max-height: 180px;
  margin-bottom: 10px;
}

.card--corporate .card__info__img {
  max-height: 150px;
  display: block;
  margin-left: auto;
  margin-right: auto;
}

.card__link {
  display: block;
  padding-top: 14px;
  padding-bottom: 14px;
  color: #565a5d;
  font-size: 1.4em;
  font-weight: 500;
  border-top: 1px solid #e5e6e7;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.card__link:hover, .card__link:focus {
  background: #f2f3f3;
}

.card__link [class^=icon] {
  font-size: 12px;
  margin-right: 4px;
}

.card__link--inline {
  border: 0;
  padding: 13px 0 27px;
}

.card--location {
  -ms-flex: 1 0 22%;
  -webkit-box-flex: 1;
          flex: 1 0 22%;
  max-width: 22%;
  margin-left: 2%;
  margin-right: 2%;
}

@media screen and (max-width: 740px) {
  .card.card--location {
    -ms-flex: 1 0 33%;
    -webkit-box-flex: 1;
            flex: 1 0 33%;
    max-width: 40%;
  }
}
@media screen and (max-width: 500px) {
  .card.card--location {
    -ms-flex: 1 0 85%;
    -webkit-box-flex: 1;
            flex: 1 0 85%;
    max-width: 85%;
  }
}
.card--single .card__link--inline {
  padding-bottom: 15px;
}

.card--article .card__link {
  color: #fff;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: end;
  align-self: flex-end;
  margin: 0 -28px;
  border-color: #b149ad;
  text-align: center;
  font-size: 1.6em;
  font-weight: 300;
}

.card--article .card__link [class^=icon] {
  opacity: 0;
  right: 0;
  position: relative;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

@media screen and (min-width: 640px) {
  .card {
    -ms-flex: 1 0 45%;
    -webkit-box-flex: 1;
            flex: 1 0 45%;
    max-width: 45%;
    margin-left: 2%;
    margin-right: 2%;
  }
  .card--single {
    -ms-flex: none;
    -webkit-box-flex: 0;
            flex: none;
    margin: 0;
    max-width: none;
  }
  .card--physician {
    max-width: 22%;
  }
}
@media screen and (max-width: 575px) {
  .card--physician {
    max-width: calc(50% - (2px + 4%));
    min-width: 180px;
    margin: 2%;
  }
}
@media screen and (max-width: 400px) {
  .card--physician {
    max-width: 88%;
    min-width: 180px;
    margin: 2% auto;
  }
}
@media screen and (min-width: 992px) {
  .card {
    -ms-flex: 1 0 48%;
    -webkit-box-flex: 1;
            flex: 1 0 48%;
    max-width: 48%;
    margin: 0 0 30px 0;
  }
  .card:nth-child(4n+2) {
    margin-left: 30px;
    margin-right: 15px;
  }
  .card:nth-child(4n+3) {
    margin-left: 15px;
    margin-right: 30px;
  }
  .card.card--location {
    -ms-flex: 1 0 33%;
    -webkit-box-flex: 1;
            flex: 1 0 29%;
    max-width: 29%;
    margin: 0 2% 30px 2%;
  }
  .card--physician {
    margin: 0 0 30px 0;
    max-width: 22%;
  }
}
.card.card--physician .card__title--name {
  padding: 10px;
  text-align: center;
}

.headshot {
  width: 150px;
  height: 150px;
  background-size: cover;
  border-radius: 100px;
  overflow: hidden;
  margin: auto;
}

.resource-card {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  margin: 0 25px 50px;
}
@media (min-width: 640px) {
  .resource-card {
    -webkit-box-flex: 0 !important;
        -ms-flex: 0 1 calc(25% - 50px) !important;
            flex: 0 1 calc(25% - 50px) !important;
  }
}

.resource-card__info {
  color: #565a5d;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  width: 100%;
  background-color: #6D276A;
  color: white;
  text-align: center;
}
.resource-card__info img {
  display: none;
}

.resource-card__info:hover .resource-card__link [class^=icon], .resource-card__info:focus .resource-card__link [class^=icon] {
  opacity: 1;
  right: -10px;
}

.resource-card__img {
  position: relative;
  height: 200px;
  width: 100%;
  background: #fff;
  -ms-flex-item-align: start;
  align-self: flex-start;
  text-align: center;
}

.resource-card__title {
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-top: 32px;
  margin-bottom: 20px;
  font-size: 2em;
  font-weight: 500;
  line-height: 1.2;
  padding: 0 15px;
  -webkit-box-flex: inherit;
      -ms-flex: inherit;
          flex: inherit;
}

.resource-card__meta {
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-bottom: 0.5em;
  font-style: normal;
  font-size: 1em;
}

.resource-card__excerpt {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 25px;
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.resource-card__link {
  display: inline-block;
  padding-top: 14px;
  padding-bottom: 14px;
  color: #6d276a;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: end;
  align-self: flex-end;
  font-size: 1.6em;
  font-weight: 300;
  color: white;
  border-top: 1px solid #b149ad;
}
.resource-card__link::before, .resource-card__link::after {
  content: "...";
  display: inline;
}
.resource-card__link::before {
  padding-right: 5px;
}

.resource-card__link:hover, .resource-card__link:focus {
  background: #e5e6e7;
}

@media screen and (min-width: 640px) {
  .resource-card {
    -ms-flex: 0 1 calc(33% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(33% - 50px);
    max-width: 365px;
    flex: 0 1 calc(33% - 50px);
  }
}
@media screen and (max-width: 640px) {
  .resource-card {
    width: 100%;
  }
}
@media screen and (min-width: 640px) {
  .news-card {
    -ms-flex: 1 0 42%;
    -webkit-box-flex: 1;
            flex: 1 0 42%;
  }
  .related__content--home .news-card {
    -ms-flex: 0 1 calc(50% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(50% - 50px);
    -ms-flex-preferred-size: calc(50% - 50px);
    flex-basis: calc(50% - 50px);
    max-width: none;
  }
}
.news-card {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  border: 1px solid #e5e6e7;
  -webkit-box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
  margin: 0 25px 50px;
}

.news-card > * {
  padding-left: 28px;
  padding-right: 28px;
}

.news-card__info {
  color: #565a5d;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  width: 100%;
}

.news-card__info:focus,
.news-card__info:hover {
  background: #f5f5f5;
}

.news-card__info:focus .news-card__link,
.news-card__info:hover .news-card__link {
  background: #e5e6e7;
}

.news-card__info:focus .news-card__link [class^=icon],
.news-card__info:hover .news-card__link [class^=icon] {
  opacity: 1;
  right: -10px;
}

.news-card__img {
  margin: 0 -28px;
  position: relative;
  height: 280px;
  width: calc(100% + 56px);
  overflow: hidden;
  background: #fff;
  -ms-flex-item-align: start;
  align-self: flex-start;
  background-size: cover;
  background-position: top center;
  background-repeat: no-repeat;
}
@media screen and (max-width: 900px) {
  .news-card__img {
    height: auto;
  }
}

.news-card__img:before {
  content: "";
  position: absolute;
  width: 100%;
  height: 100%;
  top: 0;
  left: 0;
  -webkit-box-shadow: inset 0 0 49px rgba(1, 1, 1, 0.1);
          box-shadow: inset 0 0 49px rgba(1, 1, 1, 0.1);
  pointer-events: none;
  z-index: 1;
}

.news-card__img img {
  display: none;
}
@media screen and (max-width: 900px) {
  .news-card__img img {
    display: block;
  }
}

.news-card__title {
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-top: 32px;
  margin-bottom: 20px;
  font-size: 2em;
  font-weight: 500;
  line-height: 1.2;
}

.news-card__meta {
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.news-card__excerpt {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 25px;
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.news-card__link {
  display: block;
  padding-top: 14px;
  padding-bottom: 14px;
  color: #565a5d;
  border-top: 1px solid #e5e6e7;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: end;
  align-self: flex-end;
  margin: 0 -28px;
  text-align: center;
  font-size: 1.6em;
  font-weight: 300;
}

.news-card__link [class^=icon] {
  opacity: 0;
  right: 0;
  position: relative;
  font-size: 12px;
  margin-right: 4px;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.news-card__link:focus,
.news-card__link:hover {
  background: #e5e6e7;
}

/*NEWS LANDING PAGE, */
.newsearchwrap {
  width: calc(84% - 40px);
  max-width: calc(84% - 40px);
  padding-left: 40px;
  padding-right: 40px;
  margin-bottom: 40px;
}

/*
* used on homepage as recent new/resources

*/
.homenews-card {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  margin: 0 25px 50px;
}

.homenews-card__info {
  color: #565a5d;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  width: 100%;
  padding: 20px;
  border: solid 1px transparent;
}
.homenews-card__info:hover {
  border: solid 1px #e6e6e6;
}

.homenews-card__info:hover .homenews-card__link [class^=icon], .homenews-card__info:focus .homenews-card__link [class^=icon] {
  opacity: 1;
  right: -10px;
}

.homenews-card__img {
  margin-bottom: 20px;
  position: relative;
  height: 200px;
  overflow: hidden;
  width: 100%;
  background: #fff;
  -ms-flex-item-align: start;
  align-self: flex-start;
  text-align: center;
}

.homenews-card__title {
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-top: 0px;
  margin-bottom: 0px;
  font-size: 2em;
  font-weight: 500;
  line-height: 1.2;
}

.homenews-card__meta {
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-bottom: 0.5em;
  font-style: normal;
  font-size: 1em;
  display: none;
}

.homenews-card__excerpt {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 5px;
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.homenews-card__link {
  display: inline-block;
  padding-top: 14px;
  padding-bottom: 14px;
  color: #6d276a;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: end;
  align-self: flex-end;
  font-size: 1.6em;
  font-weight: 300;
}
.homenews-card__link::before, .homenews-card__link::after {
  content: "...";
  display: inline;
}
.homenews-card__link::before {
  padding-right: 5px;
}

.homenews-card__link:hover, .homenews-card__link:focus {
  background: #e5e6e7;
}

@media screen and (min-width: 640px) {
  .homenews-card {
    -ms-flex: 0 1 calc(33% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(33% - 50px);
    max-width: 365px;
    flex: 0 1 calc(33% - 50px);
  }
}
@media screen and (max-width: 640px) {
  .homenews-card {
    width: 100%;
  }
  .homenews-card__img {
    height: auto;
  }
}
@media screen and (min-width: 640px) {
  .resourcepages-card {
    -ms-flex: 1 0 42%;
    -webkit-box-flex: 1;
            flex: 1 0 42%;
    max-width: 42%;
  }
  .related__content--home .resourcepages-card {
    -ms-flex: 0 1 calc(50% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(50% - 50px);
    -ms-flex-preferred-size: calc(50% - 50px);
    flex-basis: calc(50% - 50px);
    max-width: none;
  }
}
.resourcepages-card {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  border: 1px solid #e5e6e7;
  -webkit-box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 5px rgba(63, 63, 63, 0.34);
  margin: 0 25px 50px;
}

.resourcepages-card > * {
  padding-left: 28px;
  padding-right: 28px;
}

.resourcepages-card__info {
  color: #565a5d;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  width: 100%;
}

.resourcepages-card__info:focus,
.resourcepages-card__info:hover {
  background: #f5f5f5;
}

.resourcepages-card__info:focus .resourcepages-card__link,
.resourcepages-card__info:hover .resourcepages-card__link {
  background: #e5e6e7;
}

.resourcepages-card__info:focus .resourcepages-card__link [class^=icon],
.resourcepages-card__info:hover .resourcepages-card__link [class^=icon] {
  opacity: 1;
  right: -10px;
}

.resourcepages-card__img {
  margin: 0 -28px;
  position: relative;
  min-height: 200px;
  max-height: 200px;
  width: calc(100% + 56px);
  overflow: hidden;
  background: #fff;
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.resourcepages-card__img:before {
  content: "";
  position: absolute;
  width: 100%;
  height: 100%;
  top: 0;
  left: 0;
  -webkit-box-shadow: inset 0 0 49px rgba(1, 1, 1, 0.1);
          box-shadow: inset 0 0 49px rgba(1, 1, 1, 0.1);
  pointer-events: none;
  z-index: 1;
}

.resourcepages-card__img img {
  position: absolute;
  max-width: 100%;
  max-height: 260px;
  width: auto;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
}

.resourcepages-card__title {
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: start;
  align-self: flex-start;
  margin-top: 32px;
  margin-bottom: 20px;
  font-size: 2em;
  font-weight: 500;
  line-height: 1.2;
}

.resourcepages-card__meta {
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.resourcepages-card__excerpt {
  font-size: 1.6em;
  line-height: 1.3;
  margin-bottom: 25px;
  -ms-flex-item-align: start;
  align-self: flex-start;
}

.resourcepages-card__link {
  display: block;
  padding-top: 14px;
  padding-bottom: 14px;
  color: #565a5d;
  border-top: 1px solid #e5e6e7;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  -ms-flex: 1 0 100%;
  -webkit-box-flex: 1;
          flex: 1 0 100%;
  -ms-flex-item-align: end;
  align-self: flex-end;
  margin: 0 -28px;
  text-align: center;
  font-size: 1.6em;
  font-weight: 300;
}

.resourcepages-card__link [class^=icon] {
  opacity: 0;
  right: 0;
  position: relative;
  font-size: 12px;
  margin-right: 4px;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.resourcepages-card__link:focus,
.resourcepages-card__link:hover {
  background: #e5e6e7;
}

/* Kris*/
.resources-flex-hero {
  width: 100%;
  display: -ms-grid;
  display: grid;
  -ms-grid-columns: 1fr 10px 1fr 10px 1fr 10px 1fr;
  grid-template-columns: 1fr 1fr 1fr 1fr;
  gap: 10px;
}
@media screen and (max-width: 1024px) {
  .resources-flex-hero {
    -ms-grid-columns: 1fr 1fr;
    grid-template-columns: 1fr 1fr;
  }
}
@media screen and (max-width: 650px) {
  .resources-flex-hero {
    -ms-grid-columns: 1fr;
    grid-template-columns: 1fr;
  }
}
.resources-flex-hero h3 {
  color: #6d276a;
  font-size: 2.5em;
  font-weight: 300;
  margin-bottom: 10px;
}
.resources-flex-hero .resource-item {
  background-position: center;
  background-size: cover;
  display: block;
  height: 300px;
  padding: 40px;
  position: relative;
  border-radius: 10px;
  overflow: hidden;
}
.resources-flex-hero .resource-item .resource-item-copy {
  -webkit-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
  position: absolute;
  bottom: 0px;
  left: 0px;
  right: 0px;
  height: 25%;
  padding: 20px 20px;
  background-color: rgba(80, 22, 78, 0.8);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.resources-flex-hero .resource-item .resource-item-copy:hover {
  background-color: rgba(177, 73, 173, 0.8);
}
.resources-flex-hero .resource-item .resource-item-copy h5 {
  color: #fff;
  font-size: 1.5em;
  font-weight: 500;
  line-height: 1.2em;
  margin-bottom: 10px;
}
.resources-flex-hero .resource-item .resource-item-copy h6 {
  color: #fff;
  font-size: 1.2em;
  font-weight: 500;
}

.resources-flex-content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  width: 100%;
  padding: 15px 0;
}
.resources-flex-content .results-key {
  text-align: center;
  font-size: 14px;
  padding: 20px;
}
.resources-flex-content .results-message {
  text-align: center;
  font-size: 14px;
}
.resources-flex-content .resources-flex-content-card {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-direction: row;
          flex-direction: row;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  gap: 30px;
  border-bottom: solid 1px #e5e6e7;
  padding: 20px 0;
}
@media screen and (max-width: 650px) {
  .resources-flex-content .resources-flex-content-card {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
    gap: 10px;
    padding: 40px 0;
  }
}
.resources-flex-content .resources-flex-content-card .image {
  width: 200px;
  height: 120px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  border-radius: 10px;
  overflow: hidden;
  border: solid 1px rgba(204, 204, 204, 0.4);
  background-position: center;
  background-size: cover;
}
@media screen and (max-width: 650px) {
  .resources-flex-content .resources-flex-content-card .image {
    display: none;
  }
}
.resources-flex-content .resources-flex-content-card .image img {
  -o-object-fit: none;
     object-fit: none;
  width: 100px;
  height: 100px;
}
.resources-flex-content .resources-flex-content-card .content, .resources-flex-content .resources-flex-content-card .callout {
  width: calc(100% - 250px);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
@media screen and (max-width: 650px) {
  .resources-flex-content .resources-flex-content-card .content, .resources-flex-content .resources-flex-content-card .callout {
    width: 100%;
  }
}
.resources-flex-content .resources-flex-content-card .content h3, .resources-flex-content .resources-flex-content-card .callout h3 {
  margin: 0 0 10px;
  font-size: 1.8em;
  font-weight: 500;
  line-height: 1.5em;
  color: #565a5d;
}
.resources-flex-content .resources-flex-content-card .content .date, .resources-flex-content .resources-flex-content-card .callout .date {
  font-size: 1.2em;
  font-weight: 500;
  color: #565a5d;
}
.resources-flex-content .resources-flex-content-card .content .categories, .resources-flex-content .resources-flex-content-card .callout .categories {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  list-style: none;
  margin: 10px 0 0;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
.resources-flex-content .resources-flex-content-card .content .categories li, .resources-flex-content .resources-flex-content-card .callout .categories li {
  padding: 0px 10px 0px 0px;
  border: none;
}
.resources-flex-content .resources-flex-content-card .content .categories li:before, .resources-flex-content .resources-flex-content-card .callout .categories li:before {
  display: none;
}
.resources-flex-content .resources-flex-content-card .content .categories li a, .resources-flex-content .resources-flex-content-card .callout .categories li a {
  cursor: pointer;
}
.resources-flex-content .resources-flex-content-card .content .categories li a, .resources-flex-content .resources-flex-content-card .callout .categories li a, .resources-flex-content .resources-flex-content-card .content .categories li span, .resources-flex-content .resources-flex-content-card .callout .categories li span {
  text-decoration: none;
  background-color: #565a5d;
  border-radius: 10px;
  padding: 3px 10px;
  font-size: 12px;
  color: #fff;
}
.resources-flex-content .resources-flex-content-card .content .categories li a:hover, .resources-flex-content .resources-flex-content-card .callout .categories li a:hover, .resources-flex-content .resources-flex-content-card .content .categories li span:hover, .resources-flex-content .resources-flex-content-card .callout .categories li span:hover {
  background-color: #393;
}
.resources-flex-content .resources-flex-content-card .content .categories li a:after, .resources-flex-content .resources-flex-content-card .callout .categories li a:after, .resources-flex-content .resources-flex-content-card .content .categories li span:after, .resources-flex-content .resources-flex-content-card .callout .categories li span:after {
  display: none;
}
.resources-flex-content .resources-flex-content-card .btn {
  min-width: 150px;
  text-align: center;
}
.resources-flex-content .pagination {
  text-align: center;
  margin-top: 40px;
}

.loading {
  display: block;
  min-width: 32px;
  min-height: 32px;
  background-repeat: no-repeat;
  background-image: url(data:image/gif;base64,R0lGODlhMAAwAPcAAAAAABMTExUVFRsbGx0dHSYmJikpKS8vLzAwMDc3Nz4+PkJCQkRERElJSVBQUFdXV1hYWFxcXGNjY2RkZGhoaGxsbHFxcXZ2dnl5eX9/f4GBgYaGhoiIiI6OjpKSkpaWlpubm56enqKioqWlpampqa6urrCwsLe3t7q6ur6+vsHBwcfHx8vLy8zMzNLS0tXV1dnZ2dzc3OHh4eXl5erq6u7u7vLy8vf39/n5+f///wEBAQQEBA4ODhkZGSEhIS0tLTk5OUNDQ0pKSk1NTV9fX2lpaXBwcHd3d35+foKCgoSEhIuLi4yMjJGRkZWVlZ2dnaSkpKysrLOzs7u7u7y8vMPDw8bGxsnJydvb293d3eLi4ubm5uvr6+zs7Pb29gYGBg8PDyAgICcnJzU1NTs7O0ZGRkxMTFRUVFpaWmFhYWVlZWtra21tbXNzc3V1dXh4eIeHh4qKipCQkJSUlJiYmJycnKampqqqqrW1tcTExMrKys7OztPT09fX19jY2Ojo6PPz8/r6+hwcHCUlJTQ0NDg4OEFBQU9PT11dXWBgYGZmZm9vb3Jycnp6en19fYCAgIWFhaurq8DAwMjIyM3NzdHR0dTU1ODg4OTk5Onp6fDw8PX19fv7+xgYGB8fHz8/P0VFRVZWVl5eXmpqanR0dImJiaCgoKenp6+vr9/f3+fn5+3t7fHx8QUFBQgICBYWFioqKlVVVWJiYo+Pj5eXl6ioqLa2trm5udbW1vT09C4uLkdHR1FRUVtbW3x8fJmZmcXFxc/Pz42Njb+/v+/v7/j4+EtLS5qamri4uL29vdDQ0N7e3jIyMpOTk6Ojo7GxscLCwisrK1NTU1lZWW5ubkhISAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/i1NYWRlIGJ5IEtyYXNpbWlyYSBOZWpjaGV2YSAod3d3LmxvYWRpbmZvLm5ldCkAIfkEAAoA/wAsAAAAADAAMAAABv/AnHBILBqPyKRySXyNSC+mdFqEAAARqpaIux0dVwduq2VJLN7iI3ys0cZkosogIJSKODBAXLzJYjJpcTkuCAIBDTRceg5GNDGAcIM5GwKWHkWMkjk2kDI1k0MzCwEBCTBEeg9cM5AzoUQjAwECF5KaQzWQMYKwNhClBStDjEM4fzGKZCxRRioFpRA2OXlsQrqAvUM300gsCgofr0UWhwMjQhgHBxhjfpCgeDMtLtpCOBYG+g4lvS8JAQZoEHKjRg042GZsylHjBYuHMY7gyHBAn4EDE1ZI8tCAhL1tNLoJsQGDxYoVEJHcOPHAooEEGSLmKKjlWIuHKF/ES0IjxAL/lwxCfFRCwwVKlC4UTomxIYFFaVtKomzBi8yKCetMkKnxEIZIMjdKdBi6ZIYyWAthSZGUVu0RGRsyyJ07V0SoGC3yutCrN40KcIADK6hAlgmLE4hNIF58QlmKBYIDV2g75bBixouVydCAAUOGzp87h6AsBQa9vfTy0uuFA86Y1m5jyyaDQwUJ0kpexMC95AWHBw9YkJlBYoSKs1RmhJDgoIGDDIWN1BZBvUSLr0psmKDgoLuDCSZ4G4FhgrqIESZeFMbBAsOD7g0ifJBxT7wkGyxImB+Bgr7EEA8418ADGrhARAodtKCEDNYRQYNt+wl3RAfNOWBBCr3MkMEEFZxg3YwkLXjQQQg7URPDCSNQN8wRMEggwQjICUECBRNQoIIQKYAAQgpCvOABBx2ksNANLpRQQolFuCBTETBYQOMHaYxwwQV2UVMCkPO1MY4WN3wwwQQWNJPDCJ2hI4QMH3TQQXixsVDBlyNIIiUGZuKopgdihmLDBjVisOWYGFxQJ0MhADkCdnGcQCMFHsZyAQZVDhEikCtOIsMFNXKAHZmQ9kFCBxyAEGNUmFYgIREiTDmoEDCICMKfccQAgghpiRDoqtSkcAKsk7RlK51IiAcLCZ2RMJsWRbkw6rHMFhEEACH5BAAKAP8ALAAAAAAwADAAAAf/gDmCg4SFhoeIiYqLhFhRUViMkpOFEwICE5SahDg4hjgSAQJEh16em4ctRklehkQBAaSFXhMPVaiFVwoGPyeFOK+xp4MkOzoCVLiDL7sGEF2cwbKDW0A6Oj0tyoNOBt5PhUQCwoRL1zpI29QO3gxZhNLDLz7XP1rqg1E/3kmDwLDTcBS5tgMcPkG0vCW4MkjaICoBrgmxgcrFO0NWEnib0OofORtDrvGYcqhTIhcOHIjgYgiJtx9RcuBQEiSIEkFPjOnIZMiGFi3DCiVRQFTClFaDsDDg1UQQDhs2kB4x1uPFrC1ZsrL8tCQIUQVBMLgY9uSBFKSGvEABwoSQFy5Z/7NqgVZqygSvRIU0uSeTrqIuSHF00RI3yxa0iLqIePBVwYMoQSX5LKyF4qQsTIR8NYJYEla5XSIzwnHFSBAGtzZ5IcylsyYvJ564lmz5oO3buAttabKEie/fS5bE3LYFi/Hjx7MgtZKyefMhQzCIpvTiipUr2LNjp8vcuXck0ydVt649O90tTIIrUbKEfXsS4T0jn6+ck0x/8XPr34/Dyon8iRimDhZOFFGBC6hwMcUULfhFCRckGFHEBEUwAeAvLUhxwglUYDFbXRgUMeEEGExxYSFaULHhhlUApQgOLSwh4gQTGCECXyYtMowNL6i44hVcTIcDCRXQOEEFTVg1SPAVT0SSyBZVKClIFy1MIYWGUzhpyBM0FpGEFYhxscQRSKTmiTwkiCBFbTJt4d+GCB6CxRFHROGgTFLQiYQ2OVxBAgkM5ZAFFCKIECgnWVBBBZuFvMBXIVkkcQQGIpwiRXBSOFVFoSRsVYgNd0qCwxMYHJHERTlcykSmgkBYaBUnStICEhhgIMUwly7BqiBXFAoFqurY0ASdS3iaam+75mCDFIWe8KEmVJSKQWqD5JpsDi8QCoWUymwxJgZOMGrtL1QUaqc6WShBJreCjItimlEYi4sWUNxqiLu5WCHvNtPhu98iJ/hG0r+MdGFcqAQTHAgAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSDALHjxZGEqcWNCNAQNvKGokGCjQQTYX2Ry84XHjQT4a5JQk2CakwRtu1OQxWXCPAwVlqhQMBNJAm5UCoxAIcEAnTYF+bipYU4NjSwNsgP5pEIAon6MD6yjYeqdgzzYF5QgIIAAO1oF/0mxFI4NgT5ED/YypuqDtWYFSFmyVMzDQ06gCA7kZO8DO3YGA2mw1c1Xg24FVxIxFA8hkH7sF9TTY+uZGDr8XweYAhKaqGCoH96BG2CeNmihNOTLZugCFQCYOHDARaGcAWdEEZ2QYIMCoQTlmcrep4nlgljM4RQQGBKi5Bt9j+hAEVAcBgO9ngAb/pnMmt4MzcLQPtMOmiviBN6KU4RuYSoMv3wF8UdN8ZxU35jkQAR0zCHRDZQvVUFIfaoCRHwBk3PEeQTVEoUaAa+AxYUI3xEHAg2HE8cdEM8yBRm5mZNCfRDWQkR8Ya6inEUoOoKGHSXZ88UUDVGzI0A0oSGgSIG/UseJhG/k4kZJIolUHHXQ8CeWUGmIFyB9YZvlHDVuWpMcaa6ihRphgihkHkwr9kcWabLbZ3B5hihnnmGowgWZCM7SpZxYIzkDHHHP8CeigUpzFpZaIirfSnU026ihHexi30QyxHZVFHW9k4IdJNeyhhx8IalSDFHC8YWodjA7Uhx6s7iEDozdU/8HEG26YGoekE/3hKat68FGgQoHwMYeptGogxYiBaXRDFp7mwSqoCAUiRQbEZiBCRAPtIQW2CP2hB2aj+cErq+ASZAexcuwBVA11MJFuXytlgQIezBX0x6qscltQFnDEQUWoA1HBhLvq8YECCurNMC8Km+40wx57HNnQrwXJMMfAUngUSBUiiGBUIHs8REWl2wG8pBRMxDEHZhx7XFINVOCBgrpN9iHHwJK2LGkfD6FA8Vk32DFwHSTrTNANMeOhR6oJ6THwuwQZ3VDP+tL0Bx0D33Gk1H3p8VAVJm8kA9ZyVJ0DFR3jmoPCUox81x94rFYQx3WonYMffIR91IRcPxHKUB522DGT3xIBsqbehCceEAAh+QQACgD/ACwAAAAAMAAwAAAI/wBzCBxIsKDBgwgTKlxI8BIVSZcYSpxIkNMjBQo4UNxYkNNBRxgfHdzkkeNBLB3qlBzIqRFGRwY5OVpEyWRBS4kcPJjU0aUCmAXxIDCggKdNgVkQOXDgSFNFn0AHdkFjgKilowOhLHUgpaBPkQTrVDUwB+vATIuWrsHE8itBLAyqOmBrViCVpYfqEITK8lHVH13rCtz0aCmiqzlahhy4olBVRU45YqFbsBKapZA8KlYAdtOaqoRWHKwkaWVBLG7c4IlMcI6DQw8kCQSxaI0IgSV+VI06EBOHHz9EHwShqDikSaYvKYIdSSAnkiU76GaAheAmKIYECAigyLRzKGuKK/9aMwfLyhKOkCPcJOWBXueS0AgKEECAIEbenU+CFL44IyiZOLcJQ5oMmAMWjAxCn3YMSGEgQprg0Yh4azQyRX4KceIBIdvVR4gHAUqECRSMiNcBhgl1IUSHgzBSHUeWeLAGTSZFIoggaKyAIkObSCLFjgkRJgJrghVpJEeaJaakaV1EIgIUUD4JhQgiUIFVS4dspaUDaCBWSSNugNnImGG6AQKQCnWBgA5stulmczl8KWaYYjZy5lFquqmnDnA2KSWUU05p5VFY4rVllxkeyUlJSaJ5ZF2cWEKJowcVaBYmUngwRxYmbXLJJZk8SJEmVMzBQQcclEApQZlk4eolXVD/tMkkdXRgqwd11MSRJp++egmRCGURiQeocjCHJLEmtqpzXVziahagiloQFR5wcKoHUkQ0EBZUUFbpZBVh8iy0yRqEx6kdQIHYQJpIIUIk6yopECaUTFKJtJuI62q5BWECAgiTAJsDJYBymkMWK6xgcBf1UqJtRbxesiOoB2XipAilCUQJHnjoeuAk9krr3LIsSUJlJCHGybHHmtQ7yYtFXjKlCB6r3HFDIFPCL1ab4EGlFERujEcl1lUCcrxYWRIo0pWs3C/Ik3hrUxclUHlhZU5XhEW995qVSdWRPDyQ0EQX1AXIlQjMUSYrGFUQ2Qc5KzKho3Fc9qMTNY0H0ngrCrRJJqH2LXhCAQEAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSFBVlTyqGEqcSJBTBwdmPFDcWJDTwVIOHHQ4yMkjx4Op6pwySXBDyFIGvZTS8OJkQRikFFXY0xGkA5gFpxj6ZIaPzYGXcioqxaqiS5EFVyn6ZCgUjKMDTShSNGpKQZ9AB5r6RLYO1oGrNGx1FFEgJ58jB6ZyQFYRjbMDq4zaGokgSDMdTFokC8orXoFePGy1cDUHp6dxc7BoQPZNU46p2hZ8YWHrBy8C4SK2QLYBT4MvWLAsmGpDqRSXB3IytXcUC4GR3rzpm8OEoaEaC9L4QPb2wVO633jYs1rVG50m3HopKbAOqE+hUhFkhcqBge8VVrv/NeEouSNTqVie6MBHvOwqFXg7zqPowHcDCRy5d8znQ/I3GqByl2OgLTSdQKloUMh9BoRyQoEIsVJFB/+Vksd+CXFShyEMGlLHKhPRYIIGydWBIUKriHJfAhpoh5kpjtB0EioHHKCIakd5sceFJ7HSASoQHibkkBx5ZKRjSKJ1gglLMumkCcbZ5MUGolRppZWKNAZDBx2UUkqXXX4ZyYkLsQJKAGimKQCaAqAi0JZfesllmPKdtIoha66ZJptu5rDKFCYw2WSgJ+SB1WNXJpqlQmRuZOSjbhEpqUGcpFJTj2/UEdtJNFRxyimaUWTKF1+YkUKjBrGyRySmtJoCR6t8/wLArAGMcilDXrxgwimtnmLCrRPJ5Mmss3pSyoAIcXLJFLzyGgkLsaFK0AuK8EAsAIVEEiRBe/DaaxXI5pAKC+HGpEq0KTTwBbFfKLKtQFX0ekJ626VwwhQupnpJKpesxkodBxAbyn40oIIKH+++cMK9bV3ywgttsZLKxCAWdIkGnXRSRUI0VCycvSeclgMMeeSRryoTX/JuDnucehILC6fg8bgsNJaDF/umUu5ZqgB6gs0js1AzQaukvPJJXuSxcBWbwsCCyRXtC4Mq0i6UysInXHKT0PkKVPTEm9rEir1Qiud0HkALhDK/VaNYhQlT7Oz00AVJzO/RFK3CR9pvPhndNVo0tG0TyXRPKhHNfxue4Sqr4K244QEBACH5BAAKAP8ALAAAAAAwADAAAAj/AHMIHEiwoMGDCBMqXEhwBgsWNBhKnFjwiRo1pihqLMjpIK2LdA7m6rjxoJYRJkgS/KgmZMFctGZhKVkwy4Y3jnBxZOmS4IpYh2TppClwxs03dDQV/Eihp8BVRxw4UKOF6MAUb7KuIMiJliw1TwqikuqgltWBmjxknRVRYFeQBLXIknpk1dmBlBxlNbHyYtiBtKTGUnF3ICdTR45oyAL4a08XaKRuyFVyRtuaGrI+6fgWrMBcGqRGGFoQF6WEM2jRWUFZbFZHp3OYWLKEb44UQB04FUiDjlQXCG3RnjUCl8ocNJbgJJyDk/OBtWI5oFB1YC4TsgwpULABYQoPS2aF/0dVXaCKJzMRcmLhyJZhFm20bzfk4bhhLLXEi6eVwm5z+yKRlMUSQmyngCEUqAAgQblQ8oR44dFByYIJcTKCAwYqgEYtSkm0Sgq0hDcLKhQilMsi8h3iQXkUzWDCLB4wtpEKZRjyBnBEcWJaiRWacktrhQUpZEmcNefWcwJpsoIKS6rApJMqkEbkLItUaWUbbSxyhIwnmWLKCF6G6aNVmjgAy5kFoHkmLO7l0KWXYIp5C5lmrmnnmW0qCeWTT+JIEydUWiloG1sOuRCSziFp6KKGzSDjRppoMAKQJa1CyS23XEYRKoIIgoaCkGKRgi2ksgCpEAGkWsARUirESRYqkP9KqgosSgQTAq+kGkACHmhqECcOyXpLClgAyeNTrWHRRgG6viKECZQShMUtwlLiH2+4XGtQLiMksIRhKqAhiK6CtLGgC6TessIMxzXIAiUzIPRGKwD44GcOmoxgSK4ByLLgKk5mAaAWD7Hg3yozzODfE/QCoIZ9Rh1wwFYIrdJhQZaysEJ6yGWRRVuaHAIAAGCkcJALzG2ExUOUXEyDx5elAMbIQlx81yoas8Diyx8bpsbIrfx1FycurMCCC5TyrCkuPoyMQK00zWA0RAU52jNBS4wMgCN35eKCxsYVpHTVQIzcQ2xEaULJQ9ryBrNBtbgCwCsmn5VLFlB3fDWDFAwUxihBY297bGGB/31oLiMZrnhBAQEAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSDCTCxeZGEqcWPDOmzd3KGosyOmgnQtv7Bzk1HHjQVW2qJQk+PGCyII3RPxKZbKgql9MmtAsaOeiCIMs2Ci64KfmwEw4mdy5UVDExZcDWUFSNFSV0YEsmGhlQZDTxzc/CdqiusbW1ah2tIqowfIpQVVvqEJidXbgiyZaqbAEKaIkJxFU2QCrO5CTCa1OLg38CvWFBapOVlLMxNbgJSdaTXT06jYHpyZULbw4mMpFwkwlSrhgWpCK1iajc1D59UtvDhVrqEIdWEOEBAlFDwITIcKOrVSSe+cMVnilCaG+rA68QYUNrwa8miBkYYd4cRURBwb/K7FzZDAmtgW60PCA1/UHvyQTvISiO/E7LOh6ln+QdY7LETSA3QNvsMBfVy+Y4J0dJvhxYEKclCCBe+4pYoJ+DLESzB3epTfRDb5gx0sEv0inUSYq2HGHYhux0B4TsdXESSoxahShCv4RpuOOJpHk2Y+S3eBCMEMGY2SR5dUUAkhv+HKRk29owGImKJhggi1YYnklMA8ydAMbCoQp5gJhLmAbSlnacqWatgxm1JdixlmmbUIaeeSdSW70ly++aNCnn3wywSKPhBZaVyYmanQDEyVgaBIrfgTDQmUamaCLLooYuNENqUjKAjDBUVRDLwaUmoAGeUKoigufAsMCRJuG/7BLqaXuEkJ4CdXwAgutBnNJlwfVwJofGiRAqwEPoJAjQanw6ioLqTjKiirLEnTDHbtoJxAnwCiiC60I+HJgs66+UINknFySSrQC3cDKuQJpMEAACdR4gwkN0GrBgaw8pAp/mazLLidvXHqBQHbMK4AFBqniRJhcIcRKtTncoG4q4XHCCwAA8CIQK70EEIAYKhy0K7AIBZzKrwNt3HFJKoghci+OnsXKupdQqjHHHg9kgQABDLDbWar4sfJKO3dMkB8JiLxAokbVILCjSfc8UBNAB8BEXemm4gfUVUuWSQMi68LcVRavvGzYBZVAgAC6lHwWJ5Qd5LLV01kggZuGehZ2d38oE9YLxxH0LdELdthRo+GM5xAQACH5BAAKAP8ALAAAAAAwADAAAAj/AHMIHEiwoMGDCBMqXEiQGAwYxBhKnFgQhTBhKChqLFjsoIklwkwc7LgRYSZgVw7iuSiSowk7l0oWzFRCBEyDJlga5JMBg5IsMgcSMyFCBAqSA3OGLGjjiRufM4IO5GPHJq6CSvEUlISh6zCpA3OhKGrCBsGcS1oKzLSkqxyzYAVeqiqCEkE8ILUmdeMmg924AotJKloi08CVS/TmyKKk6xOkFInBnRmpqCSSaFsWE9E1CVCDl2AkJCZpWBbIAq8UtfP5SqRIKXNQyvBUrVATfD/vxMMb2AzINohGuhoYqaSeSwwPFJxEkfPHB2Gg4I0HBaWIA2FIioqwGIwnkgji/5JTxLmiIpESZroynfcwXLmWM0Q6t4L5IksooeZ4SRJ1FJLEtBEKbtyHwTCTLZQLDMO0d8V+ChUjjHmM2KGcRsRQggIKF1JESQUVOKGbTJmMSFExeAADIWAstjgRSTBCVkwWD2VBIww3cidTMZEoscQSPgL5oxzcEXPFkUgmSdyOGTgwhANQRvkkMAIZmeSVS5ZUDAZRSjnEEKFQmcOMONqIY406yhQJSBe1CRKRLkq0Ypx0DmRDgic+YUJ8QeWSySWX8KmRJAww4IZ+GxVDzCU2ZpGmRLm4ocCkQixhYkLF2DBDo47iOV8koUw6aSgiYJdQLps2egkxJOXiqUE28P95iRxDiBqEIigIWtCiqmYCmTCFiKArQcWYEMoTBFGCQRC2LgFhiTbOMCwuPejQihsCuWoDScL8YAADI4olgahJdDfDJZ4Wo4gO1iKbgxJBBKGEQCV4a0ASqBEjApRZcgQhCjywOwRcRAQQABHZKmKAAQmIWVAWf2lkgxDsBvBVDrkUfDBJVySwsCLDSvVEK+wWAaPGRCCVxMI/lMDiJT+w60OWKBOUBQMLO/CoTBmwq8MSxBb8CsIEPbGwAU7ERckr7BbSYQ4oQ0YMEQsr0O9GwzDdSnpBG0z0WQgYoEBsUkkSiiKeRl1QLhkwQjZYxYRcDBGvHDzSnC0qUrcieNcLmV0JJYjm9+AGBQQAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSBCQlmWAGEqcWHAFFBErKGqUKEmECEkHA21MCEhZn4OSLoI0mOzElpEFa7RE9rJgx48Gl8lZcqwmzByAJJ04sUIkwZsrB3qpxYTnn58Dlw09scymx4wEW8hhwuQK1IGBVpyQIsnLUY9Jc9R4whWK2a8C/yAbenIgUoLJuMqpCzdHoBZDkdUYuALtQC20mpYwqhHQ24KAWp5oYfQm1kBSuNLScnBLVYQllW1hPLDP1JrKkCFTJrDPTibJDEbesIHzwWVXcisbTNCLUGSfDV5J/IS3wL9yMCiHglBL7ucQCTp/mlBLiRYEl4lAohwDEimkCdb/gPH8SotljyUy/iMliRs3ymkpC2/wj7Lyyv7QXyhpSXcMS5Q1USBatLBCbjBsFMgTGMCXhBTUNYZbC8ZR1AcSSIgQHEw1RLiRJFfs19eIJKoH1nGkBfLHiiy2WOFIJdAioxwy1vhETV4so+OOPPo0UiBLKCLkkERil4MXD/HYI1RAEulkEUaq2OKUL2oUyAm0HHNMllweI4KHJYYp5k+AMBiRgrUkk56VyRjzxRcijHTFA7wkwdpGfRQBBgB8klGlQl4kwcugEBxjG0N/LOEDn3x6ssSaC12pCC9mUCpBCX8qVQsZjAIAhiJ1eZFpb0ZtcQwElFbqhiT7eaHIF4x+/2EMMozJYUwJkB4nCRvMlbYEnYM+cAx9gTzAKAJPnNnaGAF0ksRxgABilAigKPDAhr4ZQSkvTOwnSSedIOGjX0YIEIAnzAXCxKBMCITMAgoosER4NZQggQQJIpSMkTYVEEAAEJxphAEGsCGQFxjEawxWBS3DF0WAQPBvAQwPbIARRiljRrxG5AoTFJ0IIIAbRgVisREEyRHvAieMuMUCIo+Rr0AnSwdBvBGACdMS/wogR0E1E1RLvAo8AZcyB/xrjIcmE4yxeGzEy8vMMElygACelFBQ0xeHJ0m1vPD70woSdGxQ0AQFIoedIwaSKxsEG2xQICKWiEEBBmAw5kRSSQex4d6ADxQQACH5BAAKAP8ALAAAAAAwADAAAAj/AHMIHEiwoMGDCBMqXEhwE5ctmxhKnFgQFx48lShqlEjpYkaDxTYm3JQly8FKFymBpGSFi8iCmihdoVTDYEc8KgtqseMMlcuXAjdVunIFV0iCNz8OLIbCWc+aQAVyIXrl58CkBf04taM0ajFcRCtFHIgSJ8Eaz5ziGRtVYA2ZV7Qg9Yh0q8m2BLMQpaSJLF2pkZwOO6qxGGGCMYn6ufq32DCnkawS5CIXYTEtWvoa1LL3p94ri3Nk4eksZ0MrIEBsQcilZJYtmpcOpbRa4GFcgZ/FzvHVTocOHPAgrKHFdRYubHNwwQUV4ZZhuAhuQdWMA/Bmw0ZuMa6lxmGGhGtA/5vDwXqHSFm+G9S03XV3kZSe/Lb+hFJyhcWIu65NsRgq83MM0xxFDmF2n0RZNNPMM/y9tMluGhWlHl4UWmYbb7xN+NKEhOGCBi8ghhhiIwdS9BhPKDpjhx2RCRSJDjDGKCMzAxYGQiMX4Ihjjjl+ZIeMQOpAI1DFgMCjjhfk2MhHHooo4iGNaCgRNE5tpSJkkhmGYYYVdumlSJrYkUSJCxWDBzRkTomGIIJEAt8iozQT3UZ+XDBIAHgKUWOZzUzgZxt2NKgQF80QIgCeAhAyR5oHOdbIKH5O0AgeezaECigCHCrAIG2E9iBDmxzFhR1tRDqKEldweIEgmQYgyAPQEP/2xAPPkFnMFY6gQpAfcywyAaSjONPoBIgaYsdufoACywEd2BbqUZE8wMsEldl2hRKQTgDChFYccAAHguaQBCyDHKBrDs4sssgTAkHzwCGHzPFdDXjkeNdB0HQ1kBWEwALLBGM5ooACUfLGAS+HoKGvQFuEppEmE/hbyBUDCUzwQLhEAOKYXaLCjL9JEJbEwI0Q9ESI2VG4BS/+gnJvDhYXzPAEh/CyiGRAzeEvLOwSNPLFBOGBMC924IWLAv4+gLPFjhymSSMgRvCySFYgfYBwBcX83RXSprHwRlcswnHWJIMEQgcOt6WlQTE3+iVCHAwc8tsTaTHMMNXSrbdBAQEAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSPDGqlWcGEqcWDDLlStZKGqUaPEKlo0bOWXKdBDLFSsfDWJRZgNkwRtasmi5ofJkSoKZUOBRscrlQE4xs5AsaNJjQU5X8OBJ0dKnQBtZovYkWPSmQC1KUWR0KpDTlqhaIg6s2lCFUis0uT6NmmWqQLJjleLZohYn2LQ54OawkUIKnmBiNaYIdhBoVLpvL95UpjSFW4Krhh5U0amTBi0GV7FNu8WSJcRbdOKxZPCGshIlHv8MBaC1rhBNu37VonpgFp0q8ObglAUPFCjOrBy8oehLawBfGqQIbGOLboOZrmAemEkFcGfOoBAeXqvQcQA8FJH/psj8Si3s2FGEVZiplI/vPko9Z2hJCvYQUKRYCrzQkqIAxyVQm0KcqIBeLVfERlEKDXzxhTMgbVELFCpIBpINIbyhIEWWbKUWf3UlxMmIu0VEYogLYaGIKKKsyOKLkICo0RVS1FgjHjbiMZUUAfTo44+gDDhRLaUU2UGRpRzZQUol/OhkAKBsSF4tRxqJZAdLvuUiixO8KAok802ElI1k3uiWiSWSKCOKbLaJ0A0ldBDmQgUC5pQViugSjRQgWaJBBiF4SBEWGiRgQDTRTCMlgRm+8YYGUljIXghBGHBoNEGEMGdCVpTiqKMdqLDoQDfgMQ2iiCaQwU2bkipWJlJo//DpG07YaRAnGegZjQG6KGJFYLVQo8KauwXTAR4EZRFCBqQ4moEUMnLCCKoNlKAbFtOAkmlXuw2EBzWKvDFdV8E0IesbUCCkDBmFOCFpDk2wGwSfOUDxBinp5mAFuIo4AyJfkEAyrkFWKHNQMA2QAQopaXUgjTQx5nCDE4oowojBBn0F0g1vFFJIA1cMVIoZ0pQyFiMVN9GqRiiA4nETgZUijRkmDwRFxWsIV1cmiigciqAdkByxQJlkULEGQmrkjMug5Cvyw0MLlMIaFdPrVBbSeKyIpA6bAUlBNpRSMSmCgqRMKIWAgoJBI5dsUDBrUMOIVS4po0EpMsoMMYicQB7hRNk+nVhQ11/f6uZBTZDcweETbWGFFQMzLvlAAQEAIfkEAAoA/wAsAAAAADAAMAAACP8AcwgcSLCgwYMIEypcSLDYjRvFGEqcWPBPqlR/KGpseOOgRYwbN6oINaFjxYsZDWpJZTLkwGQEALiqZfBjSoJd9kyqBMjlwD2CAAAAclPgR0wGYUyatKelTyRCAXA4CZIgJp2TkPocqAWBUB8wCNpsWGmppYhbBz5pJZQC2hxjuS7d0yUtQUDVhAZINjBujhtYw4bMU+lgMh5Ch/SEi3JgqqWTFhe8URfhpB8/OGgdWIyC0FZPBHbBhKnyH8ipDBZLlUyF5IYTAgR4tcDO60oxWzVCiKlsJadw89gaXlh1GwKyAxCAoOItByC2EwKCUbRLpVvDbd2yhPCGiWqvkg//ciOYssYbMJJlv5V1IaZmhMLPJvTh7UQtKtarSGVfIQw3g4T3SjWVTVTMHtklYwlwDBWjAgQECELTRn/ccgtdWwFihwYMSpQKJv25FKJdCkX01ogkGpSKG9RQ04aLL7Y4S4cTWaLCjTjimMdithjg44+D/CjNaxvdIsKRSCJphxYC9fjjkz6GQiRFxSST5JVLCpRKIy3G2KKMNEpkY4457thQDvahmOKabCp0g5FhJnTgWVtV0sgCDKgQkhbNNGPCZhTxWc0nhLYRp2qozMLBLB8kU+BCgNQCAaGESmOHmgjtccwsis7yRFMlqkDBApRWw0FqaGIq0FtdJPNBp7PU/8LfQcU0wwClC7QxCUEmILFrQjA8oedAmJjQzKIcNMOXahpQGoEtr2lBgTShTGjiQCog0QgHRRVjiQiccnALQpVIM8QTRQl0zBDSSDNuDrZwwIEJAu2hbSP0TpbHMccAWtAe3BlkSQTscqguBRN8sKoIjbihAaoVMbnRDRu0C0FxORwzQcJopaKBG26IcChFI7GrsFoTUHCyQCY00ggSe6TYhRvsyiKxuhsfI9YsbjTSzJQh1WKuNKgUdAzCKwukgsuNLLuVFhOY68ajGW+c9F8f9KxZWpbIMkQowxKkMccFWYKEGxvc7BMMsxwT4thXo2lCliQWM6LGKtPaJkIipA8c2t4T/bHHHv4CbjhBAQEAOw==);
  background-position: center;
  padding: 40px 0px;
}

.resource:before {
  display: none;
}

.resource--feed {
  margin-top: 0;
}

/* CALL OUT
variations used around site
*/
.callout {
  border-radius: 60px;
  border: 4px solid #ebeced;
  position: relative;
  padding: 50px 25px 10px;
  margin: 50px 0 100px;
  max-width: 800px;
  margin: 50px auto;
}
.callout:first-of-type {
  margin-top: 100px;
}
.callout:last-of-type {
  margin-bottom: 50px;
}
.callout:before {
  position: absolute;
  content: "";
  font-family: "icons";
  font-size: 43px;
  padding-top: 15px;
  text-align: center;
  width: 75px;
  height: 75px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: -42px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.callout .iconbubble {
  position: absolute;
  font-family: "icons";
  font-size: 43px;
  padding-top: 15px;
  text-align: center;
  width: 75px;
  height: 75px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: -42px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.callout--symptoms:before {
  content: "\e914";
}
.callout--risk:before, .callout--prepare:before {
  content: "\e90e";
}
.callout--doctor:before {
  content: "\e913";
}
.callout--treatment:before {
  content: "\e912";
}
.callout--expect:before {
  content: "\e90b";
  padding-left: 9px;
}
.callout--benefits:before {
  content: "\e918";
}
.callout--cdc-value:before {
  background-image: url("/webimages/CDC-icon.svg");
}
.callout--pe-value:before {
  background-image: url("/webimages/PE-solutions-icon.svg");
}
.callout--together:before {
  background-image: url("/webimages/offerings-icon.svg");
}
.callout .callout__title {
  border: 0;
  margin: 0 0 16px;
  padding: 0;
  color: #6d276a;
  text-align: center;
  font-size: 2.4em;
}
.callout--split ul {
  -webkit-column-count: 2;
     -moz-column-count: 2;
          column-count: 2;
  -webkit-column-gap: 4em;
     -moz-column-gap: 4em;
          column-gap: 4em;
}
.callout .btn {
  font-size: 1em;
  margin-top: 15px;
}
.callout_about {
  height: 350px;
  margin-bottom: 0;
  background-position: 35vw top;
  background-repeat: no-repeat;
  background-size: contain;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: reverse;
      -ms-flex-direction: row-reverse;
          flex-direction: row-reverse;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  padding-bottom: 0px;
  position: relative;
}
@media screen and (min-width: 1241px) {
  .callout_about {
    background-position: top right;
  }
}
@media screen and (max-width: 830px) {
  .callout_about {
    height: auto;
    background-image: none !important;
  }
}
.callout_about .container, .callout_about .digestivecare_sections, .callout_about .related {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-direction: row;
          flex-direction: row;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin-bottom: 0px;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: start;
      -ms-flex-pack: start;
          justify-content: start;
}
@media screen and (max-width: 830px) {
  .callout_about .container, .callout_about .digestivecare_sections, .callout_about .related {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.callout_about .container .content, .callout_about .digestivecare_sections .content, .callout_about .related .content, .callout_about .container .callout, .callout_about .digestivecare_sections .callout, .callout_about .related .callout {
  margin-bottom: 30px;
}
.callout_about .container .inline-image, .callout_about .digestivecare_sections .inline-image, .callout_about .related .inline-image {
  display: none;
}
@media screen and (max-width: 830px) {
  .callout_about .container .inline-image, .callout_about .digestivecare_sections .inline-image, .callout_about .related .inline-image {
    display: block;
    margin: 0px -30px 30px;
    max-width: 100vw;
  }
}
.callout_about__main {
  width: 40%;
}
@media screen and (max-width: 830px) {
  .callout_about__main {
    width: auto;
  }
}
.callout_about__main .btn--outline {
  background-color: #fff;
  border-color: rgba(177, 73, 173, 0.35);
}

.list + .callout {
  margin-top: 100px;
}

.cta {
  margin: 90px 0 0;
}

.cta--primary {
  background: #6d276a;
}

.cta--primary--alt {
  margin-top: 0;
}

.cta__content {
  margin-bottom: 30px;
  padding-top: 30px;
}

.cta__content .btn {
  margin-top: 15px;
}

.cta__img {
  position: relative;
}

.cta__img img {
  display: block;
  min-width: 100%;
  min-height: 100%;
  position: relative;
  z-index: 2;
}

.cta__img.playing img {
  z-index: 0;
}

.cta__video {
  position: absolute;
  top: 0;
  width: 100%;
  height: 100%;
}

.cta__video__title {
  position: absolute;
  top: 20px;
  left: 20px;
  width: calc(100% - 60px);
  color: #fff;
  font-weight: 300;
  font-size: 2.1em;
  line-height: 1.2;
  z-index: 3;
  opacity: 1;
}

.playing .cta__video__title {
  display: none;
}

.cta__video__play {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: 4;
}

.cta__video__play [class^=icon] {
  font-size: 50px;
  color: #fff;
}

.playing .cta__video__play {
  display: none;
}

.cta__video iframe {
  position: relative;
  width: 100%;
  height: 100%;
}

.doc-search {
  background: #e5e5e5;
  padding: 20px 0 5px;
  margin-bottom: 30px;
  position: relative;
  z-index: 3;
}

.doc-search .content, .doc-search .callout {
  padding: 0;
}

.form label.error {
  color: red;
  display: block;
  font-size: 1.3em;
  margin-top: 3px;
}

.intForm ul li {
  background: none;
  padding: 0;
}

.required {
  color: #565a5d;
}

.freeform input[type=radio] {
  display: inline;
}

.preferred_physician_wrap {
  padding: 20px 0 0 30px;
}

.preferred_physician_wrap.disabled {
  color: #c9c9c9;
}

.preferred_physician_wrap.disabled a, .preferred_physician_wrap.disabled a:link, .preferred_physician_wrap.disabled a:visited, .preferred_physician_wrap.disabled .styled-select select, .preferred_physician_wrap.disabled .required {
  color: #c9c9c9;
}

.preferred_physician_wrap.disabled a:after, .preferred_physician_wrap.disabled a:link:after, .preferred_physician_wrap.disabled a:visited:after, .preferred_physician_wrap.disabled .styled-select select:after, .preferred_physician_wrap.disabled .required:after {
  opacity: 0.5;
}

.intForm__img {
  float: left;
  padding-right: 30px;
  max-width: 100%;
  display: none;
}

.hero {
  padding: 57px 0 21px;
  position: relative;
  margin-bottom: 42px;
  overflow: hidden;
}

.hero--alt {
  margin-bottom: 0px !important;
}

.hero:before, .hero:after {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 0.7;
  background: url("../../webimages/hero-bg.png") no-repeat 0 40%;
  pointer-events: none;
}

.hero:after {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 0.05;
  background-color: #6d276a;
  background-image: linear-gradient(12deg, #6d276a 0%, #6d276a 22%, #6d276a 100%);
  -webkit-box-shadow: inset 0 3px 166px rgba(109, 39, 106, 0.2);
          box-shadow: inset 0 3px 166px rgba(109, 39, 106, 0.2);
}

.hero .container, .hero .digestivecare_sections, .hero .related {
  z-index: 2;
  position: static;
}

.hero .container-flex {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}

.hero--detail, .hero--home {
  padding: 25px 0 21px;
  margin-bottom: 20px;
}

.hero--detail:before, .hero--detail:after, .hero--home:before, .hero--home:after {
  display: none;
}

.hero__title {
  font-weight: 500;
  color: #565a5d;
  font-size: 2.8em;
  position: relative;
  word-wrap: break-word;
  z-index: 3;
  padding-right: 50px;
}
@media screen and (max-width: 991.9px) {
  .hero__title {
    padding-right: 0;
  }
}

.hero__subtitle {
  font-weight: 500;
  color: #565a5d;
  font-size: 1.8em;
  line-height: 1.3em;
  position: relative;
  word-wrap: break-word;
  z-index: 3;
  padding-right: 50px;
}

.hero--detail .hero__title {
  font-weight: 300;
  font-size: 2.8em;
}

.hero--home .hero__title {
  font-weight: 300;
  font-size: 2.8em;
  padding-right: 0;
}

.hero__icon {
  position: absolute;
  top: 50%;
  right: -10px;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  height: 100%;
  z-index: 1;
  image-rendering: -webkit-optimize-contrast;
}

@media screen and (min-width: 768px) {
  .hero {
    margin-bottom: 60px;
  }
  .hero--detail, .hero--home {
    padding-top: 43px;
    margin-bottom: 20px;
  }
}
@media screen and (min-width: 992px) {
  .hero--home .hero__title {
    padding-right: 0;
  }
  .hero__title {
    padding-right: 280px;
  }
  .btn-sticky + .hero--detail, .btn-sticky + .container--sm {
    margin-top: -90px;
    margin-bottom: 20px;
  }
}
@media screen and (min-width: 1024px) {
  .hero--detail .hero__title {
    font-size: 4.4em;
  }
  .hero--home .hero__title {
    font-size: 3em;
  }
  .hero__title {
    font-size: 6em;
  }
}
@media screen and (max-width: 991.9px) {
  .btn-sticky + .hero--detail, .btn-sticky + .container--sm {
    padding-top: 10px;
  }
}
@media screen and (max-width: 480px) {
  .hero--detail .hero__title {
    -webkit-hyphens: auto;
    -ms-hyphens: auto;
    hyphens: auto;
    padding-right: 0;
  }
  .hero--home .hero__title {
    -webkit-hyphens: auto;
    -ms-hyphens: auto;
    hyphens: auto;
  }
}
.hero--dc {
  padding-top: 0;
  margin-bottom: 0;
}
@media only screen and (max-width: 768px) {
  .hero--dc {
    padding-top: 6px;
  }
}
.hero--dc .container .hero__title, .hero--dc .digestivecare_sections .hero__title, .hero--dc .related .hero__title {
  padding-top: 15px;
}

.btn-sticky + .hero--detail, .btn-sticky + .container--sm {
  width: 100%;
}

body {
  position: relative;
}

body.bio-open {
  overflow: hidden;
}

body.has-leaders .page-wrap {
  -webkit-transform: none;
          transform: none;
}

.contact-info {
  background: #393;
  padding: 48px 0 75px;
  color: #fff;
}

.contact-info--sidebar {
  padding: 0;
  color: #565a5d;
  background: none;
}

.contact-info--sidebar .contact-info__subheading {
  color: #565a5d;
  text-transform: uppercase;
  font-size: 1.2em;
  font-weight: 700;
  border-bottom: 6px solid #6d276a;
  letter-spacing: 0;
  margin-bottom: 15px;
}

.contact-info--sidebar.contact-info .contact-info__link {
  color: #565a5d;
}

.contact-info--sidebar.contact-info .contact-info__link:hover, .contact-info--sidebar.contact-info .contact-info__link:focus {
  border-color: #565a5d;
}

.contact-info--sidebar.contact-info .contact-info__link--tel {
  color: #565a5d !important;
}

.contact-info__heading {
  padding: 0;
  color: #fff;
  border: 0;
  font-size: 2.8em;
  letter-spacing: -0.9px;
  margin-bottom: 25px;
  font-weight: 300;
}

.contact-info__subheading {
  color: #fff;
  font-size: 1.5em;
  font-weight: 300;
  text-transform: none;
  padding-bottom: 14px;
  border-bottom: 1px solid #fff;
  letter-spacing: -0.4px;
  margin-bottom: 15px;
}

.contact-info__item {
  font-size: 1.6em;
  font-weight: 300;
  word-break: break-word;
}

.contact-info__address {
  font-size: 1em;
  line-height: 1.5;
}

.contact-info__name {
  display: block;
  margin-bottom: 4px;
  font-weight: 700;
  line-height: 1.6;
}

.contact-info__title {
  display: block;
  font-weight: 300;
  font-style: italic;
  line-height: 1.5;
  margin-bottom: 10px;
}

.contact-info .contact-info__link {
  text-decoration: none;
  color: #fff;
  border-bottom: 1px solid transparent;
  -webkit-transition: border 0.25s;
  transition: border 0.25s;
  display: table;
  margin-top: 9px;
  line-height: 1;
}

.contact-info .contact-info__link:hover, .contact-info .contact-info__link:focus {
  border-color: #fff;
}

.contact-info .contact-info__link--tel {
  color: #fff !important;
}

.list .list__header {
  border: 0;
  font-weight: 500;
  letter-spacing: 0.05em;
  text-transform: uppercase;
  text-align: center;
  position: relative;
}

.list .list__header:before, .list .list__header:after {
  content: "";
  position: absolute;
}

.list .list__header:before {
  width: 100%;
  height: 3px;
  background: #6d276a;
  left: 0;
  top: calc(50% + 20px);
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
}

.list .list__header span {
  background: #fff;
  position: relative;
  z-index: 2;
  padding: 0 10px;
}

.list__item {
  border-top: 3px solid #e5e6e7;
  padding: 31px 0 0;
  margin-bottom: 30px;
}

.list__item:first-of-type {
  border: 0;
}

.list .list__title {
  border: 0;
  padding: 0;
  margin: 0 0 23px;
  font-weight: 300;
}

.list .list__title a {
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.list .list__title a:after {
  background: #393 !important;
  bottom: -3px;
}

.list .list__title a:hover:after, .list .list__title a:focus:after {
  height: 1px !important;
  width: 0px;
}

.map-container {
  position: relative;
  width: 100%;
  background: whitesmoke;
  border-top: 1px solid #e5e5e5;
}

.map {
  display: none;
}

.map-nav {
  background: #fff;
  -webkit-box-shadow: 0 2px 4px rgba(63, 63, 63, 0.34);
          box-shadow: 0 2px 4px rgba(63, 63, 63, 0.34);
  /* NEW JERRY */
}

.map-nav__item--title {
  background: #f2f2f2;
  text-transform: uppercase;
  color: #565a5d;
  font-weight: 700;
  position: relative;
  padding: 0 21px 0 80px;
  height: 59px;
  line-height: 1.3;
  font-size: 1.6em;
  border-bottom: 1px solid #d8d8d8;
}

.map-nav__item--title span {
  padding-right: 10px;
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}

.map-nav__link {
  display: block;
  font-size: 1.6em;
  font-weight: 700;
  padding: 23px 21px 20px;
  color: #6d276a;
  border: 1px solid #e5e5e5;
  border-width: 0 0 1px 0;
  position: relative;
  background: none;
  width: 100%;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  text-align: left;
  -webkit-transition: background 0.25s;
  transition: background 0.25s;
}

.map-nav__link:focus {
  outline: none;
}

.map-nav__link img {
  vertical-align: middle;
  margin-right: 10px;
}

.map-nav__link.map-nav__link--current {
  text-transform: uppercase;
  color: #565a5d;
  padding: 0;
  background: #f2f2f2;
  display: inline-block;
  width: 59px;
  height: 59px;
  border-width: 0 1px 0 0;
  border-color: #d8d8d8;
  vertical-align: middle;
  position: absolute;
  top: 0;
  left: 0;
  margin-bottom: 0;
}

.map-nav__link.map-nav__link--all {
  width: 100%;
  padding: 23px 21px 20px;
  position: static;
  margin-bottom: 0;
  border-bottom: 1px solid #d8d8d8;
}

.map-nav__link.map-nav__link--shortaddy {
  padding: 20px 21px 20px;
}

.map-nav__link [class^=icon-] {
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  font-size: 26px;
}

.map-nav__link .icon-arrow-right {
  right: 13px;
  color: #c9c9c9;
}

.map-nav__link .icon-arrow-left {
  left: 15px;
}

.map-nav__link:visited:hover, .map-nav__link:hover {
  background: #f2f2f2;
}

.map-nav .typeahead__list > li.typeahead__group + li.typeahead__item, .map-nav .typeahead__list > li.typeahead__group:first-child, .map-nav .typeahead__list > li.typeahead__group {
  border-color: #ccc;
}

.map-nav .typeahead__list, .map-nav .typeahead__dropdown {
  background: #f9f9f9;
}

.map-nav .typeahead__list > li > a, .map-nav .typeahead__dropdown > li > a {
  line-height: 1.5;
}

.map-nav .typeahead__list .typeahead__group a {
  color: #fff;
  background: #6d276a;
}

.map-nav .typeahead__list .typeahead__group a:hover, .map-nav .typeahead__list .typeahead__group a:focus {
  color: #fff;
  background: #6d276a;
}

.map-nav .typeahead__list .typeahead__group[data-search-group^=Endoscopy] a {
  background: #b149ad;
}

.map-nav .typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:hover, .map-nav .typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:focus {
  color: #fff;
  background: #b149ad;
}

.map-nav .typeahead__item {
  position: relative;
}

.map-nav .typeahead__item a {
  color: #565a5d;
  padding: 10px 0px 10px 40px;
  display: block;
  line-height: 1.5;
}

.map-nav .typeahead__item img {
  position: absolute;
  height: auto;
  width: 20px;
  top: 15px;
  left: 10px;
}

.map-nav .map-nav__addy {
  font-weight: 400;
  line-height: 1.4;
  color: #565a5d;
  display: block;
}

button.map-nav__link--current:hover, button.map-nav__link--current:focus {
  color: #fff;
  background: #6d276a;
}

.resource {
  position: relative;
  padding-top: 0px;
  margin-top: 0px;
  text-align: center;
}

.resource:before, .resource:after {
  content: "";
  position: absolute;
}

.resource:before {
  content: "";
  font-family: "icons";
  font-size: 43px;
  padding-top: 20px;
  text-align: center;
  width: 80px;
  height: 80px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: 0;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.resource--videos:before {
  content: "\e91c";
}

.resource--infographics:before {
  content: "\e91b";
}

.resource--special-diets:before {
  content: "\e91a";
}

.resource--news:before {
  content: "\e911";
}

.resource--feed {
  text-align: left;
  margin-top: -120px;
  padding-top: 80px;
}

.resource--facebook:before {
  content: "\e910";
}

.resource--twitter:before {
  content: "\e919";
}

.resource__title {
  color: #6d276a;
  text-align: center;
  font-size: 2.1em;
  font-weight: 300;
  border: 0;
  margin-bottom: 27px;
  text-transform: none;
  padding-top: 15px;
}

.resource__img {
  display: block;
  margin: 0 auto 30px;
}

.toellipsis {
  overflow: hidden;
  white-space: nowrap;
  text-overflow: ellipsis;
}

.resource-hidetheicon:before {
  display: none;
  content: "" !important;
  height: 1px;
  width: 1px;
}

.newsicon {
  position: relative;
  padding-top: 80px;
  margin-top: 50px;
  text-align: center;
}
.newsicon:before {
  content: "\e911";
  font-family: "icons";
  font-size: 43px;
  padding-top: 20px;
  text-align: center;
  width: 80px;
  height: 80px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: 0;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.meta {
  font-size: 1.6em;
  font-style: italic;
  margin-bottom: 25px;
}

.feed {
  padding: 0 20px;
}

.feed__item {
  background: #fff;
  border: 1px solid #e5e6e7;
  margin-bottom: 30px;
}

.feed__item__img--twitter {
  padding: 20px;
}

.feed__item__content {
  padding: 20px;
}

.feed__text {
  font-size: 1.4em;
  line-height: 1.5;
  word-wrap: break-word;
  word-break: break-word;
}

.feed__text a {
  display: inline-block;
  position: relative;
  color: #565a5d;
  text-decoration: underline;
  -webkit-text-decoration-skip: ink;
  text-decoration-skip: ink;
}

.feed__text a:hover, .feed__text a:focus {
  color: #393;
}

.feed__meta {
  font-size: 1.4em;
  margin-bottom: 10px;
}

.share {
  margin: -27px 0 25px;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
}

.share__btn {
  padding-left: 32px;
  padding-right: 15px;
  margin-left: 5px;
  border-radius: 0;
  z-index: 5;
}

.share__btn:first-of-type {
  margin: 0;
}

.share__btn:hover, .share__btn:focus {
  padding-left: 32px;
}

.share [class^=icon] {
  width: 35px;
}

.pagination {
  margin: 10px 0 10px 20px;
  width: 100%;
  text-align: right;
}
.pagination .pagination__item {
  display: inline-block;
  font-size: 1.6em;
  vertical-align: middle;
}
.pagination .pagination__item .pagination__action {
  color: #565a5d;
  padding: 10px;
  display: block;
  position: relative;
}
.pagination .pagination__item .pagination__action:before {
  content: "";
  position: absolute;
  left: 0px;
  width: 100%;
  bottom: 0;
  height: 1px;
  background: transparent;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}
.pagination .pagination__item .pagination__action:hover:before, .pagination .pagination__item .pagination__action:focus:before {
  height: 3px;
  background: #565a5d;
}
.pagination .pagination__page,
.pagination .page-numbers {
  color: #565a5d;
  display: inline-block;
  position: relative;
  min-width: 40px;
  height: 40px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin: 0 5px;
  font-size: 1.6em;
  vertical-align: middle;
}
.pagination .pagination__page span,
.pagination .page-numbers span {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
}
.pagination .pagination__page:before, .pagination .pagination__page:after,
.pagination .page-numbers:before,
.pagination .page-numbers:after {
  content: "";
  position: absolute;
  left: 0px;
  width: 100%;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}
.pagination .pagination__page:before, .pagination .pagination__page:before,
.pagination .page-numbers:before,
.pagination .page-numbers:before {
  bottom: 0;
  height: 1px;
}
.pagination .pagination__page:after, .pagination .pagination__page:after,
.pagination .page-numbers:after,
.pagination .page-numbers:after {
  top: 0px;
  height: 100%;
  border-radius: 100%;
  background: transparent;
  z-index: -1;
}
.pagination .pagination__page:hover, .pagination .pagination__page:hover,
.pagination .page-numbers:hover,
.pagination .page-numbers:hover {
  color: #6d276a;
}
.pagination .pagination__page:hover:before, .pagination .pagination__page:hover:before, .pagination .pagination__page:hover:before, .pagination .pagination__page:hover:before,
.pagination .page-numbers:hover:before,
.pagination .page-numbers:hover:before,
.pagination .page-numbers:hover:before,
.pagination .page-numbers:hover:before {
  height: 3px;
  background: #565a5d;
}
.pagination .page-numbers.next, .pagination .page-numbers.prev {
  width: 80px;
  white-space: nowrap;
}
.pagination .page-numbers.dots {
  text-align: center;
  line-height: 40px;
}

.pagination__page--active,
.page-numbers.current {
  color: #fff;
}

.pagination__page--active:hover,
.page-numbers.current:hover {
  color: #fff;
}

.pagination__page--active:after,
.page-numbers.current:after {
  background: #6d276a;
}

.pagination__page--active:before,
.page-numbers.current:before {
  display: none;
}

.partners {
  margin-top: 40px;
}

.partners__intro {
  background: #393;
  padding-top: 50px;
  padding-bottom: 50px;
  position: relative;
}

.partners__intro--alt {
  margin-bottom: 80px;
}

.partners__intro:before {
  content: "";
  position: absolute;
  bottom: -28px;
  left: calc(50% - 21px);
  width: 0;
  height: 0;
  border-style: solid;
  border-width: 28px 21px 0 21px;
  border-color: #393 transparent transparent transparent;
  z-index: 2;
}

.partners__title {
  text-align: center;
  color: #fff;
  font-weight: 300;
  font-size: 3em;
}

.partners__block {
  padding: 30px;
}

.partners__block:nth-child(3n+1) {
  background: #ebebeb;
}

.partners__block:nth-child(3n+2) {
  background: #fff;
}

.partners__block:nth-child(3n+3) {
  background: #f5f5f5;
}

.partners__content {
  text-align: center;
}

.partners__logo {
  display: block;
  margin: 0 auto 15px;
}

.emptyMessage {
  display: none;
  font-size: 1.6em;
  width: 100%;
  text-align: center;
  margin-bottom: 30px;
}

/* NEW JERRY */
.typeahead__list > li.typeahead__group + li.typeahead__item, .typeahead__list > li.typeahead__group:first-child, .typeahead__list > li.typeahead__group {
  border-color: #ccc;
}

.typeahead__list, .typeahead__dropdown {
  background: #f9f9f9;
  padding: 0;
  border-radius: 0;
}

.typeahead__list > li > a, .typeahead__dropdown > li > a {
  line-height: 1.5;
  padding: 10px 12px;
  color: #565a5d;
}

.typeahead__list > li > a strong, .typeahead__dropdown > li > a strong {
  color: #333;
}

.typeahead__list > li > a:hover, .typeahead__list > li > a:focus, .typeahead__list > li.active > a, .typeahead__dropdown > li > a:hover, .typeahead__dropdown > li > a:focus, .typeahead__dropdown > li.active > a {
  background-color: #e5e5e5;
}

.typeahead__list .typeahead__group a {
  color: #fff;
  background: #6d276a;
}

.typeahead__list .typeahead__group a:hover, .typeahead__list .typeahead__group a:focus {
  color: #fff;
  background: #6d276a;
}

.typeahead__list .typeahead__group[data-search-group^=Endoscopy] a {
  background: #b149ad;
}

.typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:hover, .typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:focus {
  color: #fff;
  background: #b149ad;
}

.typeahead__container--location .typeahead__result ul {
  padding: 0;
}

.typeahead__container.cancel:not(.loading) .typeahead__cancel-button {
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}

.typeahead__container--physician .typeahead__item {
  position: relative;
}

.typeahead__container--physician .typeahead__item a {
  padding: 10px 12px 10px 50px;
  min-height: 63px;
}

.typeahead__container--physician .typeahead__item img {
  position: absolute;
  height: auto;
  width: 30px;
  top: 15px;
  left: 10px;
}

.typeahead__container--physician.cancel:not(.loading) .icon-search {
  display: none;
}

.location-list {
  margin-top: 40px;
  margin-bottom: 50px;
}

.location-list__title {
  text-transform: none;
  color: #565a5d;
  font-weight: 400;
  border-bottom: 1px solid #c9c9c9;
  margin-bottom: 28px;
  padding-bottom: 18px;
}

.location-list .location__link:link, .location-list .location__link:visited {
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  background: #ebeced;
  color: #565a5d;
  padding: 15px 30px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  display: block;
  font-size: 1.4em;
  text-decoration: none;
  position: absolute;
  width: 100%;
  margin: 0;
  bottom: 0;
  left: 0;
}

.location-list .location__link:link [class^=icon], .location-list .location__link:visited [class^=icon] {
  font-size: 16px;
  margin-left: 8px;
}

.location-list .location__link:hover, .location-list .location__link:visited:hover {
  background: #6d276a;
  color: #fff;
}

.location__link:link, .location__link:visited {
  -webkit-transition: color 0.25s;
  transition: color 0.25s;
}

.location__link:link [class^=icon], .location__link:visited [class^=icon] {
  font-size: 16px;
  margin-left: 8px;
}

.location__item {
  margin-bottom: 10px;
}

.location--physician .location__link:link, .location--physician .location__link:visited {
  color: #565a5d;
  font-weight: 600;
  -webkit-transition: color 0.25s;
  transition: color 0.25s;
}

.location--physician .location__link:hover, .location--physician .location__link:visited:hover {
  color: #50164e;
}

.location--physician .location__name {
  padding: 0;
  font-size: 1.4em;
  margin-bottom: 0;
}

.location--sidebar {
  margin-bottom: 20px;
}

.location--sidebar .location__entry {
  margin-top: 40px;
  padding-bottom: 90px;
  position: relative;
}

.location--sidebar .location__entry:first-of-type {
  margin-top: 0;
}

.location--sidebar .location__directions:link, .location--sidebar .location__directions:visited {
  text-transform: none;
  text-decoration: none;
  color: #565a5d;
  vertical-align: middle;
  margin: 8px 0 0;
  display: inline-block;
  font-size: 1.4em;
  position: absolute;
  bottom: 0;
}

.location--sidebar .location__directions:link span, .location--sidebar .location__directions:visited span {
  font-size: 1.2em;
}

.location--sidebar .location__directions:link span:before, .location--sidebar .location__directions:visited span:before {
  position: relative;
  top: 3px;
}

.location--sidebar .location__directions:hover, .location--sidebar .location__directions:visited:hover {
  color: #000;
}

.location--sidebar .location__name {
  padding: 0;
}

.location--sidebar .location__item {
  float: none;
  width: 100%;
  padding: 32px 32px 0;
  margin: 0 0 30px !important;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.location--sidebar .location__img {
  display: block;
  margin: 0 -25px 12px;
}

.location--sidebar .location__contact {
  margin-bottom: 7px;
}

.location--sidebar .button {
  clear: both;
}

.location--sidebar.dropdown {
  cursor: pointer;
  position: relative;
  text-align: left;
  width: 100%;
  margin-bottom: 20px;
}

.location--sidebar.dropdown:before {
  content: "";
  position: absolute;
  left: -3px;
  top: -3px;
  width: 100%;
  height: 100%;
  border: 3px solid transparent;
  border-radius: 22px;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  z-index: -1;
}

.location--sidebar .dropdown__trigger {
  position: relative;
  display: block;
  padding: 15px 15px;
  background: #e5e5e5;
  color: #565a5d;
  font-size: 1.4em;
  margin-bottom: 0;
  border: 0;
}

.location--sidebar .dropdown__trigger [class^=icon-] {
  position: absolute;
  right: 14px;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}

.location--sidebar .dropdown__menu {
  position: absolute;
  display: none;
  z-index: 10;
  background: #fff;
  width: 100%;
  padding: 15px;
  border: 1px solid #e5e5e5;
  background: #fff;
  overflow: hidden;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.location--sidebar.dropdown--active .dropdown__menu {
  display: block;
}

.location--sidebar.dropdown--active .dropdown__trigger [class^=icon-] {
  -webkit-transform: translateY(-50%) rotate(-180deg);
          transform: translateY(-50%) rotate(-180deg);
}

.location__name {
  font-size: 1.8em;
  font-weight: 500;
  text-transform: none;
  padding-top: 0;
}

.location__location {
  color: #565a5d;
  font-size: 1.4em;
  font-weight: 700;
  text-transform: uppercase;
  padding-top: 0;
}

.location__contact {
  display: block;
  margin-top: 7px;
}

.location__hours {
  margin-top: 7px;
  font-size: 1.6em;
  line-height: 1.55;
  font-weight: 300;
}

.location__hours strong {
  font-weight: 500;
}

address {
  font-style: normal;
  line-height: 1.5;
  font-size: 1.4em;
}

.mainText .provider {
  margin-top: 20px;
  margin-bottom: 50px;
}

.mainText .provider__list {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-pack: start;
  -webkit-box-pack: start;
          justify-content: flex-start;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
}

.mainText .provider__title {
  font-weight: 400;
  border-bottom: 1px solid #c9c9c9;
  text-transform: none;
  margin-bottom: 10px;
  padding-bottom: 5px;
  color: #565a5d;
}

.mainText .provider__item {
  margin-bottom: 40px;
  border-bottom: 1px solid #ccc;
  display: block;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  padding-bottom: 25px;
  text-decoration: none;
}

.mainText .provider__item__img {
  opacity: 1;
  -webkit-transition: opacity 0.125s;
  transition: opacity 0.125s;
  margin-bottom: 15px;
}

.mainText .provider__item__title {
  padding-top: 0;
  line-height: 1.4;
  -webkit-transition: color 0.125s;
  transition: color 0.125s;
}

.mainText .provider__item:hover .provider__item__img, .mainText .provider__item:focus .provider__item__img {
  opacity: 0.9;
}

.mainText .provider__item:hover .provider__item__title, .mainText .provider__item:focus .provider__item__title {
  color: #000;
}

.sidebar--location a.button {
  margin-bottom: 20px;
}

.sidebar.sidebar--divider {
  margin-top: -70px;
  padding-top: 30px;
  border-top: 1px solid #ccc;
  float: right;
}

.sidebar--top {
  margin: 0 0 15px !important;
  width: 100%;
  border-top: 1px solid #ccc;
  padding-top: 30px;
}

.sidebar--top .location__item {
  margin: 15px 0 0 !important;
}

.sidebar--top .location__item:first-of-type {
  margin: 0 !important;
}

.sidebar--right {
  margin-left: 0 !important;
  width: 100%;
}

.sidebar__title {
  font-size: 1.3em;
  text-transform: none;
  margin-bottom: 15px;
  font-weight: 400;
}

.sidebar .forms__wrapper {
  clear: both;
  margin-top: 30px;
}

.sidebar .forms__list {
  list-style: none;
  padding-left: 4px;
}

.sidebar .forms__list__item {
  font-weight: 700;
  line-height: 1.4;
  margin-bottom: 20px;
}

.sidebar .forms__list__link {
  padding-left: 12px;
  position: relative;
}

.sidebar .forms__list__link:before {
  content: "";
  position: absolute;
  top: 0;
  left: 3px;
  width: 1px;
  height: 15px;
  background: #393;
}

.sidebar .forms__list__link:first-of-type {
  padding-left: 0;
}

.sidebar .forms__list__link:first-of-type:before {
  display: none;
}

.button-sm {
  font-weight: 700;
  font-size: 1.6em;
  display: inline-block;
  margin: 10px 0;
  text-decoration: none !important;
}

.button-sm.location__detail__contact {
  margin: 0;
}

.button-sm [class^=icon-] {
  vertical-align: middle;
}

.awards {
  padding-top: 20px;
}

.awards img {
  max-width: 100px;
  margin: 0 20px 20px 0;
  vertical-align: top;
}

.resources {
  border: 1px solid #e5e6e7;
  border-width: 1px 0;
  padding: 15px 0;
  margin-bottom: 80px;
}

.resources__title {
  font-size: 1.6em;
  font-weight: 500;
  text-transform: uppercase;
  margin-right: 8px;
}

.resources a.resources__link {
  display: inline-block;
  font-size: 1.6em;
  font-weight: 700;
  padding: 0 20px;
  position: relative;
  color: #393;
  margin: 10px -2px 0 0;
  -webkit-transition: color 0.1s ease-in-out;
  transition: color 0.1s ease-in-out;
}

.resources a.resources__link:before {
  content: "";
  position: absolute;
  top: 44%;
  left: 0;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  width: 100%;
  height: 0;
  pointer-events: none;
  z-index: 0;
  min-height: 0;
  background: none;
  -webkit-transition: all 0.125s ease-in-out;
  transition: all 0.125s ease-in-out;
}

.resources a.resources__link:after {
  content: "";
  position: absolute;
  top: -9px;
  left: 0;
  width: 1px;
  height: 100%;
  pointer-events: none;
  z-index: 0;
  min-height: 42px;
  background: #393;
  -webkit-transition: all 0.125s ease-in-out;
  transition: all 0.125s ease-in-out;
}

.resources a.resources__link:first-of-type:after {
  display: none;
}

.resources a.resources__link:hover, .resources a.resources__link:focus {
  color: #fff;
}

.resources a.resources__link:hover:before, .resources a.resources__link:focus:before {
  background: #393;
  height: calc(100% + 15px);
  min-height: 38px;
}

.resources__text {
  position: relative;
  z-index: 2;
}

.resources [class^=icon] {
  font-size: 28px;
  vertical-align: middle;
  position: relative;
  top: -3px;
}

#sideMenu {
  z-index: 800;
  background: #404040;
  color: rgba(255, 255, 255, 0.6);
  height: 100%;
  overflow-x: hidden;
  width: 320px;
  border-left: 1px solid #333;
}

#sideMenu .close {
  background: none;
  color: #fff;
  border: 0;
  text-transform: uppercase;
  cursor: pointer;
  padding: 15px;
  font: 1.6em "MuseoSans", sans-serif;
}

#sideMenu .close:focus {
  outline: none;
  background: #222;
}

#sideMenu .close span {
  font-size: 1.6em;
  position: relative;
  top: 4px;
  margin-right: 10px;
}

#sideMenu ul ul, #sideMenu ul ul ul, #sideMenu ul ul button {
  display: none;
}

#sideMenu ul li {
  position: relative;
}

#sideMenu .side-menu-alt span[class^=icon] {
  padding-right: 5px;
}

#sideMenu ul button {
  position: absolute;
  width: 50px;
  height: 44px;
  right: 0;
  border: 0;
  background: #404040;
  border-left: 1px solid #666;
  border-top: 1px solid #666;
  color: #fff;
  font-size: 1.6em;
  cursor: pointer;
  z-index: 3;
  padding: 0;
}

#sideMenu ul button.open {
  background: #222;
}

#sideMenu ul button.open span:before {
  content: "\e904";
}

#sideMenu ul button:hover, #sideMenu ul button:focus {
  background: #6d276a;
  outline: none;
}

#sideMenu ul button span {
  line-height: 1.5;
}

#sideMenu ul a {
  padding: 10px 60px 10px 30px;
  display: block;
  color: #fff;
  font-size: 1.6em;
  line-height: 23px;
  border-top: 1px solid #666;
  text-decoration: none;
}

#sideMenu ul a:hover {
  background: #222;
}

#sideMenu .mobile-nav > .selected > a {
  background: #222;
}

#sideMenu ul ul a {
  background: #222;
  padding: 10px 50px;
  border-color: #333;
}

#sideMenu .side-menu-alt, #sideMenu ul ul .selected a {
  background: #6d276a;
}

#sideMenu .side-menu-alt a:hover, #sideMenu .side-menu-alt .selected a {
  background: #490f46;
}

#sideMenu .searchBar {
  position: relative;
}

#sideMenu .searchBar input {
  width: 100%;
  border: 0;
  padding: 18px 50px 17px 30px;
  -webkit-appearance: none;
  border-radius: 0;
  margin: 0;
  color: #000;
  font-size: 1.4em;
}

#sideMenu .searchBar button {
  position: absolute;
  right: 0;
  top: 0;
  width: 50px;
  height: 50px;
  border: 0;
  background: #e5e5e5;
  font-size: 2.2em;
  color: #404040;
  cursor: pointer;
  margin: 0;
  padding: 0;
}

#sideMenu .searchBar button:hover {
  background: #ccc;
}

#sideMenu .searchBar button:focus {
  outline: none;
}

.sidebar h3 {
  margin-bottom: 5px;
}

.sidebar h3 + ul {
  margin: 5px 0 0 0;
}

.sidebar hr {
  width: 90%;
  height: 1px;
  outline: none;
  background: #dadada;
  border: none;
  margin: 20px 0 20px 5%;
  display: inline-block;
}

.sidebar .spotlight {
  width: 100%;
}

.sidebar .spotlight ul {
  margin-bottom: 15px;
}

.sidebar .spotlight__title {
  font-size: 1.6em;
  font-weight: 700;
  margin-bottom: 0px;
}

.sidebar .spotlight img {
  max-width: 100%;
  border: 1px solid #c9c9c9;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.sidebar .related-fix {
  display: block;
  width: 100%;
  background: #AD3CAA;
  clear: both;
}

.sidebar .spotlight img + h2 {
  margin: 7px 0;
  padding-bottom: 1px;
  border-bottom: 1px solid #c9c9c9;
}

.sidebar .spotlight li {
  list-style-image: url("../../webimages/orange-arrow-sm.png");
}

.section-nav {
  border: 3px solid #e5e6e7;
  margin-bottom: 30px;
}
.section-nav a {
  color: #565a5d;
}

.section-nav__toggle {
  position: absolute;
  right: 0;
  top: 0;
  height: 100%;
  padding: 0;
  width: 50px;
  border-left: 3px solid #e5e6e7;
}

.section-nav__toggle [class^=icon] {
  font-size: 20px;
}

.section-nav__parent {
  background: whitesmoke;
  position: relative;
}

.section-nav__menu {
  max-height: 0;
  overflow: hidden;
  margin: 0;
  -webkit-transition: max-height 0.25s ease, margin 0.25s;
  transition: max-height 0.25s ease, margin 0.25s;
}

.section-nav__item {
  color: #565a5d;
  font-size: 1.6em;
  line-height: 1.6;
  display: block;
  padding: 8px 20px 6px;
  position: relative;
  margin-bottom: 10px;
}

.section-nav__item a {
  position: relative;
  display: inline-block;
  color: #565a5d;
}

.section-nav__item a:after {
  content: "";
  position: absolute;
  left: 0;
  bottom: 0;
  width: 100%;
  height: 1px;
  background: #4f5255;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.section-nav__item a:hover, .section-nav__item a:focus {
  color: #000;
}

.section-nav__item a:hover:after, .section-nav__item a:focus:after {
  height: 3px;
}

.section-nav__link {
  font-size: 1.6em;
  line-height: 1.6;
  display: block;
  padding: 8px 20px 6px 37px;
  position: relative;
}
.section-nav__link a {
  color: #565a5d;
}
.section-nav__link--active a {
  color: #2d862d;
}
.section-nav__link:hover a {
  color: #2d862d;
}
.section-nav__link:before {
  content: "";
  position: absolute;
  top: 18px;
  left: 9px;
  width: 0px;
  height: 3px;
  background: #4CB053;
  border-radius: 2px;
  opacity: 0;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.section-nav__link:hover:before,
.section-nav__link:focus:before {
  width: 26px;
  opacity: 1;
}

.section-nav__link--active {
  color: #393;
}

.section-nav__link--active:before {
  width: 26px;
  opacity: 1;
  background: #393;
}

.section-nav__link--parent {
  padding: 14px 22px 11px;
}

.section-nav__link--parent:before {
  display: none;
}

.dropdown {
  cursor: pointer;
  position: relative;
  margin-bottom: 50px;
  border: 1px solid #e5e6e7;
}

.dropdown__trigger [class^=icon]:before {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: rotate(0) translate(-50%, -50%);
          transform: rotate(0) translate(-50%, -50%);
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
  -webkit-transform-origin: top left;
          transform-origin: top left;
}

.dropdown--active .dropdown__trigger [class^=icon]:before {
  -webkit-transform: rotate(180deg) translate(-50%, -50%);
          transform: rotate(180deg) translate(-50%, -50%);
}

.dropdown .dropdown__trigger {
  font-size: 1.6em;
  padding: 10px;
  width: 100%;
  height: 100%;
  text-align: left;
}

.dropdown .dropdown__trigger [class^=icon] {
  position: absolute;
  right: 0;
  top: 0;
  width: 38px;
  height: 100%;
}

.dropdown__menu {
  max-height: 0;
  overflow: hidden;
  margin: 0;
  -webkit-transition: max-height 0.25s ease, margin 0.25s;
  transition: max-height 0.25s ease, margin 0.25s;
}

.dropdown__menu--overlay {
  margin: 0;
  position: absolute;
  z-index: 2;
  left: -1px;
  width: 100%;
  background: #fff;
  border: 1px solid #e5e6e7;
  border-width: 0 1px 1px 1px;
}

.dropdown--active + .dropdown__menu,
.dropdown--active .dropdown__menu {
  max-height: 5000px;
  margin: 10px 0 15px;
  -webkit-transition: max-height 2s ease, margin 0.25s;
  transition: max-height 2s ease, margin 0.25s;
}

.dropdown--active + .dropdown__menu--overlay,
.dropdown--active .dropdown__menu--overlay {
  margin: 0;
}

.dropdown__link {
  display: block;
  font-size: 1.6em;
  color: #565a5d;
  padding: 10px;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.dropdown__link:hover, .dropdown__link:focus {
  background: #e5e6e7;
}

.section-nav__parent {
  border-bottom: 2px solid #fff;
}
.section-nav__parent:last-of-type {
  border-bottom: 0px;
}

.section-nav__link--parent {
  padding: 20px 22px 15px 22px;
}

.section-nav__toggle {
  border-left-color: transparent;
}

.section-nav__parent a {
  font-weight: 500;
}
.section-nav__parent.dropdown--active {
  background-color: #6d276a;
}
.section-nav__parent.dropdown--active a {
  color: #fff;
}
.section-nav__parent.dropdown--active .dropdown__trigger [class^=icon]:before {
  color: #fff;
}
.section-nav__parent--active:before {
  width: 16px;
  opacity: 1;
  background: #393;
}

.extraDetails {
  width: 100%;
  padding: 2%;
  float: left;
  background: #fff;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin-bottom: 20px;
}

.extraDetails-Title {
  width: 96%;
  padding: 2%;
  float: left;
  background: #6d2769;
  color: #fff;
  font-size: 1.4em;
}

.sidebarDivide {
  display: block;
  width: 100%;
  margin: 20px 0;
  border-bottom: 1px dashed #c9c9c9;
}

.alert {
  background: #6d276a;
  color: #fff;
  display: block;
  padding: 15px 30px 0px;
  margin: 15px 0 15px;
}

.alert--banner {
  background: rgba(109, 39, 106, 0.95);
  position: fixed;
  top: 100%;
  left: 0;
  width: 100%;
  z-index: 20;
  min-height: 100vh;
  -webkit-transition: all 0.5s;
  transition: all 0.5s;
  padding: 0;
  margin: 0;
}

.alert--banner.slide-up {
  top: 0;
}

.alert__container {
  padding: 0 35px;
}

.alert .alert__heading {
  color: #fff;
  border: 0;
  padding: 0;
  font-size: 2em;
  text-transform: uppercase;
  font-size: 2em;
  line-height: 1.3;
  font-weight: 500;
  margin-bottom: 19px;
}

.alert .alert__text {
  font-size: 18px;
  line-height: 1.55;
  font-weight: 300;
  max-width: 730px;
  margin-bottom: 20px;
  color: #fff;
}

.alert .alert__text p {
  font-size: inherit;
  line-height: inherit;
  color: inherit;
}

.alert .alert__text .alert--banner {
  font-weight: 500;
}

.alert .alert__text strong {
  font-weight: 500;
}

.alert .alert__text a {
  color: #fff;
  border-bottom: 1px solid #fff;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}

.alert .alert__text a:hover, .alert .alert__text a:focus {
  border-width: 3px;
}

.alert__close {
  position: absolute;
  top: 20px;
  right: 20px;
  font-size: 30px;
  color: #fff;
  background: transparent;
  border: 0;
  -webkit-transition: all 0.125s;
  transition: all 0.125s;
}

.alert__close:hover, .alert__close:focus {
  background: rgba(255, 255, 255, 0.3);
  outline: none;
}

.section {
  padding: 40px 0;
  position: relative;
  z-index: 10;
}

.section--image img {
  display: block;
  max-width: 1050px;
  margin: 0 auto;
  width: 100%;
}

.section--table .section__header:before {
  background-color: #565a5d;
}

.section--primary {
  background: #6d276a;
}

.section--primary .section__header {
  color: #fff;
}

.section--primary .section__header span {
  background: #6d276a;
}

.section--primary .info-block__title, .section--primary .info-block__content, .section--primary .info-block__step:before {
  color: #fff;
}

.section--primary .info-block__step:after {
  border-color: #fff;
}

.section--primary-alt {
  background: #782b75;
}

.section--primary-alt .section__header {
  color: #fff;
}

.section--primary-alt .section__header span {
  background: #782b75;
}

.section--primary-alt .info-block__title, .section--primary-alt .info-block__content, .section--primary-alt .info-block__step:before {
  color: #fff;
}

.section--primary-alt .info-block__step:after {
  border-color: #fff;
}

.section--bg {
  padding-bottom: 400px;
  background: url("../../webimages/lifestyle-bg.jpg") no-repeat 100% 100%;
}

.section--secondary {
  background: #393;
}

.section--callout {
  text-align: center;
}

.section--callout h2 {
  font-size: 3em;
  font-weight: 300;
  color: #fff;
  margin-bottom: 30px;
}

.section--callout img {
  display: block;
  margin: 0 auto 30px;
}

.section__header {
  border: 0;
  font-weight: 300;
  font-size: 3em;
  text-align: center;
  position: relative;
  margin-bottom: 30px;
}

.section__header:before, .section__header:after {
  content: "";
  position: absolute;
}

.section__header:before {
  width: 100%;
  height: 1px;
  background: #b149ad;
  left: 0;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
}

.section__header span {
  background: #fff;
  position: relative;
  z-index: 2;
  padding: 0 20px;
}

.section--gray {
  background: #f5f5f5;
}

.instructions {
  background: #b149ad;
  padding: 20px;
  color: #fff;
  font-size: 1.6em;
}

.instructions__icon {
  font-size: 2em;
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  left: 10px;
}

.instructions__title {
  text-align: center;
  width: 90%;
  margin: 0 auto;
}

.instructions__title a {
  color: #fff;
  border-bottom: 1px solid #fff;
}

.form_prep {
  color: #565a5d;
  font-size: 1.6em;
  line-height: 1.6;
}

.form_prep__title {
  font-size: 1.6em;
  text-align: center;
  font-weight: normal;
}

.form_prep__block {
  width: 90%;
  padding: 20px 0 20px 9%;
}

.form_prep__block__title {
  font-size: 1.3em;
  font-weight: 500;
}

.form_prep li a {
  margin-left: 5px;
  padding-left: 5px;
}

.form_prep li a:before {
  content: "|";
  padding-right: 10px;
}

.form_prep li a:first-child {
  margin-left: 25px;
}

.form_prep li a:first-child:before {
  content: "";
  padding-right: 0px;
}

.info-block {
  margin-bottom: 50px;
}

.info-block__wrapper {
  counter-reset: block;
}

.info-block__button {
  text-align: center;
}

.info-block__title {
  font-size: 2.4em;
  font-weight: 300;
  color: #565a5d;
  margin-bottom: 30px;
}

.info-block__content {
  color: #565a5d;
  margin-bottom: 30px;
}

.info-block__content p {
  font-size: 1.6em;
  line-height: 1.6;
}

.info-block__step {
  display: block;
  padding-left: 105px;
  position: relative;
  margin-bottom: 30px;
}

.info-block__step:before {
  counter-increment: block;
  content: counter(block);
  color: #6d276a;
  font-size: 3em;
  position: absolute;
  left: 30px;
  top: 27px;
}

.info-block__step:after {
  content: "";
  position: absolute;
  left: 0;
  width: 75px;
  height: 75px;
  border: 1px solid #6d276a;
  border-radius: 100%;
}

::-webkit-input-placeholder {
  color: #565a5d;
}

:-moz-placeholder {
  /* Firefox 18- */
  color: #565a5d;
}

::-moz-placeholder {
  /* Firefox 19+ */
  color: #565a5d;
}

:-ms-input-placeholder {
  color: #565a5d;
}

.form ::-webkit-input-placeholder {
  color: #565a5d;
}

.form :-moz-placeholder {
  color: #565a5d;
}

.form ::-moz-placeholder {
  color: #565a5d;
}

.form :-ms-input-placeholder {
  color: #565a5d;
}

.form__row {
  margin-bottom: 30px;
}

.form__row ul {
  margin-bottom: 0;
}

.form__row ul li:last-child {
  margin-bottom: 0;
}

.form__col {
  margin-top: 15px;
  position: relative;
}

.form__col:first-of-type {
  margin-top: 0;
}

.form legend {
  text-transform: uppercase;
  font-weight: 700;
  margin-bottom: 5px;
  font-size: 1.3em;
}

.form .form__label {
  font-size: 1.6em;
  margin-bottom: 10px;
  display: block;
}

.form .form__radio, .form .form__checkbox {
  margin-left: 0;
  margin-top: -5px;
  font-size: 1.4em;
}

.form .form__radio li, .form .form__checkbox li {
  border: 0;
  padding: 10px 0;
}

.form .form__radio li:before, .form .form__checkbox li:before {
  display: none;
}

.form .subScript {
  font-size: 1.4em;
  margin-top: 10px;
  display: block;
}

.form .subScript--disclaimer {
  margin-bottom: 20px;
}

.form a:not(.btn) {
  display: inline-block;
  position: relative;
  color: #565a5d;
  text-decoration: none;
  line-height: 1.4;
}

.form a:not(.btn):after {
  content: "";
  position: absolute;
  width: 100%;
  height: 1px;
  bottom: 0;
  left: 0;
  background: #4f5255;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

.form a:not(.btn):hover, .form a:not(.btn):focus {
  color: #000;
}

.form a:not(.btn):hover:after, .form a:not(.btn):focus:after {
  height: 3px;
}

select:not([multiple=multiple]) {
  width: 100%;
  height: auto;
  min-height: 44px;
  padding: 13px 15px;
  font-size: 1.4em;
  font-weight: 500;
  border: 1px solid rgb(133, 133, 133);
  border-radius: 0;
  background: url("../../webimages/select-arrow-alt.png") no-repeat 100% 50% #fff;
  -moz-appearance: none;
  -ms-appearance: none;
  -webkit-appearance: none;
  appearance: none;
}

.form__input--select::-ms-expand {
  display: none;
}

.ie9 .form__input--select {
  background-image: none;
}

.form__input--select select {
  padding: 13px 15px;
  height: auto;
  font-size: 14px;
  font-weight: 500;
  color: #565a5d;
  -moz-appearance: none;
  -ms-appearance: none;
  -webkit-appearance: none;
  appearance: none;
}

.form__input--type, .form__input--text, .form .captcha {
  border: 1px solid #e5e6e7;
  border-radius: 0;
  font-size: 1.4em;
  font-weight: 500;
  color: #565a5d;
  width: 100%;
  padding: 13px 15px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  -webkit-transition: border 0.25s;
  transition: border 0.25s;
  -webkit-appearance: none;
}

.form__input--type:hover, .form__input--text:hover, .form .captcha:hover {
  border-color: #6d276a;
}

.form__input--type:focus, .form__input--text:focus, .form .captcha:focus {
  outline: 3px solid #6d276a;
}

.form__input--textarea {
  width: 100%;
  resize: none;
  border: 1px solid #e5e6e7;
  font-size: 1.6em;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  padding: 10px;
}

.form input[type=file] {
  font-size: 1.4em;
}

.form input[type=file]:focus {
  outline: 3px solid #6d276a;
}

.form .warning {
  font-size: 1.3em;
  display: block;
  margin-top: 5px;
}

.form .captcha {
  display: block;
}

.form__btn {
  background: #6d276a;
  color: #fff;
  border: 2px solid #6d276a;
  font-size: 1.6em;
  font-weight: 700;
  text-transform: uppercase;
  letter-spacing: 0.05em;
  padding: 8px 15px;
  cursor: pointer;
  -webkit-transition: all 0.125s ease-in-out;
  transition: all 0.125s ease-in-out;
}

.form__btn:hover {
  color: #6d286a;
  background: #fff;
}

.form .search__btn {
  position: absolute;
  right: 0;
  top: 0;
  font-size: 21px;
  width: 45px;
  height: 100%;
  text-align: center;
  color: #777b7c;
}

.form .search__btn:before {
  position: absolute;
  top: 50%;
  left: 13px;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}

.form--map {
  background: #e5e5e5;
  padding: 12px 20px;
}

.form--map .form__row {
  margin-bottom: 0;
}

.form--map .form__label {
  position: absolute;
  left: -9999px;
  width: 1px;
  height: 1px;
  overflow: hidden;
  font-weight: 700;
}

.form--map .form__input--text {
  padding: 13px 20px;
}

.form--map .form__input--text:focus {
  outline: none;
  border-color: #6d276a;
}

@media screen and (min-width: 768px) {
  .form__col {
    margin-top: 0;
  }
  .form__col--half {
    float: left;
    width: 48.5%;
    margin-left: 2%;
  }
  .form__col--half:nth-child(2n+1) {
    margin-left: 0;
  }
  .form__col--fourth {
    float: left;
    width: 48%;
    margin-left: 4%;
    margin-bottom: 20px;
  }
  .form__col--fourth:nth-child(even) {
    margin-left: 0%;
  }
  .form--map {
    background: #fff;
    border-bottom: 1px solid #e5e5e5;
  }
  .form--map .form__label {
    position: static;
    width: auto;
    height: auto;
    display: inline;
  }
  .form--map .form__input--text {
    border: 1px solid #e5e5e5;
    display: inline;
    width: 100%;
  }
}
@media screen and (min-width: 797px) {
  .form__row--doc-search {
    position: absolute;
    top: -103px;
    right: 30px;
    width: 48%;
    min-width: 300px;
  }
  .form__row--doc-search legend {
    display: none;
  }
  .form__row--doc-search .form__input--text {
    border: 1px solid #bdc0c2;
  }
  .form__row--doc-search .form__input--text:focus {
    outline: #6d276a auto 5px;
  }
}
@media screen and (min-width: 992px) {
  .form__col--fourth {
    float: left;
    width: 22.5%;
    margin-left: 3.5%;
    margin-bottom: 0;
  }
  .form__col--fourth:nth-child(even) {
    margin-left: 3%;
  }
  .form__col--fourth:first-of-type {
    margin-left: 0;
  }
}
@media screen and (min-width: 1024px) {
  .form__row--doc-search {
    width: 22.5%;
    min-width: 0;
  }
}
@media screen and (min-width: 1200px) {
  .form__row--doc-search {
    right: 0;
  }
}
/*
* Request An Appointment Form
*/
option[value="9315-ocean-highway-delmar-md-21875"] {
  display: none;
}

@media screen and (min-width: 320px) {
  .has-push-right {
    -webkit-transform: translateX(-320px);
            transform: translateX(-320px);
  }
}
@media screen and (min-width: 480px) {
  .feed__item__img, .feed__item__content {
    float: left;
  }
  .feed__item__content {
    width: calc(100% - 180px);
  }
  .feed__item__content--twitter {
    width: calc(100% - 110px);
    padding-left: 0;
  }
}
@media screen and (min-width: 640px) {
  .info-col__item {
    -ms-flex: 1 0 45%;
    -webkit-box-flex: 1;
            flex: 1 0 45%;
    max-width: 45%;
    width: auto;
  }
  .info-col__item:nth-child(2n+2) {
    margin-left: 4%;
  }
  .page-header {
    height: auto;
  }
  .sub-footer__container {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
  }
  .sub-footer__container:after {
    content: "";
    position: absolute;
    width: 2px;
    height: 100%;
    left: 50%;
    -webkit-transform: translateX(-50%);
            transform: translateX(-50%);
    background: #fff;
  }
  .sub-footer__col {
    -ms-flex: 1 0 45%;
    -webkit-box-flex: 1;
            flex: 1 0 45%;
    max-width: 45%;
  }
  .sub-footer__col:first-of-type {
    border: 0;
    margin: 0;
    padding: 0;
  }
  .sub-footer__col:last-of-type {
    margin-left: 10%;
  }
  .column25.left {
    margin-right: 20px;
    float: left;
  }
  .column25.right {
    margin: 0;
  }
  .column25 {
    width: 250px;
    min-height: 50px;
    float: left;
  }
  .homeImg {
    border: 5px solid #fff;
    padding: 0;
  }
  .homeImg img {
    display: block;
  }
  .homeImg .desc {
    position: absolute;
    top: 0;
    left: 0;
    padding: 30px 20px 40px 20px;
    height: 310px;
    width: 290px;
  }
  .homeCarousel2 .text {
    left: 260px;
  }
  .homeNews .newsText {
    margin-left: 3%;
  }
  .home .column25 {
    width: 48%;
    margin: 0;
  }
  .home .column25.right {
    float: right;
  }
  .vidThumb {
    float: left;
    width: 48%;
  }
  .content .list-col, .callout .list-col, .content .callout--split ul, .callout .callout--split ul {
    -webkit-column-count: 2;
       -moz-column-count: 2;
            column-count: 2;
    -webkit-column-gap: 4em;
       -moz-column-gap: 4em;
            column-gap: 4em;
  }
  .content .cols, .callout .cols {
    -webkit-column-count: 2;
       -moz-column-count: 2;
            column-count: 2;
    font-size: 2em;
    -webkit-column-gap: 4em;
       -moz-column-gap: 4em;
            column-gap: 4em;
  }
  .content blockquote p, .callout blockquote p {
    font-size: 3.6em;
    padding-right: 0;
  }
  .content blockquote footer, .callout blockquote footer {
    font-size: 1.8em;
  }
  .btn {
    width: auto;
  }
  .btn-container--left .btn:first-of-type {
    margin-left: 0;
  }
  .btn-container .btn {
    margin: 0 15px;
  }
  .btn-container .btn:first-of-type {
    margin-left: 0;
  }
  .btn-container .btn:last-of-type {
    margin-right: 0;
  }
  .callout {
    padding-left: 55px;
    padding-right: 55px;
  }
  .callout .callout__title {
    font-size: 3em;
  }
  .cta__video__title {
    font-size: 3em;
  }
  .preferred_physician_wrap {
    padding-left: 60px;
  }
  .hero__icon {
    right: 12vw;
  }
  .leader__bio .leader__img {
    float: right;
    max-width: 245px;
    margin-bottom: 34px;
  }
  .leader__info {
    position: absolute;
    left: 0;
    top: 50%;
    -webkit-transform: translateY(-50%);
            transform: translateY(-50%);
    width: 50%;
    margin-bottom: 0;
  }
  .resource {
    padding-left: 20px;
    padding-right: 20px;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-flow: column;
            flex-flow: column;
    width: 42%;
    max-width: 42%;
  }
  .resource__title {
    font-size: 2.6em;
  }
  .feed__item__img, .feed__item__content {
    float: none;
  }
  .partners__intro:before {
    bottom: -36px;
    left: calc(50% - 36px);
    border-width: 36px 36px 0 36px;
  }
  .partners__wrapper {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
  }
  .partners__block {
    -ms-flex: 1 0 50%;
    -webkit-box-flex: 1;
            flex: 1 0 50%;
    padding: 100px 0;
  }
  .partners__content {
    max-width: 450px;
    margin: 0 auto;
  }
  .typeahead__container--location .typeahead__result ul {
    min-width: 515px;
  }
  .location--sidebar .location__entry {
    padding-bottom: 0;
  }
  .location--sidebar .location__directions:link, .location--sidebar .location__directions:visited {
    position: static;
  }
  .location--sidebar .location__item {
    padding-bottom: 82px;
  }
  .location--sidebar.dropdown {
    min-width: 149px;
    width: 48%;
    display: inline-block;
    vertical-align: top;
  }
  .location--sidebar.dropdown:first-of-type {
    margin-right: 3%;
  }
  .mainText .provider {
    margin-top: 40px;
  }
  .mainText .provider__title {
    padding-bottom: 23px;
    margin-bottom: 29px;
  }
  .mainText .provider__item {
    -ms-flex: 1 0 50%;
    -webkit-box-flex: 1;
            flex: 1 0 50%;
    max-width: 50%;
  }
  .alert--banner {
    bottom: -350px;
    top: auto;
    min-height: 350px;
  }
  .alert--banner.slide-up {
    top: auto;
    bottom: 0;
  }
  .alert__container {
    position: absolute;
    top: 50%;
    left: 50%;
    -webkit-transform: translate(-50%, -50%);
            transform: translate(-50%, -50%);
    padding: 0 55px 30px;
    width: calc(100% - 110px);
    max-width: 1180px;
  }
  .info-block__wrapper {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
    -ms-flex-pack: justify;
    -webkit-box-pack: justify;
            justify-content: space-between;
  }
  .info-block {
    -ms-flex: 0 1 43%;
    -webkit-box-flex: 0;
            flex: 0 1 43%;
    -ms-flex-preferred-size: 43%;
    flex-basis: 43%;
    /* IE Fix ?? */
    padding-right: 7%;
  }
}
@media screen and (min-width: 640.1px) {
  .content table th, .callout table th, .content table td, .callout table td {
    padding: 19px;
  }
}
@media screen and (min-width: 640px) and (max-width: 1024px) {
  .leader__item:hover .leader__overlay, .leader__item:focus .leader__overlay {
    padding: 30px 20px;
  }
  .leader__overlay {
    padding: 30px 20px;
  }
  .leader__overlay .leader__name {
    font-size: 2em;
  }
  .leader .leader__overlay .leader__creds {
    font-size: 2em;
  }
}
@media screen and (min-width: 640px) and (max-width: 890px) {
  .feed__item__img {
    margin: 0 auto;
    display: block;
  }
  .feed__item__content {
    width: calc(100% - 40px);
  }
  .feed__item__content--twitter {
    padding-left: 20px;
  }
}
.map__item {
  width: 100%;
  height: 100%;
  min-height: 550px;
}

@media screen and (min-width: 768px) {
  .mobileBtn {
    right: 25px;
  }
  .vidThumb {
    float: left;
    width: 33%;
  }
  .content h2.section__header:before, .callout h2.section__header:before {
    top: calc(50% + 22px);
  }
  .content h2.section__header, .callout h2.section__header {
    font-size: 26px;
  }
  .content .cols, .callout .cols {
    -webkit-column-count: 3;
       -moz-column-count: 3;
            column-count: 3;
  }
  .content .imageLeft, .callout .imageLeft {
    float: left;
    margin: 0 29px 25px 0;
    position: relative;
    z-index: 1;
  }
  .content .imageRight, .callout .imageRight {
    float: right;
    margin: 0 0 25px 29px;
    position: relative;
    z-index: 1;
  }
  .content .imageCenter, .callout .imageCenter {
    text-align: center;
    margin: 0 0 29px;
    position: relative;
    z-index: 1;
  }
  .breadcrumbs {
    display: block;
  }
  .btn-sticky {
    margin-top: 15px;
  }
  .menu-btn {
    height: 70px;
    width: 80px;
  }
  .menu-text {
    bottom: 21px;
    text-align: left;
  }
  .menu-lines {
    left: auto;
    right: 0;
    bottom: 16px;
  }
  .intForm__img {
    display: block;
  }
  .contact-info--sidebar .contact-info__item {
    float: none;
    width: 100%;
    margin: 0 0 20px 0;
    font-size: 1.6em;
  }
  .contact-info__heading {
    font-size: 4.4em;
  }
  .contact-info__subheading {
    font-size: 1.4em;
    font-weight: 500;
    letter-spacing: -1px;
    margin-bottom: 18px;
  }
  .contact-info__item {
    float: left;
    width: 46%;
    margin-left: 8%;
    font-size: 1.9em;
  }
  .contact-info__item:first-of-type {
    margin-left: 0;
  }
  .contact-info__address {
    line-height: 1.6;
  }
  .contact-info__name {
    margin-bottom: 2px;
  }
  .contact-info__title {
    margin-bottom: 9px;
  }
  .list .list__header:before {
    top: calc(50% + 22px);
  }
  .list .list__header {
    font-size: 3.6em;
  }
  .map-container {
    height: 485px;
    background: #fff;
  }
  .map-container--physician {
    height: 300px;
  }
  .map {
    display: block;
    position: absolute;
    width: 100%;
    height: 100%;
    max-height: 485px;
    left: 0;
  }
  .map--physician {
    height: 300px;
  }
  .map--physician .map__item {
    min-height: 300px;
  }
  .map-nav {
    position: absolute;
    top: 15px;
    left: 0;
    width: 380px;
    height: 450px;
    overflow: auto;
  }
  .map-nav--physician {
    top: 12px;
    left: 30px;
    width: 275px;
    height: calc(100% - 36px);
  }
  .partners__title {
    font-size: 4.4em;
  }
  .mainText .provider__item {
    -ms-flex: 1 0 33%;
    -webkit-box-flex: 1;
            flex: 1 0 33%;
    max-width: 33%;
  }
  .section {
    padding: 90px 0;
  }
  .section--purple {
    padding: 30px 0;
  }
  .section--image {
    padding: 30px;
  }
  .section--bg {
    padding-bottom: 650px;
  }
  .section--callout h2 {
    font-size: 4.4em;
  }
  .section__header {
    font-size: 4.4em;
  }
  .info-block {
    -ms-flex: 0 1 26%;
    -webkit-box-flex: 0;
            flex: 0 1 26%;
    -ms-flex-preferred-size: 26%;
    flex-basis: 26%;
    /* IE Fix ?? */
  }
  .info-block__title {
    font-size: 3em;
  }
}
@media screen and (min-width: 796px) {
  .doc-search {
    padding-top: 40px;
    padding-bottom: 19px;
    margin-bottom: 80px;
  }
}
@media screen and (min-width: 797px) {
  .sidebar--top {
    border: 0;
    padding: 0;
  }
}
@media screen and (min-width: 890px) {
  .feed__item__img, .feed__item__content {
    float: left;
  }
}
@media screen and (min-width: 900px) {
  .homeImg img {
    float: right;
  }
}
@media screen and (min-width: 992px) {
  .flex-content, .locations, .callout_about {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-direction: row-reverse;
    -webkit-box-orient: horizontal;
    -webkit-box-direction: reverse;
            flex-direction: row-reverse;
    -ms-flex-pack: justify;
    -webkit-box-pack: justify;
            justify-content: space-between;
  }
  .flex-content--home {
    -ms-flex-direction: row;
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
            flex-direction: row;
  }
  .flex-content--home img {
    margin: 0;
  }
  .flex-content__side, .flex-content__main {
    -ms-flex: 0 1 auto;
    -webkit-box-flex: 0;
            flex: 0 1 auto;
  }
  .flex-content__main {
    width: 100%;
  }
  .flex-content--home .flex-content__main {
    padding: 0 0 0 5vw;
  }
  .content blockquote, .callout blockquote {
    padding-right: 100px;
  }
  .btn-sticky {
    position: sticky;
    z-index: 10;
    overflow: hidden;
    top: 0;
    margin-top: 15px;
    margin-bottom: -10px;
    width: 100%;
    pointer-events: none;
  }
  .btn-sticky .container, .btn-sticky .digestivecare_sections, .btn-sticky .related {
    padding: 0;
    width: 340px;
    margin-right: 0;
  }
  .btn-sticky .btn {
    display: block;
    margin: 0 0 15px;
    -webkit-transform: translateX(10px);
            transform: translateX(10px);
    width: 100%;
    pointer-events: auto;
  }
  .btn-sticky.js-is-sticky .btn {
    -webkit-transform: translateX(290px);
            transform: translateX(290px);
  }
  .btn-sticky.js-is-sticky .btn:hover, .btn-sticky.js-is-sticky .btn:focus {
    -webkit-transform: translateX(10px);
            transform: translateX(10px);
  }
  .landing .btn-sticky {
    margin-top: -30px;
    margin-bottom: 15px;
  }
  .landing .js-stickybit-parent .flex-content__main {
    margin-top: -100px;
  }
  .cta {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-pack: center;
    -webkit-box-pack: center;
            justify-content: center;
  }
  .cta__content, .cta__img {
    -ms-flex: 0 1 auto;
    -webkit-box-flex: 0;
            flex: 0 1 auto;
  }
  .cta__content {
    max-width: 460px;
    padding-right: 60px;
    margin-bottom: 0;
    -ms-flex-item-align: center;
    -ms-grid-row-align: center;
    align-self: center;
    padding-bottom: 30px;
  }
  .btn-sticky + .container--sm {
    padding-top: 30px;
  }
  .share {
    margin-top: -75px;
  }
  .share.news {
    position: absolute;
    right: 0;
    z-index: 24;
  }
  .location__detail {
    font-size: 2em;
    line-height: 1.6;
    margin: 0;
  }
  .location__detail__title {
    font-size: 2em;
  }
  .section-nav__toggle {
    display: none;
  }
  .section-nav__menu {
    margin: 0px 0px 0px 15px;
  }
  .dropdown {
    max-width: 350px;
  }
  .form_prep__block {
    float: left;
    width: 40%;
  }
}
@media screen and (min-width: 1024px) {
  .brand-tagline {
    display: block;
  }
  .page-footer .text {
    clear: none;
    float: left;
    max-width: 650px;
    margin: 12px 0 0 30px;
  }
  .home .column50 {
    float: left;
    width: 48%;
    margin: 0;
  }
  .home .column50.right {
    float: right;
  }
  .content h1, .callout h1 {
    font-size: 4.4em;
  }
  .flex-content--home .content h1, .flex-content--home .callout h1 {
    font-size: 3em;
  }
  .content h2, .callout h2 {
    font-size: 3em;
  }
  .btn--icon-fixed {
    padding-top: 17px;
    padding-bottom: 17px;
  }
  .cta__video__title {
    top: 60px;
    left: 60px;
    width: 60%;
    font-size: 3em;
  }
  .leader__open {
    display: none;
  }
  .leader .leader__overlay .leader__title {
    font-size: 1.8em;
  }
  .contact-info {
    padding: 92px 0 100px;
  }
  .contact-info--sidebar {
    padding: 0;
  }
  .list .list__title {
    font-size: 2.4em;
  }
  .resource__title {
    font-size: 3em;
    text-align: left;
  }
  .alert .alert__heading {
    font-size: 2.4em;
  }
  .alert .alert__text {
    font-size: 20px;
    max-width: 930px;
  }
}
@media screen and (min-width: 1024px) and (max-width: 1050px) {
  .subnav__btn.btn {
    font-size: 1.2em;
  }
}
@media screen and (min-width: 1024px) and (max-width: 1200px) {
  .homeCarousel2 {
    width: auto;
  }
  .homeCarousel2 .text {
    left: 200px;
  }
}
@media screen and (min-width: 1024.1px) {
  .leader__item:hover .leader__overlay, .leader__item:focus .leader__overlay {
    padding: 60px 25px;
  }
  .leader__overlay {
    padding: 30px 25px;
  }
  .leader__overlay .leader__name {
    font-size: 2.1em;
  }
  .leader .leader__overlay .leader__creds {
    font-size: 2.1em;
    margin-bottom: 10px;
  }
}
@media screen and (min-width: 1066px) {
  .homeNews .newsText {
    width: 63%;
  }
  .sidebar--right {
    width: 260px;
  }
}
@media screen and (min-width: 1066px) and (max-width: 1130px) {
  .location-list {
    padding: 0 30px 18px;
    -webkit-box-sizing: border-box;
            box-sizing: border-box;
  }
}
@media screen and (min-width: 1067px) {
  .location--sidebar .dropdown__trigger {
    padding: 0;
    background: none;
    color: #6d276a;
    font-size: 1.5em;
    margin-bottom: 30px;
  }
  .location--sidebar .dropdown__trigger [class^=icon-] {
    display: none;
  }
  .location--sidebar .dropdown__menu {
    display: block !important;
    border: 0;
    width: 100%;
    padding: 0;
  }
  .sidebar.sidebar--divider {
    margin: 0;
    padding: 0;
    border: 0;
  }
  .sidebar--top {
    display: none;
  }
}
@media screen and (min-width: 1125px) {
  .navMain__link {
    padding: 15px 25px;
  }
}
@media screen and (min-width: 1200px) {
  .subnav__link {
    min-width: 180px;
  }
  .navMain__link {
    padding: 15px 30px;
  }
  .page-footer .topLinks {
    right: 0;
  }
  .social {
    right: 0;
  }
  .mainText {
    max-width: 800px;
  }
  .mainText--full {
    max-width: none;
    float: none;
  }
  .section--bg {
    background-size: cover;
  }
}
@media screen and (min-width: 1220px) {
  .container, .digestivecare_sections, .related {
    padding: 0;
  }
  .cta__content {
    padding-left: 40px;
  }
}
@media (min-width: 1220px) {
  .subnav__btn.btn {
    left: 0px;
  }
}
@media screen and (min-width: 1350px) {
  .page-header .logo {
    max-width: none;
  }
}
@media screen and (min-width: 1680px) {
  .hero__icon {
    right: 25vw;
  }
}
@media screen and (max-width: 1400px) {
  .navMain__item:hover:last-of-type .subMenu {
    left: auto;
    right: 0;
  }
}
@media screen and (max-width: 1066px) {
  .sidebar--right .location--sidebar {
    display: none;
  }
}
@media screen and (max-width: 992px) {
  .sidebar {
    margin-bottom: 30px;
  }
}
@media screen and (max-width: 991.9px) {
  .btn-sticky {
    position: relative !important;
  }
}
@media screen and (max-width: 768px) {
  .contact-info__item:first-of-type {
    margin-bottom: 40px;
  }
  .map-container .container, .map-container .digestivecare_sections, .map-container .related {
    padding: 0;
  }
}
@media screen and (max-width: 640px) {
  .homeCarousel2 {
    width: 96% !important;
    padding: 2% !important;
  }
  .content p, .callout p {
    -webkit-hyphens: auto;
    -ms-hyphens: auto;
    hyphens: auto;
    word-break: break-word;
  }
  .resource {
    width: 100%;
  }
  .resource--feed:last-of-type {
    margin-top: 0;
  }
}
@media screen and (max-width: 639px) {
  a[href^=tel].btn-phone {
    font-size: 14px;
    color: #b149ad;
    border: 1px solid #b149ad;
    position: absolute;
    bottom: 80px;
    display: inline-block;
    padding: 13px 25px;
  }
  .sidebar a[href^=tel].btn-phone {
    bottom: 32px;
  }
  a[href^=tel]:hover.btn-phone, a[href^=tel]:focus.btn-phone {
    color: #fff;
    background: #b149ad;
  }
}
@media screen and (max-width: 480px) {
  .feed__item__img {
    margin: 0 auto;
    display: block;
  }
}
/* HOMEPAGE - feature section */
.featured {
  min-height: 50px;
  position: relative;
  margin-top: 0;
  padding: 0 0 33px 0;
  margin-bottom: -23px;
}
.featured .featured__container {
  background: -webkit-gradient(linear, left top, right top, from(#236194), color-stop(50%, #236194), color-stop(50%, #e6dee5), to(rgb(255, 255, 255)));
  background: linear-gradient(90deg, #236194 0%, #236194 50%, #e6dee5 50%, rgb(255, 255, 255) 100%);
  padding-bottom: 20px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  margin: 0 auto;
  -webkit-box-align: end;
      -ms-flex-align: end;
          align-items: flex-end;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
@media only screen and (max-width: 840px) {
  .featured .featured__container {
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
    background: -webkit-gradient(linear, left top, left bottom, from(#236194), color-stop(50%, #236194), color-stop(50%, #e6dee5), to(#fff));
    background: linear-gradient(180deg, #236194, #236194 50%, #e6dee5 50%, #fff);
  }
}
.featured .featured__col {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 2%;
  padding: 40px 30px 30px 30px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
@media only screen and (max-width: 840px) {
  .featured .featured__col {
    -webkit-box-flex: 1;
        -ms-flex: 1 1 100%;
            flex: 1 1 100%;
  }
}
.featured .featured__col.lab {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 2%;
  padding: 30px 15px;
  background-image: url(/webimages/feature_bg.jpg);
  background-position: top left;
  background-size: 90%;
  background-repeat: no-repeat;
  height: auto;
  -ms-flex-item-align: stretch;
      -ms-grid-row-align: stretch;
      align-self: stretch;
  -ms-flex-line-pack: initial;
      align-content: initial;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  max-width: 590px;
  width: 100%;
}
@media only screen and (max-width: 840px) {
  .featured .featured__col.lab {
    background: none !important;
  }
}
.featured .featured__col.lab .content *, .featured .featured__col.lab .callout * {
  color: #fff;
}
@media only screen and (max-width: 840px) {
  .featured .featured__col.lab .featured__text {
    padding-left: 0;
  }
}
.featured .featured__col.video {
  max-width: 590px;
  margin: 0px;
  padding: 30px 15px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.featured .featured__col .btn {
  margin: 0 auto 0 0;
}
.featured .featured__text {
  line-height: 1.4;
  margin-top: auto;
}
.featured .featured__text h2 {
  border: 0;
  line-height: 1.2;
  margin-top: 1em;
  margin-bottom: 15px;
  padding-top: 0;
  font-size: 3em;
  font-weight: 300;
}
.featured .featured__videowrap {
  position: relative;
}
.featured .featured__videowrap img {
  display: block;
  min-width: 100%;
  min-height: 100%;
  position: relative;
  z-index: 2;
}
.featured .featured__videowrap.playing .featured__video__play,
.featured .featured__videowrap.playing img {
  z-index: 0;
}
.featured .featured__videowrap .featured__video__play {
  position: absolute;
  top: calc(50% - 25px);
  z-index: 3;
  left: calc(50% - 25px);
  font-size: 50px;
}
.featured .featured__videowrap .featured__video__play [class^=icon] {
  font-size: 50px;
  color: #fff;
}
.featured .featured__videowrap .featured__video__play:hover {
  -webkit-animation: all 2s ease-in;
          animation: all 2s ease-in;
}
.featured .featured__videowrap .featured__video__play:hover .icon-play::before {
  color: #6d276a;
}
.featured .featured__link {
  display: inline-block;
  margin-top: 5px;
  color: #fff;
  font-size: 1.4em;
  padding: 5px 0;
  border-bottom: 1px solid transparent;
  -webkit-transition: all 0.25s ease-in-out;
  transition: all 0.25s ease-in-out;
}
.featured .featured__link:hover, .featured .featured__link:focus {
  border-color: #fff;
}
.featured .features__link span {
  vertical-align: middle;
}

/* CALL OUT
variations used around site
*/
.callout {
  border-radius: 60px;
  border: 4px solid #ebeced;
  position: relative;
  padding: 50px 25px 10px;
  margin: 50px 0 100px;
  max-width: 800px;
  margin: 50px auto;
}
.callout:first-of-type {
  margin-top: 100px;
}
.callout:last-of-type {
  margin-bottom: 50px;
}
.callout:before {
  position: absolute;
  content: "";
  font-family: "icons";
  font-size: 43px;
  padding-top: 15px;
  text-align: center;
  width: 75px;
  height: 75px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: -42px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.callout .iconbubble {
  position: absolute;
  font-family: "icons";
  font-size: 43px;
  padding-top: 15px;
  text-align: center;
  width: 75px;
  height: 75px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: -42px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.callout--symptoms:before {
  content: "\e914";
}
.callout--risk:before, .callout--prepare:before {
  content: "\e90e";
}
.callout--doctor:before {
  content: "\e913";
}
.callout--treatment:before {
  content: "\e912";
}
.callout--expect:before {
  content: "\e90b";
  padding-left: 9px;
}
.callout--benefits:before {
  content: "\e918";
}
.callout--cdc-value:before {
  background-image: url("/webimages/CDC-icon.svg");
}
.callout--pe-value:before {
  background-image: url("/webimages/PE-solutions-icon.svg");
}
.callout--together:before {
  background-image: url("/webimages/offerings-icon.svg");
}
.callout .callout__title {
  border: 0;
  margin: 0 0 16px;
  padding: 0;
  color: #6d276a;
  text-align: center;
  font-size: 2.4em;
}
.callout--split ul {
  -webkit-column-count: 2;
     -moz-column-count: 2;
          column-count: 2;
  -webkit-column-gap: 4em;
     -moz-column-gap: 4em;
          column-gap: 4em;
}
.callout .btn {
  font-size: 1em;
  margin-top: 15px;
}
.callout_about {
  height: 350px;
  margin-bottom: 0;
  background-position: 35vw top;
  background-repeat: no-repeat;
  background-size: contain;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: reverse;
      -ms-flex-direction: row-reverse;
          flex-direction: row-reverse;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  padding-bottom: 0px;
  position: relative;
}
@media screen and (min-width: 1241px) {
  .callout_about {
    background-position: top right;
  }
}
@media screen and (max-width: 830px) {
  .callout_about {
    height: auto;
    background-image: none !important;
  }
}
.callout_about .container, .callout_about .digestivecare_sections, .callout_about .related {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-direction: row;
          flex-direction: row;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin-bottom: 0px;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: start;
      -ms-flex-pack: start;
          justify-content: start;
}
@media screen and (max-width: 830px) {
  .callout_about .container, .callout_about .digestivecare_sections, .callout_about .related {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.callout_about .container .content, .callout_about .digestivecare_sections .content, .callout_about .related .content, .callout_about .container .callout, .callout_about .digestivecare_sections .callout, .callout_about .related .callout {
  margin-bottom: 30px;
}
.callout_about .container .inline-image, .callout_about .digestivecare_sections .inline-image, .callout_about .related .inline-image {
  display: none;
}
@media screen and (max-width: 830px) {
  .callout_about .container .inline-image, .callout_about .digestivecare_sections .inline-image, .callout_about .related .inline-image {
    display: block;
    margin: 0px -30px 30px;
    max-width: 100vw;
  }
}
.callout_about__main {
  width: 40%;
}
@media screen and (max-width: 830px) {
  .callout_about__main {
    width: auto;
  }
}
.callout_about__main .btn--outline {
  background-color: #fff;
  border-color: rgba(177, 73, 173, 0.35);
}

.leader-grid {
  margin: 40px 0 11px;
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row wrap;
          flex-flow: row wrap;
}

.leader {
  margin: 10px;
  -webkit-box-flex: 1;
      -ms-flex: 1 0 50%;
          flex: 1 0 50%;
  max-width: calc(48% - 20px);
}

.leader__item {
  text-align: left;
  border: 0;
  background: none;
  margin: 0;
  padding: 0 0 70px 0;
  position: relative;
  background: #6d276a;
  font-family: inherit;
  font-size: 10px;
}

.leader__item:hover .leader__img, .leader__item:focus .leader__img {
  opacity: 0.9;
}

.leader__item:hover .leader__overlay, .leader__item:focus .leader__overlay {
  background: #6d276a;
}

.leader__overlay {
  position: absolute;
  z-index: 2;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  width: 100%;
  bottom: 0;
  padding: 30px 28px;
  background: #6d276a;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  color: #fff;
}

.leader__overlay .leader__name {
  font-size: 2.1em;
  line-height: 1.2;
  font-weight: 500;
  color: #fff;
  margin: 0 !important;
  letter-spacing: 0;
}

.leader__img {
  opacity: 1;
  -webkit-transition: opacity 0.25s;
  transition: opacity 0.25s;
}

.leader__img img {
  display: block;
  width: 100%;
}

.leader__open {
  display: block;
  z-index: 2;
  color: #fff;
  font-size: 1.4em;
  color: #fff;
  padding: 10px 0 0;
  margin-top: 10px;
  text-transform: uppercase;
  letter-spacing: 0.05em;
}

.leader__open [class^=icon] {
  font-weight: bold;
  font-size: 18px;
  position: relative;
  top: 3px;
  margin-right: 13px;
}

.leader__info {
  margin-bottom: 25px;
}

.leader .leader__info .leader__name {
  font-size: 2.8em;
  line-height: 1.2;
  font-weight: 700;
  padding: 0;
  border: 0;
  margin: 0 !important;
  letter-spacing: -0.6px;
}

.leader .leader__info .leader__creds {
  font-size: 2.4em;
  line-height: 1;
  font-weight: 300;
  padding: 0;
  border: 0;
  display: block;
  letter-spacing: -0.8px;
  margin: 7px 0;
}

.leader__divider {
  margin: 25px 0 28px;
}

.leader .leader__info .leader__title {
  display: block;
  font-size: 1.6em;
  line-height: 1;
  font-weight: 500;
  text-transform: uppercase;
  color: #6d276a;
  padding: 0;
}

.leader .leader__overlay .leader__creds {
  font-size: 2.1em;
  line-height: 1;
  font-weight: 500;
  color: #fff;
  margin: 0 0 5px;
  letter-spacing: 0;
  display: block;
  letter-spacing: -0.8px;
}

.leader .leader__overlay .leader__title {
  font-size: 1.6em;
  line-height: 1;
  font-weight: 300;
  text-transform: none;
  color: #fff;
}

.leader__bio {
  position: fixed;
  top: 0;
  left: 50%;
  width: 0;
  height: 100%;
  background: #fff;
  z-index: 1200;
  overflow-y: scroll;
  visibility: hidden;
  opacity: 0;
  padding: 100px 0;
  background-color: #f2f3f3;
  -webkit-transition: all 0.5s 0.5s;
  transition: all 0.5s 0.5s;
}

.leader--active .leader__bio {
  opacity: 1;
  visibility: visible;
  width: 100%;
  height: 100%;
  left: 0;
  -webkit-transition: all 0.5s 0.5s;
  transition: all 0.5s 0.5s;
}

.leader__bio .container, .leader__bio .digestivecare_sections, .leader__bio .related {
  opacity: 0;
  -webkit-transition: all 0.5s 0s;
  transition: all 0.5s 0s;
  padding-bottom: 200px;
}

.leader--active .leader__bio .container, .leader--active .leader__bio .digestivecare_sections, .leader--active .leader__bio .related {
  opacity: 1;
  -webkit-transition: all 1s 0.5s;
  transition: all 1s 0.5s;
}

.leader__header {
  position: relative;
  margin-bottom: 20px;
}

.leader__content p {
  font-size: 1.6em;
  line-height: 1.5;
  margin-bottom: 25px;
}

.leader .btn--close {
  position: absolute;
  width: auto;
  top: 20px;
  right: 20px;
  background: none;
  color: #565a5d;
  font-size: 2em;
  line-height: 0.9;
  font-weight: 300;
  padding-bottom: 5px;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
  opacity: 0;
  -webkit-transition: all 1s 0s;
  transition: all 1s 0s;
}

.leader .btn--close .icon-close {
  font-size: 1.5em;
  margin-left: 5px;
  position: relative;
  vertical-align: middle;
  top: -2px;
  -webkit-transform: translateY(0);
          transform: translateY(0);
}

.leader .btn--close:hover, .leader .btn--close:focus {
  outline: none;
  background: #d8d9da;
}

.leader--active .btn--close {
  opacity: 1;
  -webkit-transition: all 1s 0.5s;
  transition: all 1s 0.5s;
}

@media screen and (max-width: 530px) {
  .leader {
    margin: 10px;
    -ms-flex-negative: 1;
        flex-shrink: 1;
    -webkit-box-flex: 0;
        -ms-flex-positive: 0;
            flex-grow: 0;
    -ms-flex-preferred-size: auto;
        flex-basis: auto;
    max-width: initial;
    -webkit-box-pack: center;
        -ms-flex-pack: center;
            justify-content: center;
  }
}
@media screen and (min-width: 768px) {
  .leader-grid {
    margin: 60px 0 11px 0;
  }
  .leader {
    -ms-flex: 1 0 30%;
    -webkit-box-flex: 1;
            flex: 1 0 30%;
    max-width: 30%;
  }
  .leader__info {
    width: 60%;
  }
  .leader .leader__info .leader__name {
    font-size: 4.4em;
  }
  .leader .leader__info .leader__creds {
    font-size: 2.6em;
  }
  .leader .leader__info .leader__title {
    font-size: 1.8em;
  }
  .leader__header {
    margin-bottom: 45px;
  }
  .leader__content p {
    font-size: 1.8em;
    line-height: 1.6;
  }
}
.fedex-pickup .error {
  color: red;
  font-size: 16px;
  font-weight: 500;
  border: 2px solid #979797;
  padding: 8px;
  margin-bottom: 10px;
  background: #F5F5F5;
}

.fedex-pickup form {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}

.fedex-pickup form .side {
  width: 50%;
  background: #F5F5F5;
  padding: 8px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.fedex-pickup form .bottom {
  width: 100%;
  margin-top: 16px;
  text-align: right;
}

.fedex-pickup form label, .fedex-pickup form .legend {
  display: block;
  color: #565A5D;
  font-size: 16px;
  text-align: right;
  margin-bottom: 5px;
}

.fedex-pickup form input[type=text], .fedex-pickup form input[type=email], .fedex-pickup form select {
  border: 0.5px solid #979797;
  background: transparent;
  color: #565A5D;
  font-size: 16px;
  display: inline-block;
  width: 50%;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  padding: 3px;
  margin-left: 3px;
}

.fedex-pickup form input[type=reset] {
  background: #fff;
  cursor: pointer;
  display: inline-block;
  vertical-align: middle;
  margin-right: 6px;
}

.fedex-pickup form .fieldset {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}

.fedex-pickup form .fieldset .legend {
  width: 50%;
  padding-right: 3px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.fedex-pickup form .fieldset label {
  text-align: left;
  margin-right: 6px;
}

.fedex-pickup form .fieldset label input {
  margin-left: 0;
}

.flex-content, .locations, .callout_about {
  width: 100%;
  position: relative;
}
.flex-content--home {
  width: calc(100% - 60px);
  margin-top: 45px;
  margin-bottom: 45px;
  position: relative;
}
.flex-content--home::after {
  position: absolute;
  bottom: -55px;
  left: 0;
  background: url("../../webimages/homeImg-shadow.png") no-repeat 50% 0;
  width: 100%;
  height: 16px;
  background-size: contain;
}
.flex-content--home img {
  display: block;
  margin: 20px auto;
}
.flex-content--home .btn + .btn {
  margin-top: 20px;
}
.flex-content__side {
  min-width: 275px;
}

#tabs {
  padding-right: 2px;
  margin-bottom: 0px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row nowrap;
          flex-flow: row nowrap;
  -webkit-box-pack: end;
      -ms-flex-pack: end;
          justify-content: flex-end;
  background-color: #fff;
  position: absolute;
  left: calc(50% - 125px);
  top: -40px;
}
#tabs a, #tabs button {
  cursor: pointer;
}
#tabs li {
  list-style: none;
  margin-right: 5px;
  padding: 0;
  display: inline-block;
}
#tabs li a, #tabs li button {
  font-size: 22px;
  font-family: "MuseoSans", sans-serif;
  font-weight: 300;
  color: #565a5d;
  padding: 8px 15px;
  display: block;
  background: #f5f5f5;
  text-decoration: none;
}
#tabs li a.inactive, #tabs li button.inactive {
  padding: 8px 15px;
  color: #6d276a;
  background: #fff;
  border-left: 1px solid transparent;
}
#tabs li a.inactive:hover, #tabs li button.inactive:hover {
  color: #B344B0;
  background-color: white;
}

.filtercontainer {
  background-color: #f5f5f5;
}
.filtercontainer .filters .selection {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row wrap;
          flex-flow: row wrap;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  padding: 30px 0;
  border: solid 1px #F5F5F5;
  background-color: #F5F5F5;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.filtercontainer .filters .selection .btn {
  margin: 5px;
}
.filtercontainer .filters .selection .narrow {
  font-weight: 500;
  font-size: 1.75em;
  margin: 5px 0 25px 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 100%;
          flex: 1 1 100%;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.filtercontainer .filters .selection .narrow::before, .filtercontainer .filters .selection .narrow::after {
  content: "";
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  border-bottom: 1px solid #565a5d;
  top: -0.5em;
  position: relative;
}
.filtercontainer .filters .selection .narrow::before {
  margin-right: 40px;
}
.filtercontainer .filters .selection .narrow::after {
  margin-left: 40px;
}
.filtercontainer .filters .selection input, .filtercontainer .filters .selection select {
  width: 280px;
  border: 2px solid #d2d2d2;
  line-height: 40px;
  font-size: 1.7em;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.filtercontainer .filters .selection .field {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  position: relative;
  padding: 0 10px;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
@media only screen and (max-width: 600px) {
  .filtercontainer .filters .selection .field {
    padding: 10px 10px;
  }
}
.filtercontainer .filters .selection .field select {
  padding: 5px 5px 5px 20px;
  position: relative;
}
.filtercontainer .filters .selection .field.actions {
  margin-top: 16px;
}
.filtercontainer .filters .selection .geo {
  background-color: #F5F5F5;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  position: relative;
  padding: 15px;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.filtercontainer .filters .selection .geo input {
  padding: 5px 10px;
}
.filtercontainer .filters .selection .geo span {
  font-size: 1.75em;
  line-height: 54px;
  padding-right: 10px;
}
.filtercontainer .filters .selection label {
  margin: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row;
          flex-flow: row;
  padding-left: 0;
  font-size: 1.7em;
  line-height: 1.2em;
}
@media screen and (max-width: 740px) {
  .filtercontainer .actions {
    padding: 35px 10px;
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
    margin: 0 auto;
    text-align: center;
  }
  .filtercontainer .locationtype {
    margin: 0 auto;
    -ms-flex-preferred-size: 100%;
        flex-basis: 100%;
    -webkit-box-align: center;
        -ms-flex-align: center;
            align-items: center;
  }
  .filtercontainer .locationtype:after {
    position: relative !important;
    right: calc(0% - 120px) !important;
    top: calc(0% - 35px) !important;
    padding: 0 !important;
    -webkit-transform: unset !important;
            transform: unset !important;
  }
  .filtercontainer .geo {
    margin: 0 auto;
    -ms-flex-preferred-size: 100%;
        flex-basis: 100%;
    -webkit-box-align: center;
        -ms-flex-align: center;
            align-items: center;
  }
}
@media screen and (max-width: 530px) {
  .filtercontainer .filtercontainer .filters .geo input {
    max-width: 100%;
    padding-right: 50px;
    width: 100%;
  }
  .filtercontainer #aczfilter {
    top: -54px;
    left: calc(50% - 30px);
  }
}

.locations {
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.locations__main {
  -ms-flex: 1 1 auto;
  -webkit-box-flex: 1;
          flex: 1 1 auto;
}
.locations__side {
  -ms-flex: 0 1 auto;
  -webkit-box-flex: 0;
          flex: 0 1 auto;
  min-width: 275px;
  margin-bottom: 30px;
}

.tabwrap {
  clear: both;
  width: 100%;
  text-align: left;
}

.tabwrap h2 {
  margin-left: 15px;
  margin-right: 15px;
  margin-bottom: 10px;
  color: #5685bc;
}

.tabwrap p {
  margin-left: 15px;
  margin-right: 15px;
  margin-top: 10px;
  margin-bottom: 10px;
  line-height: 1.3;
  font-size: small;
}

.tabwrap ul {
  margin-left: 25px;
  font-size: small;
  line-height: 1.4;
  list-style-type: disc;
}

.tabwrap li {
  padding-bottom: 5px;
  margin-left: 5px;
}

.count-label {
  text-align: center;
  font-size: 20px;
  font-weight: bold;
  padding: 20px 0px;
}

.map-wrapper {
  background-color: #f5f5f5;
  padding: 20px;
}

.locationlisting {
  display: -ms-grid;
  display: grid;
  -ms-grid-columns: 1fr 20px 1fr;
  grid-template-columns: 1fr 1fr;
  gap: 20px;
}
.locationlisting h2 {
  margin: 1em;
  font-size: 24px;
  line-height: 1.5;
  color: #2db035;
}
@media screen and (max-width: 970px) {
  .locationlisting {
    -ms-grid-columns: 1fr;
    grid-template-columns: 1fr;
    padding: 1em;
    grid-row-gap: 20px;
  }
}
.locationlisting .item {
  -webkit-transition: all 0.2s linear;
  transition: all 0.2s linear;
  border: solid 1px #F5F5F5;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
}
@media only screen and (max-width: 720px) {
  .locationlisting .item {
    max-width: 100%;
  }
}
@media only screen and (max-width: 600px) {
  .locationlisting .item {
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.locationlisting .item:hover {
  border: solid 1px #dedede;
  background-color: #F5F5F5;
}
.locationlisting .item .image {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 250px;
          flex: 0 0 250px;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  padding: 15px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
@media only screen and (max-width: 720px) {
  .locationlisting .item .image {
    width: 100%;
    -webkit-box-sizing: border-box;
            box-sizing: border-box;
  }
}
.locationlisting .item .image img {
  border: 1px solid #e5e6e7;
}
.locationlisting .item .image a {
  display: block;
}
.locationlisting .item .text {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 0px;
          flex: 1 0 0;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  font-size: 1.6em;
  line-height: 1.5;
  position: relative;
  padding: 20px;
}
@media only screen and (max-width: 720px) {
  .locationlisting .item .text {
    padding: 0px 20px;
    -webkit-box-sizing: border-box;
            box-sizing: border-box;
    text-align: center;
  }
}
.locationlisting .item .text a {
  color: #6d276a;
}
.locationlisting .item .text a:hover {
  text-decoration: underline;
}
.locationlisting .item .text .title {
  font-weight: 700;
  font-size: 1.5em;
}
.locationlisting .item .text .subtitle {
  font-size: 14px;
  font-weight: bold;
}
.locationlisting .item .text .category {
  margin-top: 15px;
}
.locationlisting .item .text .category ul {
  padding: 0;
  margin: 0;
  list-style: none;
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
.locationlisting .item .text .category ul li {
  color: #fff;
  padding: 5px 8px;
  background-color: #565a5d;
  border-radius: 5px;
  font-size: 12px;
  margin: 0 0 5px 5px;
  white-space: nowrap;
}
.locationlisting .item .text .address {
  margin: 10px 0;
}
.locationlisting .item .text [class^=icon-] {
  width: 25px;
  height: 20px;
  padding-right: 5px;
}
.locationlisting .item .text .phone [class^=icon-] {
  color: #565a5d;
}
.locationlisting .item .text .details {
  display: block;
}
.locationlisting .item .text .details [class^=icon-] {
  color: #565a5d;
}
.locationlisting .item .text .directions [class^=icon-] {
  color: #565a5d;
}
.locationlisting #locations-map .office-detail .info {
  width: 100%;
}
.locationlisting #locations-map .office-detail .info p, .locationlisting #locations-map .office-detail .info h2 {
  margin-left: 0;
  margin-right: 0;
}
.locationlisting #locations-map .img {
  width: 100%;
  min-height: 100px;
  background-size: cover;
  background-position: center;
  margin-right: 20px;
}

.location__meta {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.location__meta.location__meta_row {
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
@media screen and (min-width: 992px) {
  .location__meta {
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
        -ms-flex-direction: row;
            flex-direction: row;
    gap: 3%;
  }
}

.location__detail {
  width: 100%;
  margin: 20px auto;
  font-size: 1.8em;
  line-height: 1.3;
}
@media screen and (min-width: 992px) {
  .location__detail {
    font-size: 2em;
    line-height: 1.6;
    margin: 0;
  }
}
@media screen and (max-width: 600px) {
  .location__detail {
    margin: 0;
  }
}

.location__detail__address {
  font-size: 1em;
  margin-top: 15px;
  margin-bottom: 15px;
}

.location__detail__contact {
  display: block;
  margin: 0;
  position: relative;
}

.location__detail__contact a {
  color: #6d276a;
}

.location__detail__description {
  font-size: 0.8em;
  padding: 10px 0 0;
}
.location__detail__description p {
  margin-bottom: 0.75em;
}
@media screen and (max-width: 600px) {
  .location__detail__description {
    display: none;
  }
}

.location__detail__link:link,
.location__detail__link:visited {
  font-size: 1rem;
  font-weight: 500;
  text-transform: none;
  text-decoration: none;
  color: #565a5d;
  vertical-align: middle;
  margin: 8px 0 0;
  display: inline-block;
}

.location__detail__link:link span,
.location__detail__link:visited span {
  font-size: 1.2em;
  margin-left: 8px;
}

.location__detail__link:link span:before,
.location__detail__link:visited span:before {
  position: relative;
  top: 3px;
}

.location__detail__link:hover,
.location__detail__link:visited:hover {
  color: #000;
}

.location__detail__image {
  display: block;
  width: 100%;
}

.location__detail__title {
  font-size: 1.8em;
  line-height: 1.1em;
}

.location__detail__name,
.location__detail__hours,
.location__detail__title {
  display: block;
}

.location__detail .btn-container {
  margin: 30px 0;
}
@media screen and (max-width: 600px) {
  .location__detail .btn-container {
    margin: 0;
  }
}

.location__detail .btn {
  font-size: 1rem;
  margin: 0;
}
@media screen and (max-width: 600px) {
  .location__detail .btn {
    margin-top: 10px;
  }
}

.location__detail .locationmessage {
  text-align: center;
  background: #e6dee5;
  padding: 20px;
  color: black;
}

.location__detail__office {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row nowrap;
          flex-flow: row nowrap;
}
.location__detail__office img {
  max-width: 130px;
  max-height: 100px;
  padding-right: 20px;
}
.location__detail__office .text {
  width: 80%;
}
.location__detail__office .text .title {
  color: #6d276a;
  font-weight: 700;
}

#locationsearch {
  width: 80%;
  position: absolute;
  top: 100%;
  left: 0;
  right: 0;
  z-index: 20;
  list-style: none;
  padding: 30px;
  margin: 0 auto;
  opacity: 0;
  visibility: hidden;
}
#locationsearch.open {
  opacity: 1;
  visibility: visible;
}
#locationsearch .filtercontainer {
  -webkit-box-shadow: 5px 6px 7px rgba(0, 0, 0, 0.2);
          box-shadow: 5px 6px 7px rgba(0, 0, 0, 0.2);
  border: 1px solid #e5e5e5;
}
#locationsearch .filtercontainer .filters .selection label:hover {
  cursor: pointer;
  text-decoration: underline;
}
#locationsearch .filtercontainer .filters .selection label input {
  height: 1px;
  position: absolute;
}
#locationsearch #aczfilter {
  position: relative;
  top: 0;
  right: 40px;
}
#locationsearch h3 {
  font-size: 38px;
  margin: 30px 20px 10px 20px;
  font-weight: 300;
}

@media screen and (max-width: 600px) {
  .location__related {
    display: none;
  }
}

.location__map {
  aspect-ratio: 600/450;
  max-width: 1000px;
  width: 100%;
}
@media screen and (max-width: 600px) {
  .location__map {
    display: none;
  }
}
.location__map iframe {
  width: 100%;
  height: 100%;
}

.page-template-page-locations .container .row, .page-template-page-locations .digestivecare_sections .row, .page-template-page-locations .related .row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-direction: row;
          flex-direction: row;
  gap: 40px;
}
.page-template-page-locations .container .row .col, .page-template-page-locations .digestivecare_sections .row .col, .page-template-page-locations .related .row .col {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
@media screen and (max-width: 991px) {
  .page-template-page-locations .container .row, .page-template-page-locations .digestivecare_sections .row, .page-template-page-locations .related .row {
    gap: 20px;
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
        -ms-flex-direction: row;
            flex-direction: row;
  }
}

.pt-5 {
  padding-top: 5rem !important;
}

.w-100 {
  width: 100% !important;
}

@media screen and (min-width: 480px) {
  .physician-list {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
    -ms-flex-pack: start;
    -webkit-box-pack: start;
            justify-content: flex-start;
  }
}
.typeahead__cancel-button {
  visibility: hidden;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  border-radius: 50%;
  width: 16px;
  height: 16px;
  position: absolute;
  top: 8px;
  right: 0.8em;
  cursor: pointer;
  background: url(data:image/svg+xml;charset=utf8;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iaXNvLTg4NTktMSI/Pgo8IS0tIEdlbmVyYXRvcjogQWRvYmUgSWxsdXN0cmF0b3IgMTYuMC4wLCBTVkcgRXhwb3J0IFBsdWctSW4gLiBTVkcgVmVyc2lvbjogNi4wMCBCdWlsZCAwKSAgLS0+CjwhRE9DVFlQRSBzdmcgUFVCTElDICItLy9XM0MvL0RURCBTVkcgMS4xLy9FTiIgImh0dHA6Ly93d3cudzMub3JnL0dyYXBoaWNzL1NWRy8xLjEvRFREL3N2ZzExLmR0ZCI+CjxzdmcgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayIgdmVyc2lvbj0iMS4xIiBpZD0iQ2FwYV8xIiB4PSIwcHgiIHk9IjBweCIgd2lkdGg9IjE2cHgiIGhlaWdodD0iMTZweCIgdmlld0JveD0iMCAwIDQzOC41MzMgNDM4LjUzMyIgc3R5bGU9ImVuYWJsZS1iYWNrZ3JvdW5kOm5ldyAwIDAgNDM4LjUzMyA0MzguNTMzOyIgeG1sOnNwYWNlPSJwcmVzZXJ2ZSI+CjxnPgoJPHBhdGggZD0iTTQwOS4xMzMsMTA5LjIwM2MtMTkuNjA4LTMzLjU5Mi00Ni4yMDUtNjAuMTg5LTc5Ljc5OC03OS43OTZDMjk1LjczNiw5LjgwMSwyNTkuMDU4LDAsMjE5LjI3MywwICAgYy0zOS43ODEsMC03Ni40Nyw5LjgwMS0xMTAuMDYzLDI5LjQwN2MtMzMuNTk1LDE5LjYwNC02MC4xOTIsNDYuMjAxLTc5LjgsNzkuNzk2QzkuODAxLDE0Mi44LDAsMTc5LjQ4OSwwLDIxOS4yNjcgICBjMCwzOS43OCw5LjgwNCw3Ni40NjMsMjkuNDA3LDExMC4wNjJjMTkuNjA3LDMzLjU5Miw0Ni4yMDQsNjAuMTg5LDc5Ljc5OSw3OS43OThjMzMuNTk3LDE5LjYwNSw3MC4yODMsMjkuNDA3LDExMC4wNjMsMjkuNDA3ICAgczc2LjQ3LTkuODAyLDExMC4wNjUtMjkuNDA3YzMzLjU5My0xOS42MDIsNjAuMTg5LTQ2LjIwNiw3OS43OTUtNzkuNzk4YzE5LjYwMy0zMy41OTYsMjkuNDAzLTcwLjI4NCwyOS40MDMtMTEwLjA2MiAgIEM0MzguNTMzLDE3OS40ODUsNDI4LjczMiwxNDIuNzk1LDQwOS4xMzMsMTA5LjIwM3ogTTMyMi42MjEsMjcwLjkzOWMzLjYxNywzLjYxMyw1LjQyOCw3LjkwNSw1LjQyOCwxMi44NTQgICBjMCw1LjEzMy0xLjgxMSw5LjUxNC01LjQyOCwxMy4xMjdsLTI1LjY5MywyNS43MDFjLTMuNjE0LDMuNjEzLTcuOTk0LDUuNDItMTMuMTM1LDUuNDJjLTQuOTQ4LDAtOS4yMzYtMS44MDctMTIuODQ3LTUuNDIgICBsLTUxLjY3Ni01MS42ODJsLTUxLjY3OCw1MS42ODJjLTMuNjE2LDMuNjEzLTcuODk4LDUuNDItMTIuODQ3LDUuNDJjLTUuMTQsMC05LjUxNy0xLjgwNy0xMy4xMzQtNS40MmwtMjUuNjk3LTI1LjcwMSAgIGMtMy42MTYtMy42MTMtNS40MjQtNy45OTQtNS40MjQtMTMuMTI3YzAtNC45NDgsMS44MDktOS4yNCw1LjQyNC0xMi44NTRsNTEuNjc4LTUxLjY3M2wtNTEuNjc4LTUxLjY3OCAgIGMtMy42MTYtMy42MTItNS40MjQtNy44OTgtNS40MjQtMTIuODQ3YzAtNS4xNCwxLjgwOS05LjUxNyw1LjQyNC0xMy4xMzRsMjUuNjk3LTI1LjY5M2MzLjYxNy0zLjYxNiw3Ljk5NC01LjQyNCwxMy4xMzQtNS40MjQgICBjNC45NDksMCw5LjIzMSwxLjgwOSwxMi44NDcsNS40MjRsNTEuNjc4LDUxLjY3NGw1MS42NzYtNTEuNjc0YzMuNjEtMy42MTYsNy44OTgtNS40MjQsMTIuODQ3LTUuNDI0ICAgYzUuMTQxLDAsOS41MjEsMS44MDksMTMuMTM1LDUuNDI0bDI1LjY5MywyNS42OTNjMy42MTcsMy42MTcsNS40MjgsNy45OTQsNS40MjgsMTMuMTM0YzAsNC45NDgtMS44MTEsOS4yMzUtNS40MjgsMTIuODQ3ICAgbC01MS42NzUsNTEuNjc4TDMyMi42MjEsMjcwLjkzOXoiIGZpbGw9IiM1NTU1NTUiLz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8Zz4KPC9nPgo8L3N2Zz4K) no-repeat scroll center center transparent;
}

.typeahead__container.cancel:not(.loading) .typeahead__cancel-button {
  visibility: visible;
  opacity: 0.25;
  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=25)";
}

.physician {
  margin-bottom: 40px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  border-bottom: 1px solid #ccc;
  padding-bottom: 10px;
}
.physician.hide-loc .physician.hide-name .physician.hide-gender .physician.hide-type .physician.hide-lang {
  display: none;
}
.physician__link {
  color: #565a5d;
  -webkit-transition: color 0.25s;
  transition: color 0.25s;
}
.physician__link:hover .physician__link:focus {
  color: #000;
}
.physician__name {
  font-weight: 400;
  border: 0;
  text-transform: uppercase;
  margin-bottom: 10px;
  padding: 0 0 5px;
  font-size: 1.6em;
  font-weight: 700;
}
.physician__name a {
  text-decoration: none;
}
.physician__content {
  text-align: center;
}
.physician__img {
  margin: 0 auto 15px;
  position: relative;
  display: block;
  max-width: 166px;
}
.physician__img .physician__link {
  display: block;
}
.physician__info--full {
  float: none;
  width: 100%;
}
.physician__info p {
  line-height: 1.5;
  margin-bottom: 28px;
}
.physician__details {
  margin-bottom: 50px;
}
.physician__details__title {
  text-transform: none;
  font-weight: 400;
  color: #565a5d;
  border-bottom: 1px solid #c9c9c9;
  margin-bottom: 21px;
  padding-bottom: 19px;
}
.physician__details h3 {
  font-weight: 400;
}
.physician-detail__name {
  margin-bottom: 34px;
}
.physician-detail__img {
  margin-bottom: 15px;
  position: relative;
  display: block;
}
.physician-detail__img .physician__link {
  display: block;
}
.physician-detail__img img {
  margin-bottom: 20px;
  display: block;
}
.physician-detail__info p {
  line-height: 1.5;
  margin-bottom: 28px;
}

.physician-hero__img {
  width: 160px;
  height: 160px;
  margin: 0 auto 32px auto;
  overflow: hidden;
  border-radius: 50%;
}

.physician-hero__img img {
  display: block;
  margin: 0 auto;
}

.physician-hero__name {
  font-size: 2.4em;
  font-weight: 300;
  margin-bottom: 30px;
}

.physician-hero .btn {
  text-transform: none;
}

@media screen and (min-width: 480px) {
  .physician {
    -ms-flex: 1 0 49.5%;
    -webkit-box-flex: 1;
            flex: 1 0 49.5%;
    max-width: 49.5%;
    padding: 0 20px 20px;
  }
  .physician-list {
    display: -ms-flexbox;
    display: -webkit-box;
    display: flex;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
    -ms-flex-pack: start;
    -webkit-box-pack: start;
            justify-content: flex-start;
  }
}
@media screen and (min-width: 640px) {
  .physician-hero {
    text-align: center;
  }
  .physician-hero__name {
    font-size: 4.4em;
  }
}
@media screen and (min-width: 752px) {
  .physician-detail__img {
    float: left;
    width: 25%;
    margin-right: 5%;
    max-width: 166px;
    margin-bottom: 0;
  }
  .physician-detail__info {
    float: left;
    width: 71%;
  }
}
@media screen and (min-width: 768px) {
  .physician {
    -ms-flex-preferred-size: 33%;
    flex-basis: 33%;
    max-width: 33%;
  }
}
@media screen and (min-width: 992px) {
  .physician {
    -ms-flex-preferred-size: 24.5%;
    flex-basis: 24.5%;
    max-width: 24.5%;
  }
}
.physician-container {
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.physician-container .content, .physician-container .callout {
  max-width: 800px;
  margin: 0 auto;
}

.physician-hero {
  padding: 40px 0 10px;
  margin-bottom: 0px;
  position: relative;
}

.physician-lang {
  background: #f2f3f3;
  padding: 12px 18px;
  margin-bottom: 32px;
}

.physician-lang .physician-lang__title {
  margin: 0 10px 0 0;
  padding-top: 0;
  border: 0;
  display: inline-block;
  font-size: 1.6em;
  font-weight: 700;
}

.physician-lang .physician-lang__list {
  margin: 0;
  display: inline-block;
}

.physician-lang .physician-lang__list li {
  list-style: none;
  padding: 0 10px 0 12px;
  border: 1px solid #d8d9da;
  border-width: 0 0 0 1px;
  margin: 0;
  display: inline-block;
}

.physician-lang .physician-lang__list li:before {
  display: none;
}

.physician-lang .physician-lang__list li:first-of-type {
  border: 0;
  padding-left: 0;
}

.physician-info ul {
  margin: 15px 0 0;
}

.physician-info ul li {
  border: 0;
  margin: 0 0 12px 0;
  padding: 0;
  line-height: 1.4;
}

.physician-info ul li:before {
  display: none;
}

.physician_nav {
  padding: 10px 0;
  text-align: center;
  position: relative;
}
.physician_nav::after {
  content: "";
  position: absolute;
  bottom: -2em;
  left: 0;
  background: url(../../webimages/homeImg-shadow.png) no-repeat 50% 0;
  width: 100%;
  height: 16px;
  background-size: contain;
}
.physician_nav a {
  font-size: 15px;
  color: #979797;
  text-transform: capitalize;
  border-bottom: 2px solid transparent;
  padding-right: 0.4em;
  padding-left: 0.7em;
}
.physician_nav a:last-of-type::after {
  content: "";
}
.physician_nav a:hover {
  color: #6d276a;
  border-bottom-color: #6d276a;
}
.physician_nav a:hover::after {
  border-bottom: transparent;
  color: #979797;
}
.physician_nav a::after {
  content: "/";
  margin: 0 0.2em 0 0.4em;
  display: inline-block;
  position: absolute;
}

.physician-info.connect + * h2 {
  border: 0;
}

.physician-locations {
  position: relative;
  padding-top: 80px;
  margin-top: 50px;
}
.physician-locations:before, .physician-locations:after {
  content: "";
  position: absolute;
}
.physician-locations:before {
  content: "\e90c";
  font-family: "icons";
  font-size: 43px;
  padding-top: 20px;
  text-align: center;
  width: 80px;
  height: 80px;
  border-radius: 100%;
  background: #6d276a;
  color: #fff;
  top: 0;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.physician-locations--articles:before {
  content: "\e911";
}
.physician-locations--docs {
  padding-left: 30px;
  padding-right: 30px;
}
.physician-locations--docs:before {
  content: "\e913";
}
.physician-locations--resources:before, .physician-locations--resources:after, .physician-locations--feeds:before, .physician-locations--feeds:after {
  display: none;
}
.physician-locations--resources {
  padding: 0;
}
.physician-locations--feeds {
  background: #f2f3f3;
  margin-bottom: -50px;
  padding-bottom: 50px;
}
.physician-locations:after {
  top: 40px;
  left: 0;
  width: 100%;
  height: 3px;
  background: #e5e6e7;
}
.physician-locations__content {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-pack: center;
  -webkit-box-pack: center;
          justify-content: center;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-bottom: 40px;
}
.physician-locations__content--margin {
  margin: 0 -25px;
  -ms-flex-pack: start;
  -webkit-box-pack: start;
          justify-content: flex-start;
}

.physician-locations__content a:not(.btn) {
  display: block;
  color: #565a5d;
}

.physician-locations a:not(.btn):hover,
.physician-locations a:not(.btn):focus {
  background: #f2f3f3;
  color: #565a5d;
}

.physician-locations a:not(.btn):hover:after,
.physician-locations a:not(.btn):focus:after {
  height: 1px;
  background-color: inherit;
  color: #565a5d;
}

.physician-locations a:not(.btn):after {
  content: "";
  position: absolute;
  width: 100%;
  height: 1px;
  bottom: 0;
  left: 0;
  background: inherit;
  opacity: 0;
  -webkit-transition: all 0.25s;
  transition: all 0.25s;
}

h2.physician-locations__title {
  color: rebeccapurple;
  text-align: center;
  font-size: 2.1em;
  font-weight: 300;
  padding-top: 20px;
  border: 0;
  margin-top: 0px;
  margin-bottom: 27px;
}

@media screen and (min-width: 640px) {
  .physician-locations__content--home .news-card {
    -ms-flex: 0 1 calc(50% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(50% - 50px);
    -ms-flex-preferred-size: calc(50% - 50px);
    flex-basis: calc(50% - 50px);
    /* IE Fix ?? */
    max-width: none;
  }
  h2.physician-locations__title {
    font-size: 2.6em;
  }
}
@media screen and (min-width: 768px) {
  .physician-locations__content--home .news-card {
    -ms-flex: 0 1 calc(33% - 50px);
    -webkit-box-flex: 0;
            flex: 0 1 calc(33% - 50px);
    -ms-flex-preferred-size: calc(33% - 50px);
    flex-basis: calc(33% - 50px);
    /* IE Fix ?? */
    max-width: none;
  }
}
@media screen and (min-width: 1024px) {
  .physician-locations--resources {
    padding-bottom: 100px;
  }
}
.typeahead__list {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 1000;
  width: 100%;
  border: 1px solid #ccc;
  display: none;
}

.typeahead__list > li {
  border-top: solid 1px #ccc;
}

.typeahead__list > li:first-child {
  border-top: none;
}

.typeahead__container.result .typeahead__list, .typeahead__container.filter .typeahead__dropdown, .typeahead__container.hint .typeahead__hint, .typeahead__container.backdrop + .typeahead__backdrop {
  display: block !important;
}

.typeahead__list, .typeahead__dropdown {
  background: #f9f9f9;
  padding: 0;
  border-radius: 0;
}

.typeahead__list > li > a, .typeahead__dropdown > li > a {
  line-height: 1.5;
  padding: 10px 12px;
  color: #565a5d;
}

.typeahead__list > li > a strong, .typeahead__dropdown > li > a strong {
  color: #333;
}

.typeahead__list > li > a:hover, .typeahead__list > li > a:focus, .typeahead__list > li.active > a, .typeahead__dropdown > li > a:hover, .typeahead__dropdown > li > a:focus, .typeahead__dropdown > li.active > a {
  background-color: #e5e5e5;
}

.typeahead__list .typeahead__group a {
  color: #fff;
  background: #6d276a;
}

.typeahead__list .typeahead__group a:hover, .typeahead__list .typeahead__group a:focus {
  color: #fff;
  background: #6d276a;
}

.typeahead__list .typeahead__group[data-search-group^=Endoscopy] a {
  background: #b149ad;
}

.typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:hover, .typeahead__list .typeahead__group[data-search-group^=Endoscopy] a:focus {
  color: #fff;
  background: #b149ad;
}

.typeahead__container--location .typeahead__result ul {
  padding: 0;
}

.typeahead__container.cancel:not(.loading) .typeahead__cancel-button {
  top: 50%;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}

.typeahead__container--physician .typeahead__item {
  position: relative;
}

.typeahead__container--physician .typeahead__item a {
  padding: 10px 12px 10px 50px;
  min-height: 63px;
}

.typeahead__container--physician .typeahead__item img {
  position: absolute;
  height: auto;
  width: 30px;
  top: 15px;
  left: 10px;
}

.typeahead__container--physician.cancel:not(.loading) .icon-search {
  display: none;
}

.physician {
  margin-bottom: 40px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  border-bottom: 1px solid #ccc;
  padding-bottom: 10px;
}

.physician.hide-loc, .physician.hide-name, .physician.hide-gender, .physician.hide-type, .physician.hide-lang {
  display: none;
}

.physician__link {
  color: #565a5d;
  -webkit-transition: color 0.25s;
  transition: color 0.25s;
}

.physician__link:hover, .physician__link:focus {
  color: #000;
}

.physician__name {
  font-weight: 400;
  border: 0;
  text-transform: uppercase;
  margin-bottom: 10px;
  padding: 0 0 5px;
  font-size: 1.6em;
  font-weight: 700;
}

.physician__name a {
  text-decoration: none;
}

.physician__content {
  text-align: center;
}

.physician__img {
  margin: 0 auto 15px;
  position: relative;
  display: block;
  max-width: 166px;
}

.physician__img .physician__link {
  display: block;
}

.physician__info p {
  line-height: 1.5;
  margin-bottom: 28px;
}

.physician__details {
  margin-bottom: 50px;
}

.physician__details__title {
  text-transform: none;
  font-weight: 400;
  color: #565a5d;
  border-bottom: 1px solid #c9c9c9;
  margin-bottom: 10px;
  padding-bottom: 5px;
}

.physician__details h3 {
  font-weight: 400;
}

.physician-detail__name {
  margin-bottom: 34px;
}

.physician-detail__img {
  margin-bottom: 15px;
  position: relative;
  display: block;
}

.physician-detail__img img {
  margin-bottom: 20px;
  display: block;
}

.physician-detail__img .physician__link {
  display: block;
}

.physician-detail__info p {
  line-height: 1.5;
  margin-bottom: 28px;
}

.related {
  position: relative;
  padding: 0;
  margin-top: 0px;
  margin-bottom: 50px;
}
.related .related__header {
  font-weight: 300;
  font-size: 2.7em;
  text-align: center;
  position: relative;
  margin-bottom: 30px;
  padding-top: 42px;
  color: #6D276A;
  border-top-color: transparent;
  /* round icon 
  position: absolute;
      content: "";
      font-family: icons;
      font-size: 43px;
      padding-top: 15px;
      text-align: center;
      width: 75px;
      height: 75px;
      border-radius: 100%;
      background: #6d276a;
      color: #fff;
      top: -42px;
      left: 50%;
      transform: translateX(-50%);
      z-index: 1;
      box-sizing: border-box;
  */
  /* no icon 
   width: 100%;
        height: 1px;
        background: #565a5d;
        left: 0;
        top: calc(50% + 20px);
        transform: translateY(-50%);
        -webkit-backface-visibility: hidden;
        backface-visibility: hidden;
  */
}
.related .related__header::before {
  content: "";
  position: absolute;
  width: 100%;
  height: 1px;
  background: #e5e6e7;
  left: 0;
  top: calc(50% + 20px);
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
}
.related .related__header span {
  background: #fff;
  position: relative;
  z-index: 2;
  padding: 0 30px;
}
.related .related__header[class*=icon] {
  border-top-width: 2px;
  border-top-color: #e5e6e7;
  padding-top: 50px;
}
.related .related__header[class*=icon]::before {
  position: absolute;
  font-family: icons;
  font-size: 43px;
  padding-top: 15px;
  text-align: center;
  width: 75px;
  height: 75px;
  border-radius: 100%;
  background: #6d276a;
  color: #ececec;
  top: -42px;
  left: 50%;
  -webkit-transform: translateX(-50%);
          transform: translateX(-50%);
  z-index: 1;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.related--icon--related:before {
  font-family: "icons";
  content: "\e911" !important;
}
.related--icon--docs:before {
  font-family: "icons";
  content: "\e913" !important;
}
.related__content {
  display: -ms-flexbox;
  display: -webkit-box;
  display: flex;
  -ms-flex-pack: center;
  -webkit-box-pack: center;
          justify-content: center;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-bottom: 40px;
}
.related__content--margin {
  margin: 50px 0 0 0;
  -ms-flex-preferred-size: 100%;
      flex-basis: 100%;
  -ms-flex-pack: space-between;
  -webkit-box-pack: justify;
          justify-content: space-between;
}
.related__title {
  color: #6d276a;
  text-align: center;
  font-size: 2.1em;
  font-weight: 300;
  padding-top: 20px;
  border: 0;
  margin-bottom: 27px;
}
.related-card {
  background-color: #6D276A !important;
}
.related-card__title {
  color: white;
}

/*


.recent {
  position: relative;
  padding-top: 80px;
  margin-top: 50px;
  @extend .container;
  &:after,
  &:before {
    content: "";
    position: absolute;
  }
  // // &:before {
  // //   content: "\e90c";
  // //   font-family: icons;
  // //   font-size: 43px;
  // //   padding-top: 20px;
  // //   text-align: center;
  // //   width: 80px;
  // //   height: 80px;
  // //   border-radius: 100%;
  // //   background: #6d276a;
  // //   color: #fff;
  // //   top: 0;
  // //   left: 50%;
  // //   transform: translateX(-50%);
  // //   z-index: 1;
  // //   box-sizing: border-box;
  // // }
  // // &--articles:before {
  // //   content: "\e911";
  // // }
  // &--docs {
  //   padding-left: 30px;
  //   padding-right: 30px;
  // }
  // &--docs:before {
  //   content: "\e913";
  // }
  // &--feeds:after,
  // &--feeds:before,
  // &--resources:after,
  // &--resources:before {
  //   display: none;
  // }
  &--resources {
    padding: 0;
  }
  &--feeds {
    background: #f2f3f3;
    margin-bottom: -50px;
    padding-bottom: 50px;
  }
  &:after {
    top: 40px;
    left: 0;
    width: 100%;
    height: 3px;
    background: #e5e6e7;
  }
  &__content {
    display: -ms-flexbox;
    display: flex;
    -ms-flex-pack: center;
    justify-content: center;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
    margin-bottom: 40px;
  }
  &__content--margin {
    margin: 0;
      -ms-flex-pack: space-between;;
      justify-content: space-between;
  }
  &__title {
    color: #6d276a;
    text-align: center;
    font-size: 2.1em;
    font-weight: 300;
    padding-top: 20px;
    border: 0;
    margin-bottom: 27px;
  }

}


*/
.digestivecare.fullimage {
  background-size: cover;
  height: 28vw;
  background-position: top center;
  margin-bottom: 60px;
  background-repeat: no-repeat;
  max-height: 400px;
}
@media only screen and (max-width: 800px) {
  .digestivecare.fullimage {
    margin-bottom: 30px;
  }
}
@media only screen and (max-width: 500px) {
  .digestivecare.fullimage {
    margin-bottom: 0;
  }
}
.digestivecare_sections {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row wrap;
          flex-flow: row wrap;
}
.digestivecare_sections .item {
  margin: 0 20px 20px 20px;
  width: calc(25% - 40px);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
@media only screen and (max-width: 800px) {
  .digestivecare_sections .item {
    width: calc(50% - 40px);
  }
}
@media only screen and (max-width: 500px) {
  .digestivecare_sections .item {
    width: calc(100% - 40px);
    padding-top: 40px;
    margin-bottom: 40px;
    border-top: 1px solid #ececec;
    padding-top: 40px;
  }
  .digestivecare_sections .item:first-of-type {
    border-top-color: transparent;
  }
}
.digestivecare_sections .item .image {
  min-height: 112px;
  margin: 0;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin-bottom: 20px;
}
.digestivecare_sections .item .title {
  font-size: 2.2em;
  font-weight: 500;
  margin: 20px 0;
}
.digestivecare_sections .item .text {
  font-size: 1.6em;
  margin-bottom: 20px;
  line-height: 1.5em;
}
.digestivecare_sections .item .btn {
  margin-top: auto;
}

.accordionwrap {
  position: relative;
  padding: 20px 0;
  margin: 20px 0;
}
.accordionwrap::before, .accordionwrap::after {
  content: "";
  position: absolute;
  background: url(/webimages/homeImg-shadow.png) no-repeat 50% 0;
  width: 100%;
  height: 16px;
  background-size: contain;
}
.accordionwrap::before {
  top: 5px;
}
.accordionwrap::after {
  bottom: -10px;
}

.accordionBtn {
  font-size: 21px;
  min-height: 40px;
  font-weight: 300;
  cursor: pointer;
  background-color: transparent;
  color: #6d276a;
  text-align: left;
}

.accordionBtn svg {
  height: 20px;
  width: 20px;
  line-height: 20px;
  vertical-align: middle;
  padding: 1px;
  margin-right: 5px;
}

.accordionBtn[aria-expanded=true] svg .vert {
  fill: transparent;
}

.accordion dd {
  font-weight: 300;
  padding-left: 33px;
  margin-top: 0.5em;
  margin-right: 0.5em;
  margin-bottom: 0.75em;
  text-align: left;
  font-size: 0.95em;
}

.accordion dd a {
  color: #565a5d;
  font-weight: 500;
}
.accordion dd a:hover {
  text-decoration: underline;
}

.searchBar {
  position: absolute;
  right: 0px;
  top: 0;
  display: block;
}

.searchBar .icon-search:before {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
}

.searchBar__toggle {
  width: 60px;
  height: 50px;
  display: block;
  text-align: center;
  font-size: 2em;
  border: 1px solid #50164e;
  border-width: 0 0 0 1px;
  background: none;
  color: #fff;
  cursor: pointer;
  position: relative;
  z-index: 2;
  background: #6d276a;
}

.searchBar__toggle.open, .searchBar__toggle:hover, .searchBar__toggle:focus {
  outline: none;
  background: #50164e;
  color: #fff;
}

.searchBar__toggle.open + .searchBar__box {
  z-index: 2;
}

.searchBar__box {
  position: absolute;
  right: 0;
  min-width: 440px;
  top: 50px;
  z-index: 1;
  -webkit-transition: top 0.25s ease-in-out;
  transition: top 0.25s ease-in-out;
  display: none;
}

.searchBar__box input[type=search] {
  padding: 17px 10px;
  min-width: 380px;
  width: auto;
  border: 0;
  -webkit-box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
          box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
  float: left;
  margin: 0;
  color: #565a5d;
  font-size: 1.4em;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  min-height: 50px;
}

.searchBar__box input[type=text]:focus, .searchBar__box input[type=text]:hover {
  -webkit-box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #6d276a;
          box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #6d276a;
  outline: none;
}

.searchBar__box input[type=submit] {
  width: 61px;
  height: 50px;
  background: #fff;
  -webkit-box-shadow: 0 3px 5px 1px rgba(80, 80, 80, 0.2), inset 0px 0px 2px #56595d;
          box-shadow: 0 3px 5px 1px rgba(80, 80, 80, 0.2), inset 0px 0px 2px #56595d;
  border: 0;
  font-size: 1.4em;
  text-transform: lowercase;
  padding: 17px 9px;
  margin: 0px 0 0 -1px;
  cursor: pointer;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
  color: #56595d;
}

.searchBar__box input[type=submit]:focus, .searchBar__box input[type=submit]:hover {
  outline: none;
  background: #e5e5e5;
}

.onpageSearch h2 {
  border-top-color: transparent;
  padding-top: 0px;
}
.onpageSearch form .search-form {
  position: relative;
  display: block;
}
.onpageSearch form .search-form form {
  width: 100%;
}
.onpageSearch form .search-form input[type=search] {
  padding: 17px 10px;
  min-width: 380px;
  width: auto;
  border: 0;
  -webkit-box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
          box-shadow: 0 3px 5px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
  margin: 0;
  color: #565a5d;
  font-size: 1.4em;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  min-height: 50px;
}
.onpageSearch form .search-form input[type=submit] {
  width: 61px;
  height: 50px;
  background: #fff;
  -webkit-box-shadow: 0 3px 5px 1px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
          box-shadow: 0 3px 5px 1px rgba(80, 80, 80, 0.2), inset 0 0 2px #56595d;
  border: 0;
  font-size: 1.4em;
  text-transform: lowercase;
  padding: 17px 9px;
  margin: -5px 0 0 -3px;
  cursor: pointer;
  -webkit-transition: all 0.25s ease;
  transition: all 0.25s ease;
  color: #247f27;
  font-weight: 600;
}
.onpageSearch form .search-form input[type=submit]:focus, .onpageSearch form .search-form input[type=submit]:hover {
  outline: none;
  background: #e5e5e5;
}

/* Slideshow container */
.slideshow-container {
  max-width: 1000px;
  position: relative;
  margin: auto auto 10px;
  overflow: hidden;
  width: 220px;
  height: 160px;
  -webkit-box-shadow: 0px 2px 5px rgba(0, 0, 0, 0.3);
          box-shadow: 0px 2px 5px rgba(0, 0, 0, 0.3);
  /* Next & previous buttons */
}
.slideshow-container.large {
  width: 555px;
  height: 403px;
}
@media screen and (max-width: 554px) {
  .slideshow-container.large {
    width: 300px;
    height: 218px;
  }
}
.slideshow-container .slides {
  list-style: none;
  padding: 0px;
  margin: 0px;
  display: -ms-grid;
  display: grid;
  grid-auto-flow: column;
  width: inherit;
  height: inherit;
  position: absolute;
  -webkit-transition: all 0.1s linear;
  transition: all 0.1s linear;
}
.slideshow-container .slides .slide {
  width: inherit;
  height: inherit;
  background-size: cover;
  background-repeat: no-repeat;
  background-position: center;
}
.slideshow-container.multiple {
  width: auto;
  height: initial;
  aspect-ratio: 555/403;
}
.slideshow-container.multiple .slides {
  width: 100%;
  height: 100%;
}
.slideshow-container .prev,
.slideshow-container .next {
  cursor: pointer;
  position: absolute;
  top: 50%;
  width: auto;
  margin-top: -20px;
  color: white;
  font-size: 18px;
  -webkit-transition: 0.6s ease;
  transition: 0.6s ease;
  border-radius: 20px;
  -webkit-user-select: none;
     -moz-user-select: none;
      -ms-user-select: none;
          user-select: none;
  width: 30px;
  height: 30px;
  display: -webkit-box !important;
  display: -ms-flexbox !important;
  display: flex !important;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.slideshow-container .prev:hover,
.slideshow-container .next:hover {
  background-color: rgba(0, 0, 0, 0.8);
}
.slideshow-container .prev {
  left: 5px;
}
.slideshow-container .next {
  right: 5px;
}
.slideshow-container .dots {
  position: absolute;
  bottom: 5px;
  z-index: 10;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  left: 0;
  right: 0;
}
.slideshow-container .dots .dot {
  cursor: default;
  height: 8px;
  width: 8px;
  margin: 0 2px;
  background-color: #fff;
  border-radius: 50%;
  -webkit-transition: background-color 0.6s ease;
  transition: background-color 0.6s ease;
}
.slideshow-container .dots .dot.active {
  background-color: #000;
}

.modal {
  position: fixed;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: rgba(249, 247, 249, 0.8);
  z-index: 999;
  display: none;
}
.modal.show {
  display: block;
}
.modal .modal-close {
  position: absolute;
  top: 10px;
  right: 10px;
  width: 20px;
  height: 20px;
  border-radius: 50%;
  cursor: pointer;
}
.modal .modal-close:before, .modal .modal-close:after {
  content: "";
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
  width: 100%;
  height: 2px;
  background: #000;
}
.modal .modal-close:before {
  -webkit-transform: translate(-50%, -50%) rotate(45deg);
          transform: translate(-50%, -50%) rotate(45deg);
}
.modal .modal-close:after {
  -webkit-transform: translate(-50%, -50%) rotate(-45deg);
          transform: translate(-50%, -50%) rotate(-45deg);
}
.modal .modal-content {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
  background: #fff;
  padding: 20px;
  width: 80%;
  max-width: 600px;
  border-radius: 45px;
  -webkit-box-shadow: 0 0 10px rgba(0, 0, 0, 0.5);
          box-shadow: 0 0 10px rgba(0, 0, 0, 0.5);
  border-top: solid 40px #6d276a;
}
.modal .modal-content .modal-body {
  font-size: 18px;
  line-height: 1.5em;
  padding: 20px 20px;
}
@media screen and (max-width: 560px) {
  .modal .modal-content .modal-body {
    font-size: 14px;
    line-height: 1.2em;
  }
}
.modal .modal-content .modal-body .image {
  margin: 0px 50px 50px;
}
@media screen and (max-width: 560px) {
  .modal .modal-content .modal-body .image {
    margin: 0px 20px 20px;
  }
}
.modal .modal-content .modal-body p {
  margin-bottom: 20px;
}

.labhero {
  background-size: cover;
  background-repeat: no-repeat;
  margin-bottom: 60px;
}
@media only screen and (max-width: 768px) {
  .labhero {
    position: relative;
  }
}
.labhero:before {
  background: -webkit-gradient(linear, left top, left bottom, color-stop(60%, transparent), color-stop(80%, #fff));
  background: linear-gradient(to bottom, transparent 60%, #fff 80%);
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
}
@media only screen and (max-width: 768px) {
  .labhero:before {
    background: -webkit-gradient(linear, left top, left bottom, from(transparent), color-stop(80%, #fff));
    background: linear-gradient(to bottom, transparent 0%, #fff 80%);
    content: "";
  }
}
@media (max-width: 800px) {
  .labhero {
    background-position: 10%;
    background-size: auto;
  }
}
.labhero .labtext {
  padding-left: 55%;
  height: 425px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
@media only screen and (max-width: 768px) {
  .labhero .labtext {
    padding: 0;
    -webkit-box-pack: end;
        -ms-flex-pack: end;
            justify-content: flex-end;
  }
}
.labhero .labtext p {
  font-size: 2.4em;
  line-height: 1.5;
  color: #565a5d;
}
.labhero .labtext h1 {
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8rem;
  margin-bottom: 20px;
  margin-top: -5px;
}
@media only screen and (max-width: 768px) {
  .labhero .labtext h1 {
    font-size: 2.5rem;
  }
}

.lab ul li {
  margin: 0;
  padding-bottom: 5px;
  border-bottom: 0;
}
.lab .wp-block-separator {
  border-bottom: 0;
  border-top: 0.25px solid #979797;
}

.container--full {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row wrap;
          flex-flow: row wrap;
}

.whatwedo {
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
  background-color: #DDE5E9;
  padding: 50px 0;
  border-top: 2px solid #4CB053;
}
.whatwedo .title {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 100%;
          flex: 1 0 100%;
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8em;
  margin-bottom: 20px;
  margin-top: -5px;
  text-align: left;
}
.whatwedo .col {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 29%;
          flex: 1 1 29%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  padding: 0 1.5%;
  -ms-flex-positive: 1;
      flex-grow: 1;
}
.whatwedo .col:first-of-type {
  padding-left: 0;
}
.whatwedo .col:last-of-type {
  padding-right: 3%;
}
@media only screen and (max-width: 768px) {
  .whatwedo .col {
    -webkit-box-flex: 1;
        -ms-flex: 1 1 100%;
            flex: 1 1 100%;
    padding: 3%;
  }
}
.whatwedo .col h3 {
  font-size: 1.25em;
  margin-bottom: 1em;
}
.whatwedo .col .btn {
  margin-top: auto;
}

.labdiff {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row wrap;
          flex-flow: row wrap;
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
  background-color: #DDE5E9;
  padding: 50px 0;
}
.labdiff .title {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 100%;
          flex: 1 0 100%;
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8em;
  margin-bottom: 20px;
  margin-top: -5px;
  text-align: center;
}
.labdiff .col {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 29%;
          flex: 1 1 29%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  padding: 0 1.5%;
}
.labdiff .col:first-of-type {
  padding-left: 3%;
}
.labdiff .col:last-of-type {
  padding-right: 3%;
}
@media only screen and (max-width: 768px) {
  .labdiff .col {
    -webkit-box-flex: 1;
        -ms-flex: 1 1 100%;
            flex: 1 1 100%;
    padding: 3%;
  }
}
.labdiff .col h3 {
  border-bottom: 1px solid #4CB053;
  font-size: 1.25em;
  margin-bottom: 1em;
}
.labdiff a.btn {
  border: 1px solid #6D276A;
  background-color: #fff;
  padding: 1em 0.5em;
  color: #6D276A;
  font-size: 1em;
  margin-top: 30px;
  margin-bottom: 30px;
  -webkit-box-shadow: 1px 1px 4px 0px rgba(0, 0, 0, 0.3);
          box-shadow: 1px 1px 4px 0px rgba(0, 0, 0, 0.3);
  width: auto;
}
.labdiff a.btn:hover {
  background-color: whitesmoke;
}

.howitworks {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
  border-bottom: 2px solid #4CB053;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
@media (max-width: 970px) {
  .howitworks {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.howitworks .hiwcontent {
  width: 50%;
  padding: 50px 0;
}
@media (max-width: 970px) {
  .howitworks .hiwcontent {
    padding: 50px 30px;
    width: auto;
  }
}
.howitworks .hiwcontent h2,
.howitworks .hiwcontent p {
  max-width: 430px;
  margin: 0 auto;
}
@media (max-width: 460px) {
  .howitworks .hiwcontent h2,
  .howitworks .hiwcontent p {
    margin: 0 10px;
  }
}
.howitworks .hiwcontent h2 {
  font-size: 46px;
  font-weight: 300;
  padding-bottom: 34px;
}
@media (max-width: 970px) {
  .howitworks .hiwcontent h2 {
    padding-bottom: 15px;
  }
}
.howitworks .hiwcontent ul, .howitworks .hiwcontent ol {
  margin-top: 20px;
  padding: 0 0 0 20px;
}
.howitworks .hiwcontent .btn {
  font-size: inherit !important;
}
.howitworks .hiwimage {
  width: 50%;
  background-repeat: no-repeat;
  background-size: auto 100%;
  height: 1100px;
  background-position: center;
}
@media (max-width: 970px) {
  .howitworks .hiwimage {
    width: 100%;
    height: 600px;
  }
}
.howitworks .hiwimage img {
  width: 100%;
  vertical-align: bottom;
}

.expertteam {
  padding: 100px 0;
}
.expertteam .container, .expertteam .related, .expertteam .digestivecare_sections {
  width: 70%;
  max-width: 800px;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
}
@media only screen and (max-width: 768px) {
  .expertteam .container, .expertteam .related, .expertteam .digestivecare_sections {
    max-width: 100%;
    width: 100%;
    padding: 0 30px;
  }
}
.expertteam .container h2, .expertteam .related h2, .expertteam .digestivecare_sections h2 {
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8em;
  margin-bottom: 20px;
  margin-top: -5px;
}

.referral {
  background-color: #DDE5E9;
  padding: 50px 0;
}
.referral .container, .referral .related, .referral .digestivecare_sections {
  font-size: 1.6em;
  line-height: 1.5;
  color: #565a5d;
  width: 70%;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
@media only screen and (max-width: 768px) {
  .referral .container, .referral .related, .referral .digestivecare_sections {
    width: 100%;
    padding: 0 30px;
  }
}
.referral .container h2, .referral .related h2, .referral .digestivecare_sections h2 {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 100%;
          flex: 1 0 100%;
  font-weight: 300;
  color: #565a5d;
  font-size: 2.8em;
  margin-bottom: 20px;
  margin-top: -5px;
  text-align: center;
}
.referral .container p, .referral .related p, .referral .digestivecare_sections p {
  line-height: 2.5em;
}
.referral .container a, .referral .related a, .referral .digestivecare_sections a {
  color: currentColor;
  font-size: 1em;
  text-decoration: underline;
}

.cff-wrapper-ctn {
  background-color: transparent !important;
  padding: 0 !important;
}

#cff .cff-item {
  margin-bottom: 20px !important;
  background-color: #fff !important;
  padding: 10px !important;
  max-width: 350px;
  border: none !important;
}

#cff.cff-default-styles a {
  color: rgb(86, 90, 93) !important;
  font-weight: 700;
}

#cff .cff-text {
  font-size: 14px !important;
  line-height: 1.5;
}

.gform_wrapper.gravity-theme input[type=color],
.gform_wrapper.gravity-theme input[type=date],
.gform_wrapper.gravity-theme input[type=datetime-local],
.gform_wrapper.gravity-theme input[type=datetime],
.gform_wrapper.gravity-theme input[type=email],
.gform_wrapper.gravity-theme input[type=month],
.gform_wrapper.gravity-theme input[type=number],
.gform_wrapper.gravity-theme input[type=password],
.gform_wrapper.gravity-theme input[type=search],
.gform_wrapper.gravity-theme input[type=tel],
.gform_wrapper.gravity-theme input[type=text],
.gform_wrapper.gravity-theme input[type=time],
.gform_wrapper.gravity-theme input[type=url],
.gform_wrapper.gravity-theme input[type=week],
.gform_wrapper.gravity-theme select,
.gform_wrapper.gravity-theme textarea {
  font-size: 20px !important;
  padding: 15px !important;
}
.gform_wrapper.gravity-theme input[type=file] {
  padding: 10px;
  background-color: #f7f7f7;
}
.gform_wrapper.gravity-theme .gfield_label {
  margin: 0 0 5px !important;
}
.gform_wrapper.gravity-theme .gfield_radio .gchoice {
  padding: 10px;
  border: solid 1px #ccc;
  display: inline-block;
  white-space: nowrap;
}
.gform_wrapper.gravity-theme .gfield_radio .gchoice:hover {
  background-color: #f7f7f7;
}
.gform_wrapper.gravity-theme .gfield_radio .gchoice label {
  font-size: 18px !important;
  font-weight: bold;
}
.gform_wrapper.gravity-theme .gfield_radio .gchoice input {
  margin: 0;
}
.gform_wrapper.gravity-theme .gform_footer input[type=submit] {
  -webkit-transition: all 0.5s;
  transition: all 0.5s;
  background: #6d276a;
  border: 0;
  color: #f7f7f7;
  font-size: 16px;
  margin: 0;
  padding: 12px;
}
.gform_wrapper.gravity-theme .gform_footer input[type=submit]:hover {
  background: #c4c4c4;
  color: #787878;
}

.gform_validation_errors,
.gform_title {
  display: none;
}

.gfield {
  padding: 0 0 20px !important;
}
.gfield .gfield_label {
  font-size: 18px !important;
  line-height: 20px;
}
.gform_wrapper .gfield_validation_message,
.gform_wrapper .validation_message {
  padding: 10px !important;
}

.gform_confirmation_message {
  font-size: 20px;
}

.filters {
  background-color: #f5f5f5;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row;
          flex-flow: row;
  padding: 30px;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  gap: 20px;
}
@media screen and (max-width: 800px) {
  .filters {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.filters .field {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  position: relative;
  padding: 0 10px;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  width: calc(100% - 40px);
}
.filters .field input, .filters .field select {
  border: 2px solid #d2d2d2;
  line-height: 40px;
  font-size: 1.7em;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.filters .field select {
  padding: 5px 5px 5px 20px;
  position: relative;
}
.filters .field.actions {
  margin-top: 16px;
  width: 100px;
}
@media screen and (max-width: 1024px) {
  .filters .field.actions {
    width: auto;
  }
}
.filters .field.actions .btn {
  max-width: 100px;
  text-align: center;
}
.filters label {
  margin: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-flow: row;
          flex-flow: row;
  padding-left: 0;
  font-size: 1.7em;
  line-height: 1.2em;
}
@media screen and (max-width: 740px) {
  .filters .actions {
    padding: 35px 10px;
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
    margin: 0 auto;
    text-align: center;
  }
}

.pagination-new {
  margin: 40px 0 10px 20px;
}
.pagination-new ul {
  padding: 0;
  margin: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
      -ms-flex-direction: row;
          flex-direction: row;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.pagination-new ul li a,
.pagination-new ul li div {
  color: #565a5d;
  position: relative;
  min-width: 40px;
  height: 40px;
  margin: 0 5px;
  font-size: 1.6em;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  border-radius: 100%;
}
.pagination-new ul li a {
  cursor: pointer;
}
.pagination-new ul li a:hover {
  color: #fff;
  background-color: #565a5d;
}
.pagination-new ul li .current {
  color: #fff;
  background: #6d276a;
}